| Revision as of 11:49, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 464219441 of page Proscillaridin for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 15:38, 5 November 2024 edit CurtisEColwell (talk | contribs)138 editsm Cleaned SMILESTag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 447609232 |
|
| verifiedrevid = 464375437 |
|
| IUPAC_name = 5-phenanthren- 17-yl]- 2''H''-pyran- 2-one<br />OR<br />3β-Rhamnosido- 14β-hydroxybufa- 4,20,22-trienolide |
|
| IUPAC_name = 5-phenanthren-17-yl]-2''H''-pyran-2-one |
|
| image = Proscillaridin.png |
|
| image = Proscillaridin structure.svg |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 19: |
Line 20: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 466-06-8 --> |
|
| CAS_number = 466-06-8 |
|
| ATC_prefix = C01 |
|
| ATC_prefix = C01 |
|
| ATC_suffix = AB01 |
|
| ATC_suffix = AB01 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 600325 |
|
| ChEMBL = 600325 |
|
| PubChem = 5284613 |
|
| PubChem = 5284613 |
| Line 31: |
Line 32: |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = KC6BL281EN |
|
| UNII = KC6BL281EN |
|
|
| synonyms = 14β-Hydroxy-3β-bufa-4,20,22-trienolide |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=30 | H=42 | O=8 |
|
| C=30 | H=42 | O=8 |
|
⚫ |
| smiles = O=C1OC=C(2CC3(2(CC43CCC5=C(CC54C)O6O(C)((6O)O)O)C)O)C=C1 |
|
| molecular_weight = 530.650 |
|
| ⚫ |
| smiles = O=C\1O\C=C(/C=C/1)2CC6(O)2(C)CC56CC/C4=C/(O3O((O)(O)3O)C)CC45C |
|
|
| InChI = 1/C30H42O8/c1-16-24(32)25(33)26(34)27(37-16)38-19-8-11-28(2)18(14-19)5-6-22-21(28)9-12-29(3)20(10-13-30(22,29)35)17-4-7-23(31)36-15-17/h4,7,14-16,19-22,24-27,32-35H,5-6,8-13H2,1-3H3/t16-,19-,20+,21-,22+,24-,25+,26+,27-,28-,29+,30-/m0/s1 |
|
|
| InChIKey = MYEJFUXQJGHEQK-ALRJYLEOBX |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C30H42O8/c1-16-24(32)25(33)26(34)27(37-16)38-19-8-11-28(2)18(14-19)5-6-22-21(28)9-12-29(3)20(10-13-30(22,29)35)17-4-7-23(31)36-15-17/h4,7,14-16,19-22,24-27,32-35H,5-6,8-13H2,1-3H3/t16-,19-,20+,21-,22+,24-,25+,26+,27-,28-,29+,30-/m0/s1 |
|
| StdInChI = 1S/C30H42O8/c1-16-24(32)25(33)26(34)27(37-16)38-19-8-11-28(2)18(14-19)5-6-22-21(28)9-12-29(3)20(10-13-30(22,29)35)17-4-7-23(31)36-15-17/h4,7,14-16,19-22,24-27,32-35H,5-6,8-13H2,1-3H3/t16-,19-,20+,21-,22+,24-,25+,26+,27-,28-,29+,30-/m0/s1 |
| Line 43: |
Line 42: |
|
| StdInChIKey = MYEJFUXQJGHEQK-ALRJYLEOSA-N |
|
| StdInChIKey = MYEJFUXQJGHEQK-ALRJYLEOSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Proscillaridin''' is a ], a kind of drug that can be used in the treatment of ] and ] (irregular heartbeat). It is of the ] type and can be obtained from plants of the genus '']'' and in '']'' (''Scilla maritima'').<ref>{{cite journal | vauthors = Kedra M, Kedrowa S | title = | journal = Polski Tygodnik Lekarski | volume = 23 | issue = 19 | pages = 714–6 | date = May 1968 | pmid = 4876207 }}</ref> |
|
|
|
|
|
The ] of proscillaridin is ]. |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Cardiac glycosides}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{cardiovascular-drug-stub}} |