| Revision as of 17:25, 9 January 2011 editMystBot (talk | contribs)177,678 editsm r2.7.1) (robot Adding: pl:Rodoksantyna← Previous edit |
Latest revision as of 06:30, 23 October 2024 edit undoCitation bot (talk | contribs)Bots5,424,117 edits Added date. | Use this bot. Report bugs. | Suggested by Dominic3203 | Category:Diketones | #UCB_Category 151/206 |
| (21 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|Reference=<ref name="Merck">'']'', 11th Edition, '''8196'''.</ref> |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Rhodoxanthin.png |
|
|
|
| verifiedrevid = 406901980 |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| Reference =<ref name="Merck">'']'', 11th Edition, '''8196'''.</ref> |
| ⚫ |
|IUPACName= <small>(4''E'')-3,5,5-Trimethyl-4--1-cyclohex-2-enone</small> |
|
|
⚫ |
| ImageFile =Rhodoxanthin.png |
| ⚫ |
|OtherNames=•4',5'-Didehydro-''retro''-β-carotene-3,3'-dione<br>•E161f |
|
|
⚫ |
| ImageSize =250px |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| IUPACName = <small>(4''E'')-3,5,5-Trimethyl-4--1-cyclohex-2-enone</small> |
| ⚫ |
| CASNo=116-30-3 |
|
|
⚫ |
| OtherNames ={{Unbulleted list|4',5'-Didehydro-''retro''-β-carotene-3,3'-dione|E161f}} |
| ⚫ |
| PubChem=5281251 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| SMILES=CC1=CC(=O)CC(C1=CC=C(C)C=CC=C(C)C=CC=CC(=CC=CC(=CC=C2C(=CC(=O)CC2(C)C)C)C)C)(C)C |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo =116-30-3 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 51V984ID9Q |
|
⚫ |
| PubChem =5281251 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444663 |
|
⚫ |
| SMILES = CC\1=CC(=O)CC(/C1=C\C=C(\C=C\C=C(\C=C\C=C\C(=C\C=C\C(=C\C=C\2/C(CC(=O)C=C2C)(C)C)\C)\C)/C)/C)(C)C |
|
|
| InChI = 1/C40H50O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-26H,27-28H2,1-10H3/b15-11+,16-12+,19-13+,20-14+,29-17+,30-18+,31-21+,32-22+,37-23-,38-24- |
|
|
| InChIKey = VWXMLZQUDPCJPL-ZDHAIZATBA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C40H50O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-26H,27-28H2,1-10H3/b15-11+,16-12+,19-13+,20-14+,29-17+,30-18+,31-21+,32-22+,37-23-,38-24- |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = VWXMLZQUDPCJPL-ZDHAIZATSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C08610 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>40</sub>H<sub>50</sub>O<sub>2</sub> |
|
| Formula =C<sub>40</sub>H<sub>50</sub>O<sub>2</sub> |
|
| MolarMass=562.82 g/mol |
|
| MolarMass =562.82 g/mol |
|
| Appearance=Purple crystals |
|
| Appearance =Purple crystals |
|
| Density= |
|
| Density = |
|
|
| MeltingPtC = 219 |
|
| MeltingPt=219 °C |
|
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Rhodoxanthin''' is a ] ] with a purple color that is found in small quantities in a variety plants including '']''. It is also found in the feathers of some birds.<ref name="Merck"/> As a ] it is used under the ] E161f as a ]. |
|
'''Rhodoxanthin''' is a ] ] with a purple color that is found in small quantities in a variety of plants including '']'' and '']''. It is also found in the feathers of some birds.<ref name="Merck"/> As a ] it is used under the ] E161f as a ]. It is not approved for use in the ]<ref>UK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |accessdate=2011-10-27}}</ref> or ]; however, it is approved in ] and ]<ref>Australia New Zealand Food Standards Code{{cite web |url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |date=8 September 2011 |accessdate=2011-10-27}}</ref> (where it is listed under its ] 161f). |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Carotenoids}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|