| Revision as of 02:26, 21 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Dr← Previous edit |
Latest revision as of 15:49, 1 November 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits +Category:Isoxazoles; +Category:4-Tolyl compounds using HotCat |
| (16 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 449586101 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 451606624 |
|
| IUPAC_name = 3-methyl-5-octan-4-yl]-1,2-oxazole |
|
| IUPAC_name = 3-methyl-5-octan-4-yl]-1,2-oxazole |
|
| image = RTI-171_structure.png |
|
| image = RTI-171_structure.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = |
|
| CAS_number = 178929-75-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = Q8U66P787F |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 10565888 |
|
| PubChem = 10565888 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8741276 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=24 | N=2 | O=1 |
|
| C=19 | H=24 | N=2 | O=1 |
|
|
| smiles = n1oc(cc1C)34N(C)(C3c2ccc(cc2)C)CC4 |
|
| molecular_weight = 296.406 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| smiles = CN2C1CCC2CC(c(cc4)ccc4C)C1c3cc(C)no3 |
|
|
|
| StdInChI = 1S/C19H24N2O/c1-12-4-6-14(7-5-12)16-11-15-8-9-17(21(15)3)19(16)18-10-13(2)20-22-18/h4-7,10,15-17,19H,8-9,11H2,1-3H3/t15-,16+,17+,19-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JWOFBAPJYPWTNI-FAJBIJEISA-N |
|
}} |
|
}} |
|
|
|
|
|
'''(–)-2β-(3-Methylisoxazol-5-yl)-3β-(p-])tropane''' ('''RTI-171''') is a ] derivative which acts as a selective ], with a relatively slow onset of action and short duration of effects found in animal studies.<ref name="pmid11714587">{{cite journal |author=Kimmel HL, Carroll FI, Kuhar MJ |title=Locomotor stimulant effects of novel phenyltropanes in the mouse |journal=Drug and Alcohol Dependence |volume=65 |issue=1 |pages=25–36 |year=2001 |month=December |pmid=11714587 |doi= 10.1016/S0376-8716(01)00144-2|url=}}</ref> |
|
'''(–)-2β-(3-Methylisoxazol-5-yl)-3β-(p-])tropane''' ('''RTI-''4229''-171''') is a ] derivative which acts as a selective ], with a relatively slow onset of action and short duration of effects found in animal studies.<ref name="pmid11714587">{{cite journal | vauthors = Kimmel HL, Carroll FI, Kuhar MJ | title = Locomotor stimulant effects of novel phenyltropanes in the mouse | journal = Drug and Alcohol Dependence | volume = 65 | issue = 1 | pages = 25–36 | date = December 2001 | pmid = 11714587 | doi = 10.1016/S0376-8716(01)00144-2 }}</ref> However, other studies have shown it to have the most pronounced effects in terms of speed of onset and rate of stimulation among many differing phenyltropanes.<ref name="KimmelO'Connor2007">{{cite journal | vauthors = Kimmel HL, O'Connor JA, Carroll FI, Howell LL | title = Faster onset and dopamine transporter selectivity predict stimulant and reinforcing effects of cocaine analogs in squirrel monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 86 | issue = 1 | pages = 45–54 | date = January 2007 | pmid = 17258302 | pmc = 1850383 | doi = 10.1016/j.pbb.2006.12.006 }}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
| Line 34: |
Line 46: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |