| Revision as of 12:22, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 422660633 of page Quinizarine_Green_SS for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 08:50, 26 May 2023 edit User-duck (talk | contribs)Extended confirmed users36,657 edits Cite CE. |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401038222 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Quinizarine Green SS |
|
|
⚫ |
| verifiedrevid = 464378746 |
|
| ImageFile = Quinizarine Green SS.png |
|
|
⚫ |
| Name = Quinizarine Green SS |
|
| Image Size = 200px |
|
|
| Image Name = Quinizarine Green SS |
|
| ImageFile = Quinizarine Green SS.png |
|
|
| ImageSize = |
|
| IUPAC Name = Quinizarine Green SS |
|
|
| Other Names = C.I. Solvent Green 3; |
|
| ImageName = Quinizarine Green SS |
|
|
| PIN = 1,4-Bis(4-methylanilino)anthracene-9,10-dione |
|
1,4-bis-9,10-Anthracenedione; D & C Green No.6; 1,4-Bis(p-tolylamino)anthraquinone; 1,4-Bis(p-toluidino)anthraquinone; C.I. 61565; Oil Green G; |
|
| OtherNames = C.I. Solvent Green 3; 1,4-bis-9,10-Anthracenedione; D & C Green No.6; 1,4-Bis(p-tolylamino)anthraquinone; 1,4-Bis(p-toluidino)anthraquinone; C.I. 61565; Oil Green G; |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| SMILES = O=C2c1ccccc1C(=O)c3c2c(ccc3Nc4ccc(cc4)C)Nc5ccc(cc5)C |
|
| SMILES = O=C2c1ccccc1C(=O)c3c2c(ccc3Nc4ccc(cc4)C)Nc5ccc(cc5)C |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 29146 |
|
| ChemSpiderID = 29146 |
|
| PubChem = 31416 |
|
| PubChem = 31416 |
| Line 20: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = TVRGPOFMYCMNRB-UHFFFAOYSA-N |
|
| StdInChIKey = TVRGPOFMYCMNRB-UHFFFAOYSA-N |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CasNO = 128-80-3 |
|
| CASNo = 128-80-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| RTECS = |
|
|
|
| UNII = 4QP5U84YF7 |
|
⚫ |
| RTECS = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|C=28|H=22|N=2|O=2 |
|
| C=28 | H=22 | N=2 | O=2 |
|
|
| Appearance = Black powder<ref name=chemicalland21></ref> |
|
| Appearance = Black Powder |
|
|
| Density = |
|
| Density = |
|
| Solubility = Insoluble |
|
| Solubility = Insoluble<ref name=chemicalland21/> |
|
| MeltingPt = 220-221 °C |
|
| MeltingPtC = 220 to 221 |
|
|
| MeltingPt_ref = <ref name=chemicalland21/> |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
|
| GHSPictograms = |
|
| RPhrases = {{R36/37/38}} |
|
|
|
| GHSSignalWord = |
|
| SPhrases = {{S26}}, {{S36}} |
|
|
|
| HPhrases = |
| ⚫ |
}} |
|
|
|
| PPhrases = |
| ⚫ |
| Section8 = {{Chembox Related |
|
|
| OtherCpds = |
|
| GHS_ref = |
|
}} |
|
}} |
|
⚫ |
|Section8={{Chembox Related |
|
|
| OtherCompounds = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Quinizarine Green SS''', also called '''Solvent Green 3''' is an ] derivative. It is a black powder that is soluble in polar organic solvents, but insoluble in water. It is used as a dye for adding greenish coloring to ] and medications. It is used in some ] formulations. |
|
|
|
|
|
According to ], the anthroquinone portion of the molecule is planar. Both ] protons form ]s to the carbonyls.<ref>{{cite journal |author1=T.Saito |author2=Chong-yang Liu |author3=V.M. Lynch |author4=A.J. Bard |title=Orientational Dependence of the Color and Photoconductivity of 1,4-Di-p-toluidinoanthraquinone Single Crystals |journal=Chem. Mater. |year=1997 |volume=210 |issue=6 |page=1318 |doi=10.1021/cm960652f}}</ref> |
|
|
] |
|
|
|
|
|
This dye is a component in some ]s, and questions have been raised about its toxicity.<ref>{{cite book |url=https://nap.edu/read/9645/chapter/1 |title=Toxicity of Military Smokes and Obscurants |year=1999 |doi=10.17226/9645 |pmid=25077233 |isbn=978-0-309-06599-3 |author1=National Research Council (US) Subcommittee on Military Smokes Obscurants }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |