| Revision as of 12:13, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 401379499 of page Pyrrolidonyl-beta-naphthylamide for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 01:06, 5 April 2024 edit Innerstream (talk | contribs)Autopatrolled, Extended confirmed users4,032 editsmNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 401037297 |
|
| verifiedrevid = 464377852 |
| ⚫ |
|Name=Pyrrolidonyl-''beta''-naphthylamide |
|
|
|ImageFile=Pyrrolidonylbetanaphthylamide.png |
|
| ImageFile=Pyrrolidonyl-β-naphthylamide.svg |
|
|ImageSize= |
|
| ImageSize=200px |
|
|IUPACName=''N''-(2-Naphthyl)-5-oxo-2-pyrrolidinecarboxamide |
|
| IUPACName=''N''<sup>1</sup>-(Naphthalen-2-yl)-5-oxo-<small>L</small>-prolinamide |
|
|
| SystematicName=(2''S'')-''N''-(Naphthalen-2-yl)-5-oxopyrrolidine-2-carboxamide |
|
|OtherNames= |
|
|
⚫ |
| OtherNames=Pyrrolidonyl-''beta''-naphthylamide |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 81932 |
|
| ChemSpiderID = 81932 |
|
| InChI = 1/C15H14N2O2/c18-14-8-7-13(17-14)15(19)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,16,19)(H,17,18) |
|
| InChI = 1/C15H14N2O2/c18-14-8-7-13(17-14)15(19)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,16,19)(H,17,18) |
| Line 16: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BZEPQNMASTUAMY-UHFFFAOYSA-N |
|
| StdInChIKey = BZEPQNMASTUAMY-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 22155-91-5 --> |
|
|
|
| CASNo=22155-91-5 |
| ⚫ |
| PubChem=90745 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = O=C(Nc2cc1ccccc1cc2)C3NC(=O)CC3 |
|
|
|
| UNII = 6G5U8A2YEH |
|
⚫ |
| PubChem=90745 |
|
⚫ |
| SMILES = O=C(Nc2cc1ccccc1cc2)C3NC(=O)CC3 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 | H=14 | N=2 | O=2 |
|
| Formula=C<sub>15</sub>H<sub>14</sub>N<sub>2</sub>O<sub>2</sub> |
|
|
|
| Appearance= |
|
| MolarMass=254.28386 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Pyrrolidonyl-β-naphthylamide''' (PYR) is a molecule used in ] to detect the presence of ].<ref>{{Cite journal | doi = 10.1016/0732-8893(86)90055-6| title = Value of the l-pyrrolidonyl-β-naphthylamide hydrolysis test for identification of select gram-positive cocci| journal = Diagnostic Microbiology and Infectious Disease| volume = 4| pages = 43–47| year = 1986| last1 = Oberhofer| first1 = Thomas R.}}</ref> In the presence of bacteria with pyrrolidonyl peptidase, it is broken down to ] and ]. To detect this process, ] is added and a change to a pink color can then be detected. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
{{Clinical microbiology techniques}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{heterocyclic-stub}} |