| Revision as of 00:05, 11 September 2011 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)← Previous edit |
Latest revision as of 18:38, 8 September 2024 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers153,282 edits →top: | Altered template type. Add: bibcode, pages, issue, volume, journal, date, title, doi, authors 1-4. Changed bare reference to CS1/2. | Use this tool. Report bugs. | #UCB_Gadget |
| (17 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{distinguish|retusin (isoflavone)}} |
|
{{distinguish|retusin (isoflavone)}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 407331260 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 449638802 |
|
| Name = Retusin |
|
| Name = Retusin |
|
| ImageFile = Retusin.svg |
|
| ImageFile = Retusin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of |
|
| ImageName = Chemical structure of |
|
| IUPACName = 2-(3,4-dimethoxyphenyl)-5-hydroxy-3,7-dimethoxychromen-4-one |
|
| IUPACName = 5-Hydroxy-3,3′,4′,7-tetramethoxyflavone |
|
|
| SystematicName = 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4''H''-1-benzopyran-4-one |
|
| OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine |
|
| OtherNames = Quercetin tetramethylether<br>Quercetin-3,7,3',4'-tetramethyl ether<br>Tetramethylquercetin<br>Retusine |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 1245-15-4 |
|
| CASNo = 1245-15-4 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = M8591903SD |
|
| PubChem = 5352005 |
|
| PubChem = 5352005 |
|
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC |
|
| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)OC)OC |
|
| InChI = |
|
| EINECS = 214-991-4 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| MeSHName = |
|
|
|
| ChemSpiderID = 4508983 |
|
|
| InChI = 1/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
|
|
| InChIKey = HHGPYJLEJGNWJA-UHFFFAOYAJ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = HHGPYJLEJGNWJA-UHFFFAOYSA-N |
|
|
| ChEBI = 144861 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 77966 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub> |
|
| Formula = C<sub>19</sub>H<sub>18</sub>O<sub>7</sub> |
|
| MolarMass = 358.34 g/mol |
|
| MolarMass = 358.34 g/mol |
|
| ExactMass = 358.105253 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Retusin''' is a ], a type of flavonoid. It can be found in '']''<ref> |
|
'''Retusin''' is an ], a type of flavonoid. It can be found in '']''<ref>{{cite journal | url=http://www.sciencedirect.com/science/article/pii/S030519780800063X | doi=10.1016/j.bse.2008.05.003 | title=Exudate flavones and flavanones in Origanum species and their interspecific variation | date=2008 | last1=Skoula | first1=Melpomene | last2=Grayer | first2=Renée J. | last3=Kite | first3=Geoffrey C. | last4=Veitch | first4=Nigel C. | journal=Biochemical Systematics and Ecology | volume=36 | issue=8 | pages=646–654 | bibcode=2008BioSE..36..646S }}</ref> and in '']''.<ref></ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
| Line 38: |
Line 52: |
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
{{aromatic-stub}} |
|
|
|
|
{{Natural-phenol-stub}} |
|