| Revision as of 09:16, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 02:58, 31 May 2024 edit undoBlainster (talk | contribs)Extended confirmed users, Pending changes reviewers34,705 edits →top: add short description; improve grammarTags: Mobile edit Mobile app edit Android app edit |
| (37 intermediate revisions by 26 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Ginseng plant extract}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 380810600 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Protopanaxadiol.png |
|
|
⚫ |
| verifiedrevid = 424828849 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
|ImageFile=Protopanaxadiol.svg |
| ⚫ |
|IUPACName=(3''S'',5''R'',8''R'',9''R'',10''R'',12''R'',13''R'',14''R'',17''S'')-17--4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1''H''-cyclopentaphenanthrene-3,12-diol |
|
|
⚫ |
| ImageSize=200px |
|
|OtherNames= Dammar-24-ene-3β,12β,20-triol |
|
| IUPACName=Dammar-24-ene-3β,12β,20-triol |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| SystematicName=(1''S'',3a''R'',3b''R'',5a''R'',7''S'',9a''R'',9b''R'',11''R'',11a''R'')-1--3a,3b,6,6,9a-pentamethylhexadecahydro-1''H''-cyclopentaphenanthene-7,11-diol |
| ⚫ |
| Abbreviations = PPD |
|
|
|
| OtherNames= |
| ⚫ |
| CASNo=7755-01-3 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=11213350 |
|
|
⚫ |
| Abbreviations = PPD |
| ⚫ |
| SMILES=CC(=CCC(C)(1CC2(1(C32(CC43(CC(C4(C)C)O)C)C)O)C)O)C |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=7755-01-3 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C20715 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = P6717R7BP8 |
|
⚫ |
| PubChem = 9920281 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8095918 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 375563 |
|
⚫ |
| SMILES=CC(=CCC(C)(1CC2(1(C32(CC43(CC(C4(C)C)O)C)C)O)C)O)C |
|
|
| InChI = 1/C30H52O3/c1-19(2)10-9-14-30(8,33)20-11-16-29(7)25(20)21(31)18-23-27(5)15-13-24(32)26(3,4)22(27)12-17-28(23,29)6/h10,20-25,31-33H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24-,25-,27-,28+,29+,30+/m0/s1 |
|
|
| InChIKey = PYXFVCFISTUSOO-VUFVRDRTBZ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C30H52O3/c1-19(2)10-9-14-30(8,33)20-11-16-29(7)25(20)21(31)18-23-27(5)15-13-24(32)26(3,4)22(27)12-17-28(23,29)6/h10,20-25,31-33H,9,11-18H2,1-8H3/t20-,21+,22-,23+,24-,25-,27-,28+,29+,30+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PYXFVCFISTUSOO-VUFVRDRTSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 76237 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=30|H=52|O=3 |
|
| C=30 | H=52 | O=3 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Protopanaxadiol''' (PPD) is an organic coumpound characterizing a group of ]s. It is a ]-type tetracyclic ] ] found in ] (''Panax ginseng'') and in ] (''Panax pseudoginseng'').<ref>{{cite journal | author = Shibata, S.; Tanaka, O.; Sado, M.; Tsushima, S. | title = The genuine sapogenin of ginseng | journal = Tetrahedron Letters | year = 1963 | issue = 12 | pages = 795–800 | doi = 10.1016/S0040-4039(01)90718-X | volume = 4}}</ref><ref>{{cite journal | author = Tanaka, O.; Nagai, M.; Shibata, S. | title = Stereochemistry of protopanaxadiol, a genuine sapogenin of ginseng | journal = Tetrahedron Letters | year = 1964 | issue = 33-34 | pages = 2291–7 | doi = 10.1016/S0040-4039(00)71705-9 | volume = 5}}</ref> |
|
'''Protopanaxadiol''' (PPD) is an organic compound that is an ] of ]s, a group of ]s. It is a ]-type tetracyclic ] ] found in ] (''Panax ginseng'') and in ] (''Panax pseudoginseng'').<ref>{{cite journal |author1=Shibata, S. |author2=Tanaka, O. |author3=Sado, M. |author4=Tsushima, S. | title = The genuine sapogenin of ginseng | journal = Tetrahedron Letters | year = 1963 | issue = 12 | pages = 795–800 | doi = 10.1016/S0040-4039(01)90718-X | volume = 4}}</ref><ref>{{cite journal |author1=Tanaka, O. |author2=Nagai, M. |author3=Shibata, S. | title = Stereochemistry of protopanaxadiol, a genuine sapogenin of ginseng | journal = Tetrahedron Letters | year = 1964 | issue = 33–34 | pages = 2291–7 | doi = 10.1016/S0040-4039(00)71705-9 | volume = 5}}</ref> |
|
|
|
|
|
The health effect of protopanaxadiol inside the human body is still unclear. One study suggests it has rapid, non-genomic effects on ]s, binding to the ] and ]. The study also showed an increase in intracellular calcium ion concentration.<ref name=LEUNG>{{cite journal|last=Leung|title=Protopanaxadiol and protopanaxatriol bind to glucocorticoid and oestrogen receptors in endothelial cells|journal=British Journal of Pharmacology|volume=156|issue=4|pages=626–637|display-authors=etal|doi=10.1111/j.1476-5381.2008.00066.x|pmid=19226254|pmc=2697710|year=2009}}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
| ⚫ |
{{alcohol-stub}} |
|
|
|
|
|
|
⚫ |
{{alcohol-stub}} |
| ⚫ |
] |
|
| ⚫ |
] |
|