| Revision as of 14:34, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455524509 of page Propidium_iodide for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 01:27, 13 December 2024 edit Innerstream (talk | contribs)Autopatrolled, Extended confirmed users3,896 editsmNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 464216583 |
|
| Verifiedfields = changed |
|
|
⚫ |
| ImageFile=Propidium iodide.svg |
| ⚫ |
| verifiedrevid = 439273118 |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|ImageFile=Propidium iodide.png |
|
|
⚫ |
| IUPACName= |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| OtherNames= |
| ⚫ |
|IUPACName= |
|
| ⚫ |
|OtherNames= |
|
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 94732 |
|
| ChemSpiderID = 94732 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 345124 |
|
| ChEMBL = 345124 |
|
| InChI = 1/C27H33N4.2HI/c1-4-31(3,5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20;;/h6-8,10-15,18-19,29H,4-5,9,16-17,28H2,1-3H3;2*1H/q+1;;/p-1 |
|
| InChI = 1/C27H33N4.2HI/c1-4-31(3,5-2)17-9-16-30-26-19-22(29)13-15-24(26)23-14-12-21(28)18-25(23)27(30)20-10-7-6-8-11-20;;/h6-8,10-15,18-19,29H,4-5,9,16-17,28H2,1-3H3;2*1H/q+1;;/p-1 |
| Line 20: |
Line 18: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=25535-16-4 |
|
| CASNo=25535-16-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=104981 |
|
|
|
| UNII = TP416O228T |
| ⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
⚫ |
| PubChem=104981 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 51240 |
|
| ChEBI = 51240 |
|
| SMILES = CC(C)(CC)CCC1c2cc(ccc2c3ccc(cc3c1c4ccccc4)N)N.. |
|
| SMILES = CC(C)(CC)CCC1c2cc(N)ccc2c3ccc(N)cc3c1c4ccccc4.. |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>27</sub>H<sub>34</sub>I<sub>2</sub>N<sub>4</sub> |
|
| Formula=C<sub>27</sub>H<sub>34</sub>I<sub>2</sub>N<sub>4</sub> |
|
| MolarMass=668.3946 |
|
| MolarMass=668.3946 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Propidium iodide''' (or '''PI''') is a ] ] that can be used to ] ] and ]. PI binds to DNA by intercalating between the bases with little or no sequence preference. When in an aqueous solution, PI has a fluorescent excitation maximum of 493 nm (blue-green), and an emission maximum of 636 nm (red). After binding DNA, the ] of PI is enhanced 20-30 fold, and the excitation/emission maximum of PI is shifted to 535 nm (green) / 617 nm (orange-red).<ref>{{cite web |url=https://www.thermofisher.com/us/en/home/life-science/cell-analysis/fluorophores/propidium-iodide.html |title=Propidium Iodide |author=<!--Not stated--> |date=2019-11-14 |publisher=Thermo Fisher Scientific |access-date=2019-11-14 }}</ref> Propidium iodide is used as a DNA stain in ] to ] or DNA content in ], <ref>{{cite web|url=http://www.biolegend.com/propidium-iodide-solution-2651.html|title=Propidium Iodide Solution - BioLegend|access-date=10 January 2015|archive-url=https://web.archive.org/web/20150210095844/http://www.biolegend.com/propidium-iodide-solution-2651.html|archive-date=10 February 2015|url-status=dead}}</ref> or in microscopy to visualize the nucleus and other DNA-containing organelles. Propidium Iodide is not membrane-permeable, making it useful to differentiate ], ] and healthy cells based on membrane integrity.<ref>{{cite journal |author=Lecoeur H |title=Nuclear apoptosis detection by flow cytometry: influence of endogenous endonucleases |journal=Exp. Cell Res. |volume=277 |issue=1 |pages=1–14 |year=2002 |pmid=12061813 |doi=10.1006/excr.2002.5537}}</ref><ref>{{cite web|title=Propidium Iodide|url=https://www.thermofisher.com/order/catalog/product/P1304MP|publisher=ThermoFisher}}</ref> PI also binds to ], necessitating treatment with nucleases to distinguish between RNA and DNA staining.<ref>{{cite journal|vauthors=Suzuki T, Fujikura K, Higashiyama T, Takata K|date=1 January 1997|title=DNA staining for fluorescence and laser confocal microscopy|journal=J. Histochem. Cytochem.|volume=45|issue=1|pages=49–53|doi=10.1177/002215549704500107|pmid=9010468|doi-access=free}}</ref> PI is widely used in fluorescence staining and visualization of the plant cell wall.<ref name=Bidhendi2020>{{cite journal|last1=Bidhendi|first1=AJ|last2=Chebli|first2=Y|last3=Geitmann|first3=A|title=Fluorescence Visualization of Cellulose and Pectin in the Primary Plant Cell Wall|journal=Journal of Microscopy|volume=278 |issue=3 |pages=164–181|date=May 2020|doi=10.1111/jmi.12895|pmid=32270489|s2cid=215619998}}</ref><br /> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Propidium Iodide}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |