| Revision as of 14:23, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456794689 of page Profenamine for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 05:14, 12 September 2023 edit CrafterNova (talk | contribs)Extended confirmed users16,639 edits decluttered the lead. Only the most common trade name should be mentioned in the leadTags: Mobile edit Mobile web edit Advanced mobile edit |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 464215203 |
|
| Watchedfields = changed |
|
|
⚫ |
| IUPAC_name = ''N'',''N''-Diethyl-1-(10''H''-phenothiazin-10-yl)propan-2-amine |
| ⚫ |
| verifiedrevid = 416041182 |
|
| ⚫ |
| IUPAC_name = ''N'',''N''-diethyl-1-(10''H''-phenothiazin-10-yl)propan-2-amine |
|
|
| image = Profenamine.svg |
|
| image = Profenamine.svg |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Parsidol, Parsidan, Parkisol, Parkin |
|
| Drugs.com = {{drugs.com|international|profenamine}} |
|
| Drugs.com = {{drugs.com|international|profenamine}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| Line 15: |
Line 13: |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| protein_bound = 93% |
|
| protein_bound = 93% |
|
| elimination_half-life = 1 to 2 hours |
|
| elimination_half-life = 1 to 2 hours |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7181 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|CAS}} |
|
| CAS_number = 1094-08-2 |
|
| CAS_number = 522-00-9 |
|
| ATC_prefix = N04 |
|
| ATC_prefix = N04 |
|
| ATC_suffix = AA05 |
|
| ATC_suffix = AA05 |
| Line 31: |
Line 27: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 3174 |
|
| ChemSpiderID = 3174 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII = O00T1I1VRN |
|
| UNII = 7WI4P02YN1 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 313639 |
|
| ChEBI = 313639 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1206 |
|
| ChEMBL = 1206 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=24 | N=2 | S=1 |
|
| C=19 | H=24 | N=2 | S=1 |
|
| molecular_weight = 312.473 g/mol |
|
|
| smiles = S2c1ccccc1N(c3c2cccc3)CC(N(CC)CC)C |
|
| smiles = S2c1ccccc1N(c3c2cccc3)CC(N(CC)CC)C |
|
| InChI = 1/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3 |
|
|
| InChIKey = CDOZDBSBBXSXLB-UHFFFAOYAV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3 |
|
| StdInChI = 1S/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3 |
| Line 49: |
Line 41: |
|
| StdInChIKey = CDOZDBSBBXSXLB-UHFFFAOYSA-N |
|
| StdInChIKey = CDOZDBSBBXSXLB-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Profenamine''' (]; also known as '''ethopropazine''' (]); solde under the trade name '''Parsidol''' and others) is a ] ] used as an ] agent<ref>{{Cite web | url = https://www.drugs.com/international/profenamine.html | title = Prefenamine | publisher = ]}}</ref><ref>{{cite book | vauthors = Morton IK, Hall JM | chapter = Ethopropazine | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA115 | page = 115 |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391}}</ref> that has ], ], and ] actions. It is also used in the alleviation of the ] induced by drugs such as other phenothiazine compounds, but, like other compounds with antimuscarinic properties, is of no value against ]. |
|
|
|
|
|
==Synthesis== |
|
|
For promoting bone growth:<ref>Debra Ellies, William Rosenberg, {{Cite patent|WO|2010025135}} (2010 to Osteogenex Inc.).</ref> |
|
|
] |
|
|
|
|
|
The alkylation between phenothiazine ('''1''') and 1-Diethylamino-2-chloropropane ('''2''') in the presence of Sodium amide gives ethopropazine ('''3'''). |
|
|
|
|
|
*The ] salt helps to rationalize why a rearrangement product is observed (ala methadone). This was also observewd for ]. |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Antiparkinson}} |
|
|
{{Navboxes |
|
|
| title = ] |
|
|
| titlestyle = background:#ccccff |
|
|
| list1 = |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
|
{{Adrenergic receptor modulators}} |
|
|
{{Histamine receptor modulators}} |
|
|
{{Muscarinic acetylcholine receptor modulators}} |
|
|
}} |
|
|
{{Tricyclics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |