| Revision as of 18:24, 10 September 2011 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)← Previous edit |
Latest revision as of 21:31, 6 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (23 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 449573592 |
|
| Watchedfields = changed |
|
|
⚫ |
| Name = Procyanidin B1 |
| ⚫ |
| verifiedrevid = 318432786 |
|
|
⚫ |
| Reference = |
| ⚫ |
| Name = Proanthocyanidin B1 |
|
|
|
| ImageFile = procyanidin B1.svg |
| ⚫ |
| Reference = |
|
|
| ImageFile = procyanidin B1.svg |
|
| ImageName = Chemical structure of procyanidin B2 |
|
⚫ |
| ImageSize = 200px |
|
| ImageName = Chemical structure of proanthocyanidin B2 |
|
|
|
| IUPACName = -(4→8)- |
| ⚫ |
| ImageSize = 200px |
|
|
|
| SystematicName = (2''R'',2′''R'',3''R'',3′''S'',4''R'')-2,2′-Bis(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2''H'',2′''H''--3,3′,5,5′,7,7′-hexol |
|
| IUPACName = |
|
|
| OtherNames = Procyanidin B1<br>cis,trans′′-4,8′′-Bi-(3,3′,4′,5,7-Pentahydroxyflavane) |
|
| OtherNames = Procyanidin B1<br>cis,trans′′-4,8′′-Bi-(3,3′,4′,5,7-Pentahydroxyflavane) |
|
| Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 20315-25-7 |
|
|
| CASOther = |
|
| CASNo = 20315-25-7 |
|
| PubChem = 11250133 |
|
| CASNoOther = |
|
| SMILES = |
|
| PubChem = 11250133 |
|
|
| ChEBI = 75633 |
|
|
| ChEMBL = 504937 |
|
|
| ChemSpiderID = 9425166 |
|
|
| UNII = 0566J48E7X |
|
|
| SMILES = O1Cc2c(O)cc(O)c(3(O)(Oc4cc(O)cc(O)c34)c3ccc(O)c(O)c3)c2O1c1ccc(O)c(O)c1 |
|
|
| StdInChI = 1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m0/s1 |
|
|
| StdInChIKey = XFZJEEAOWLFHDH-UKWJTHFESA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>30</sub>H<sub>26</sub>O<sub>12</sub> |
|
| Formula = C<sub>30</sub>H<sub>26</sub>O<sub>12</sub> |
|
| MolarMass = 578.52 g/mol |
|
| MolarMass = 578.52 g/mol |
|
|
| Appearance= |
|
| ExactMass = 578.142426 u |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPtC= |
|
| MeltingPtC= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Proanthocyanidin B1'''<ref></ref> is a ]. |
|
'''Procyanidin B1'''<ref></ref> is a ]. |
|
|
|
|
|
It is a molecule with a 4→8 bond (]-(4β→8)-]).<ref></ref> Proanthocyanidin-B1 can be found in '']'' (Ceylon cinnamon, in the rind, bark or cortex), in '']'' (Cat's claw, in the root), and in '']'' (Common grape vine, in the leaf).<ref></ref> |
|
It is a molecule with a 4→8 bond (]-(4β→8)-]).<ref></ref> Proanthocyanidin-B1 can be found in '']'' (Ceylon cinnamon, in the rind, bark or cortex), in '']'' (cat's claw, in the root), and in '']'' (common grape vine, in the leaf)<ref></ref> or in ].<ref>Postharvest sensory and phenolic characterization of ‘Elegant Lady’ and ‘Carson’ peaches. Rodrigo Infante, Loreto Contador, Pía Rubio, Danilo Aros and Álvaro Peña-Neira, Chilean Journal of Agricultural Research, 71(3), July–September 2011, pages 445-451 ()</ref> |
|
|
|
|
|
|
Procyanidin B1 can be converted into ] by radical oxidation using ] (DPPH) radicals under neutral conditions.<ref>Conversion of procyanidin B-type (catechin dimer) to A-type: evidence for abstraction of C-2 hydrogen in catechin during radical oxidation. Kazunari Kondo, Masaaki Kurihara, Kiyoshi Fukuhara, Takashi Tanaka, Takashi Suzuki, Naoki Miyata and Masatake Toyoda, Tetrahedron Letters, 22 January 2000, Volume 41, Issue 4, Pages 485–488, {{doi|10.1016/S0040-4039(99)02097-3}}</ref> |
| ⚫ |
==References== |
|
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{procyanidin}} |
|
{{proanthocyanidin}} |
|
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |