| Revision as of 07:46, 12 October 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages ta...← Previous edit |
Latest revision as of 06:37, 3 June 2024 edit undoOAbot (talk | contribs)Bots440,440 editsm Open access bot: pmc updated in citation with #oabot. |
| (19 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 448211076 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 455170527 |
|
| IUPAC_name = 1-({(2''R'',3''S'')-5-chloro-3-(2-chlorophenyl)-1--3-hydroxy-2,3-dihydro-1''H''-indol-2-yl}carbonyl)-<small>L</small>-prolinamide |
|
| IUPAC_name = 1-({(2''R'',3''S'')-5-chloro-3-(2-chlorophenyl)-1--3-hydroxy-2,3-dihydro-1''H''-indol-2-yl}carbonyl)-<small>L</small>-prolinamide |
|
| image = Relcovaptan.png |
|
| image = Relcovaptan.svg |
|
| width = 220 |
|
| width = 220 |
|
|
|
|
| Line 24: |
Line 27: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 2200 |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 150375-75-0 |
|
| CAS_number = 150375-75-0 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 29: |
Line 34: |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 60943 |
|
| PubChem = 60943 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 419667 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = C1GL8G6G0O |
|
| UNII = C1GL8G6G0O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 54910 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=28 | H=27 | Cl=2 | N=3 | O=7 | S=1 |
|
| C=28 | H=27 | Cl=2 | N=3 | O=7 | S=1 |
|
| molecular_weight = 620.501 |
|
|
| smiles = COC1=C(C=C(C=C1)S(=O)(=O)N2((C3=C2C=CC(=C3)Cl)(C4=CC=CC=C4Cl)O)C(=O)N5CCC5C(=O)N)OC |
|
| smiles = COC1=C(C=C(C=C1)S(=O)(=O)N2((C3=C2C=CC(=C3)Cl)(C4=CC=CC=C4Cl)O)C(=O)N5CCC5C(=O)N)OC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C28H27Cl2N3O7S/c1-39-23-12-10-17(15-24(23)40-2)41(37,38)33-21-11-9-16(29)14-19(21)28(36,18-6-3-4-7-20(18)30)25(33)27(35)32-13-5-8-22(32)26(31)34/h3-4,6-7,9-12,14-15,22,25,36H,5,8,13H2,1-2H3,(H2,31,34)/t22-,25-,28+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CEBYCSRFKCEUSW-NAYZPBBASA-N |
|
| synonyms = <small>(2''S'')-1-pyrrolidine-2-carboxamide</small> |
|
| synonyms = <small>(2''S'')-1-pyrrolidine-2-carboxamide</small> |
|
}} |
|
}} |
|
|
|
|
|
'''Relcovaptan''' ('''SR-49059''') is a non-peptide ], selective for the ] subtype.<ref>Lemmens-Gruber R, Kamyar M. Vasopressin antagonists. ''Cellular and Molecular Life Sciences''. 2006 Aug;63(15):1766-79. PMID 16794787</ref> It has shown positive initial results in tests against ], ], and ],<ref>Decaux G, Soupart A, Vassart G. Non-peptide arginine-vasopressin antagonists: the vaptans. ''Lancet''. 2008 May 10;371(9624):1624-32. PMID 18468546</ref> although it is not yet approved for clinical use. |
|
'''Relcovaptan''' ('''SR-49059''') is a non-] ], selective for the ] subtype.<ref>{{cite journal | vauthors = Lemmens-Gruber R, Kamyar M | title = Vasopressin antagonists | journal = Cellular and Molecular Life Sciences | volume = 63 | issue = 15 | pages = 1766–79 | date = August 2006 | pmid = 16794787 | doi = 10.1007/s00018-006-6054-2 | s2cid = 30709102 | pmc = 11136164 }}</ref> It has shown positive initial results for the treatment of ] and ], and as a ],<ref>{{cite journal | vauthors = Decaux G, Soupart A, Vassart G | title = Non-peptide arginine-vasopressin antagonists: the vaptans | journal = Lancet | volume = 371 | issue = 9624 | pages = 1624–32 | date = May 2008 | pmid = 18468546 | doi = 10.1016/S0140-6736(08)60695-9 | s2cid = 1245079 }}</ref> although it is not yet approved for clinical use. |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{Pituitary and hypothalamic hormones and analogues}} |
|
{{Oxytocin and vasopressin receptor modulators}} |
|
{{Neuropeptide agonists and antagonists}} |
|
|
|
|
|
|
] |
|
] |
|
|
|
|
|
{{systemic-hormonal-drug-stub}} |
|
{{systemic-hormonal-drug-stub}} |
|
|
|
|
] |
|