| Revision as of 12:23, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 450287830 of page Quinoline_Yellow_SS for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 20:30, 16 July 2024 edit حسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Indandiones; added Category:1,3-Indandiones using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 450286527 |
|
| verifiedrevid = 464378819 |
|
| Name = Quinoline Yellow SS |
|
| Name = Quinoline Yellow |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile = Quinoline Yellow SS.png |
|
| ImageFile = Quinoline Yellow SS.svg |
|
| ImageSize = 200px |
|
|
| ImageName = |
|
| ImageName = |
|
| IUPACName = |
|
| ImageFile1 = |
|
|
| IUPACName = |
|
| OtherNames = Quinoline Yellow, spirit soluble; Solvent Yellow 33; C.I. Solvent Yellow 33; FD&C Yellow #11; Quinoline Yellow A; Quinoline yellow for microscopy; Yellow No. 204; C.I. 47000 |
|
| OtherNames = Quinoline Yellow, spirit soluble; Solvent Yellow 33; C.I. Solvent Yellow 33; D&C Yellow #10; Quinoline Yellow A; Quinoline yellow for microscopy; Yellow No. 204; C.I. 47000 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 8003-22-3 |
|
| CASNo = 8003-22-3 |
|
|
| Beilstein = 1536880 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 44F3HYL954 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 6475 |
|
| ChemSpiderID = 6475 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 53700 |
|
| ChEBI = 53700 |
|
|
| PubChem = 6731 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H11NO2/c20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15/h1-10,16H |
|
| StdInChI = 1S/C18H11NO2/c20-17-12-6-2-3-7-13(12)18(21)16(17)15-10-9-11-5-1-4-8-14(11)19-15/h1-10,16H |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IZMJMCDDWKSTTK-UHFFFAOYSA-N |
|
| StdInChIKey = IZMJMCDDWKSTTK-UHFFFAOYSA-N |
|
| SMILES = O=C(c3ccccc3C4=O)/C4=C2N c1ccccc1C=C\2 |
|
| SMILES = O=C(c3ccccc3C4=O)/C4=C2Nc1ccccc1C=C\2 |
|
| EINECS = 232-318-2 |
|
| EINECS = 83-08-9 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Appearance = Yellow powder |
|
| Appearance = Yellow powder |
|
| Formula = C<sub>18</sub>H<sub>11</sub>NO<sub>2</sub> |
|
| Formula = C<sub>18</sub>H<sub>11</sub>NO<sub>2</sub> |
|
| MolarMass = 273.29 g/mol |
|
| MolarMass = 273.29 g/mol |
|
| Density = |
|
| Density = 1.34 g/cm<sup>3</sup> |
|
| MeltingPtC = 240 |
|
| MeltingPtC = 240 |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = Insoluble |
|
| Solubility = Insoluble |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = {{R20/21}} {{R33}} |
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Quinoline Yellow SS''' is a bright yellow ] with green shade. It is insoluble in water, but soluble in nonpolar organic solvents. Quinoline yellow is representative of a large class of quinophthalone pigments.<ref>Volker Radtke "Quinophthalone Pigments" in High Performance Pigments (2nd Edition), Edited by Edwin B. Faulkner, Russell J. Schwartz, 2009 Wiley-VCH, Weinheim. {{doi|10.1002/9783527626915.ch19}}</ref> It is suggested that quinoline yellow exhibits ] (ESIPT) behavior and the behavior might be the cause of its decent photostability, by recent spectroscopic study.<ref>Gi Rim Han et al., , '']'', 2017, 7, 3863.</ref> |
|
|
|
|
|
==Synthesis and reactions== |
|
|
As first described in 1878, the dye is prepared by the fusion of phthalic anhydride and ]. The compound exists as a mixture of two tautomers.<ref>{{Ullmann|author=Horst Berneth|title=Methine Dyes and Pigments|year=2008|doi= 10.1002/14356007.a16_487.pub2}}</ref> Using other anhydrides and other quinaldine derivatives other dyes in the quinophthalone family can be prepared. |
|
|
|
|
|
When ], it converts to a water-soluble derivative, ]. |
|
|
|
|
|
==Uses and safety== |
|
|
Quinoline Yellow SS is used in spirit ]s, ], ]s, ]s, ]s, and to color ] solvents. It is also used in externally applied drugs and cosmetics. Quinoline Yellow SS is used in some yellow ] formulations. |
|
|
|
|
|
It may cause ]. It has the appearance of a yellow powder with a melting point of {{convert|240|C}}. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |