Revision as of 12:32, 7 December 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: InChI1->InChI StdInChI StdInChIKey.← Previous edit |
Latest revision as of 00:19, 19 December 2023 edit undoBigLew99 (talk | contribs)Extended confirmed users765 edits →top: Added image and caption #suggestededit-add-image-topTags: Mobile edit Mobile app edit Android app edit |
(55 intermediate revisions by 28 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Combination drug}} |
|
{{Unreferenced|date=December 2009}} |
|
|
|
{{Use dmy dates|date=September 2019}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 401042719 |
⚫ |
| type = combo |
|
|
|
|
⚫ |
| component1 = Rifampicin |
|
|
|
<!--Combo data--> |
⚫ |
| class1 = Rifamycin antibiotic |
|
|
⚫ |
| type = combo |
⚫ |
| component2 = Isoniazid |
|
|
⚫ |
| component1 = Rifampicin |
⚫ |
| class2 = First-line anti-tuberculosis medication |
|
|
⚫ |
| class1 = Rifamycin antibiotic |
⚫ |
| component3 = Pyrazinamide |
|
|
⚫ |
| component2 = Isoniazid |
⚫ |
| class3 = Anti-tuberculosis medication |
|
|
⚫ |
| class2 = Anti-tuberculosis medication |
⚫ |
| ChemSpiderID = 10468813 |
|
|
⚫ |
| component3 = Pyrazinamide |
|
| InChI = 1/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,49-53H,15-18H2,1-10H3,(H,45,55)/b12-11+,19-14+,22-13-,44-20+/t21-,23+,24+,25+,29-,34-,35+,39+,43-/m0/s1 |
|
|
⚫ |
| class3 = Anti-tuberculosis medication |
|
| InChIKey = JQXXHWHPUNPDRT-WLSIYKJHBI |
|
|
|
|
|
| smiles = CN1CCN(CC1)/N=C/c2c(O)c3c5C(=O)4(C)O/C=C/(OC)(C)(OC(C)=O)(C)(O)(C)(O)(C)\C=C\C=C(\C)C(=O)Nc2c(O)c3c(O)c(C)c5O4 |
|
|
|
<!--Clinical data--> |
|
| StdInChI = 1S/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,49-53H,15-18H2,1-10H3,(H,45,55)/b12-11+,19-14+,22-13-,44-20+/t21-,23+,24+,25+,29-,34-,35+,39+,43-/m0/s1 |
|
|
|
| tradename = Rifater, Trifazid, others |
|
| StdInChIKey = JQXXHWHPUNPDRT-WLSIYKJHSA-N |
|
|
|
| Drugs.com = {{Drugs.com|pro|rifater}} |
⚫ |
| CAS_number = |
|
|
|
| DailyMedID = Rifampin_isoniazid_and_pyrazinamide |
⚫ |
| ATC_prefix = |
|
|
| ATC_suffix = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_category = |
⚫ |
| PubChem = |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| DrugBank = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = Rx-only |
⚫ |
| pregnancy_category= |
|
|
|
| legal_status = Rx-only |
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
⚫ |
| routes_of_administration = ] |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
|
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
|
<!--Identifiers--> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| CAS_number = 161935-14-4 |
⚫ |
| legal_status = Rx-only |
|
|
⚫ |
| ATC_prefix = J04 |
⚫ |
| routes_of_administration = Oral |
|
|
|
| ATC_suffix = AM05 |
|
⚫ |
| PubChem = 6474062 |
|
|
| KEGG = D10210 |
|
⚫ |
| ChemSpiderID = none |
|
|
|
|
|
<!--Chemical data--> |
|
}} |
|
}} |
|
|
] |
|
'''Rifater''' is a ] tablet manufactured by ] used in the treatment of ]. Each tablet contains 120 mg ], 50 mg ] and 300 mg ]. |
|
|
|
<!-- Definition and medical uses --> |
|
|
'''Rifampicin/isoniazid/pyrazinamide''', also known as '''rifampin/isoniazid/pyrazinamide''', and sold under the trade name '''Rifater''', is a medication used to treat ].<ref name=WHO2008/> It is a ] of ], ], and ].<ref name=WHO2008/> It is used either by itself or along with other ].<ref name=WHO2008/> It is taken ].<ref name=WHO2008>{{cite book | title = WHO Model Formulary 2008 | year = 2009 | isbn = 9789241547659 | vauthors = ((World Health Organization)) | veditors = Stuart MC, Kouimtzi M, Hill SR | hdl = 10665/44053 | author-link = World Health Organization | publisher = World Health Organization | hdl-access=free |page=143 }}</ref> |
|
|
|
|
|
|
<!-- Side effects and mechanisms --> |
|
It is used in the first two months of tuberculosis treatment. The dose given depends on the patient's weight: |
|
|
|
Side effects are those of the underlying medications.<ref name=WHO2008/> These may include poor coordination, loss of appetite, nausea, joint pain, feeling tired, and numbness.<ref>{{cite web|title=Rifater Side Effects in Detail - Drugs.com|url=https://www.drugs.com/sfx/rifater-side-effects.html|website=www.drugs.com|access-date=18 December 2016|url-status=live|archive-url=https://web.archive.org/web/20161221013131/https://www.drugs.com/sfx/rifater-side-effects.html|archive-date=21 December 2016}}</ref> Severe side effects include ].<ref name=Pro2016/> Use in those under the age of 15 may not be appropriate.<ref name=Pro2016/> It is unclear if use in ] is safe for the baby.<ref name=Pro2016>{{cite web|title=Rifater - FDA prescribing information, side effects and uses|url=https://www.drugs.com/pro/rifater.html#dosage_administration|website=www.drugs.com|access-date=18 December 2016|date=October 2016|url-status=live|archive-url=https://web.archive.org/web/20161221013153/https://www.drugs.com/pro/rifater.html#dosage_administration|archive-date=21 December 2016}}</ref> |
|
*up to 40 kg, 3 tablets daily; |
|
|
*40 to 49 kg, 4 tablets daily; |
|
|
*50 to 64 kg, 5 tablets daily; |
|
|
*65 kg or more, 6 tablets daily. |
|
|
|
|
|
|
|
<!-- History and culture --> |
|
Rifater should not be used in children (the doses are wrong for them). |
|
|
|
Rifampicin/isoniazid/pyrazinamide was approved for medical use in the United States in 1994.<ref name=Pro2016/> It is on the ].<ref name="WHO21st">{{cite book | vauthors = ((World Health Organization)) | title = World Health Organization model list of essential medicines: 21st list 2019 | year = 2019 | hdl = 10665/325771 | author-link = World Health Organization | publisher = World Health Organization | location = Geneva | id = WHO/MVP/EMP/IAU/2019.06. License: CC BY-NC-SA 3.0 IGO | hdl-access=free }}</ref> |
|
|
|
|
|
|
==Medical uses== |
|
The purpose of the fixed dose combination is to make it easier for patients to take their medication; but also to ensure that if patients forget to take one or two of their drugs, they do not then develop resistance to the remaining drugs. |
|
|
|
The hope of a fixed-dose ] is to increase the likelihood that people will take all of three medications.<ref>{{Cite book| vauthors = Brown MJ, Sharma P, Bennett PN |url=https://books.google.com/books?id=lVXFAAAAQBAJ|title=Clinical Pharmacology|date=2012-07-30|publisher=Elsevier Health Sciences|isbn=978-0-7020-5113-5|pages=204|language=en}}</ref> Also, if people forget to take one or two of their drugs, they might not then develop resistance to the remaining drugs.{{cn|date=August 2022}} |
|
|
|
|
|
==See also== |
|
==Society and culture== |
|
|
It is manufactured by ].{{Fact|date=September 2019}} |
|
*] |
|
|
*] |
|
|
|
|
|
|
|
== See also == |
⚫ |
] |
|
|
] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Antimycobacterials}} |
|
|
{{Portal bar|Medicine}} |
|
|
|
|
|
{{DEFAULTSORT:Rifampicin Isoniazid Pyrazinamide}} |
|
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
⚫ |
] |
|
|
] |
|
|
|
|
|
{{antiinfective-drug-stub}} |