| Revision as of 09:20, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456631239 of page Rhoifolin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 00:04, 7 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| Line 1: |
Line 1: |
|
|
{{one source|date=September 2014}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 425682998 |
|
| verifiedrevid = 477855186 |
|
| Name = Rhoifolin |
|
|
| ImageFile = Rhoifolin.svg |
|
| Name = Rhoifolin |
|
|
| ImageFile = Rhoifolin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Rhoifolin structure |
|
| ImageName = Rhoifolin structure |
|
|
| IUPACName = 4′,5-Dihydroxy-7-flavone |
|
| IUPACName = 7-oxy-5-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|
| SystematicName = 7-{oxy}oxan-2-yl]oxy}-5-hydroxy-2-(4-hydroxyphenyl)-4''H''-1-benzopyran-4-one |
|
| OtherNames = ] 7-O-] |
|
| OtherNames = ] 7-O-] |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 17306-46-6 --> |
|
|
| PubChem = 5282150 |
|
| CASNo = 17306-46-6 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = K86F9AKS2A |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C12627 |
|
|
| PubChem = 5282150 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445347 |
|
| ChemSpiderID = 4445347 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 395990 |
|
| ChEMBL = 395990 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 31227 |
|
| ChEBI = 31227 |
|
| SMILES = O=C\4c5c(O)cc(O2O(CO)(O)(O)2O1O((O)(O)1O)C)cc5O/C(c3ccc(O)cc3)=C/4 |
|
| SMILES = O=C\4c5c(O)cc(O2O(CO)(O)(O)2O1O((O)(O)1O)C)cc5O/C(c3ccc(O)cc3)=C/4 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C27H30O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
|
| StdInChI=1S/C27H30O14/c1-10-20(32)22(34)24(36)26(37-10)41-25-23(35)21(33)18(9-28)40-27(25)38-13-6-14(30)19-15(31)8-16(39-17(19)7-13)11-2-4-12(29)5-3-11/h2-8,10,18,20-30,32-36H,9H2,1H3/t10-,18+,20-,21+,22+,23-,24+,25+,26-,27+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RPMNUQRUHXIGHK-PYXJVEIZSA-N |
|
| StdInChIKey = RPMNUQRUHXIGHK-PYXJVEIZSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>14</sub> |
|
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>14</sub> |
|
| MolarMass = 578.52 g/mol |
|
| MolarMass = 578.52 g/mol |
|
|
| Density = |
|
| ExactMass = 578.163556 u |
|
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Rhoifolin''' is a chemical compound. It is first isolated from plant '']''. The term "Rhoi" derived from generic name of plant Rhus.<ref>{{cite journal |last1=Hattori |first1=Shizuo |last2=Matsuda |first2=Hiroaki |title=Rhoifolin, a new flavone glycoside, isolated from the leaves of Rhus succedanea |journal=Archives of Biochemistry and Biophysics |date=May 1952 |volume=37 |issue=1 |pages=85–89 |doi=10.1016/0003-9861(52)90164-1 }}</ref> It is a ], a type of flavonoid isolated from '']'', China grass or ramie (leaf), from '']'', Canton lemon (leaf), from ''Citrus x aurantium'', the bigarade or bitter orange (plant), from '']'', the grapefruit (leaf), from '']'', the ] (shoot) and from ''Sabal serratula'', the ] or sabal fruit (plant).<ref></ref> |
|
|
<!-- ==]== |
|
|
* |
|
|
--> |
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
<!-- ==External links== |
|
|
* --> |
|
|
|
|
|
{{flavone}} |
|
|
|
|
|
] |
|
|
|
|
|
|
|
|
{{Aromatic-stub}} |