| Revision as of 00:11, 11 September 2011 editYobot (talk | contribs)Bots4,733,870 editsm →See also: WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)← Previous edit |
Latest revision as of 00:23, 28 January 2022 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,032 editsNo edit summary |
| (12 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 402553352 |
|
| verifiedrevid = 449639938 |
|
| Name = Robinetinidin |
|
| Name = Robinetinidin |
|
| ImageFile = Robinetinidin.PNG |
|
| ImageFile = Robinetinidin chloride.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of robinetinidin |
|
| ImageName = Chemical structure of robinetinidin |
|
| IUPACName = <nowiki>5-(3,7-dihydroxychromenylium-2-yl)benzene-1,2,3-triol chloride</nowiki> |
|
| IUPACName = 5-(3,7-Dihydroxychromenylium-2-yl)benzene-1,2,3-triol chloride |
|
| OtherNames = 3,3',4',5',7-Pentahydroxyflavylium chloride<!-- <br> --> |
|
| OtherNames = 3,3',4',5',7-Pentahydroxyflavylium chloride |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 3020-09-5 |
|
| CASNo = 3020-09-5 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| CASNo_Ref = |
|
|
|
| UNII = DW6W3V57N8 |
|
| CASOther = |
|
|
|
| CASNoOther = |
|
| PubChem = 16212723 |
|
| PubChem = 16212723 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 21489630 |
|
|
| InChI = 1/C15H10O6/c16-9-2-1-7-3-12(19)15(21-13(7)6-9)8-4-10(17)14(20)11(18)5-8/h1-6H,(H4-,16,17,18,19,20)/p+1 |
|
|
| InChIKey = BQLHYJCUNNPCKQ-IKLDFBCSAA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H10O6/c16-9-2-1-7-3-12(19)15(21-13(7)6-9)8-4-10(17)14(20)11(18)5-8/h1-6H,(H4-,16,17,18,19,20)/p+1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BQLHYJCUNNPCKQ-UHFFFAOYSA-O |
|
|
| RTECS = |
|
| SMILES = C1=CC(=CC2=C(=C(C=C21)O)C3=CC(=C(C(=C3)O)O)O)O. |
|
| SMILES = C1=CC(=CC2=C(=C(C=C21)O)C3=CC(=C(C(=C3)O)O)O)O. |
|
| InChI = |
|
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>11</sub>ClO<sub>6</sub> (C<sub>15</sub>H<sub>11</sub>O<sub>6</sub><sup>+</sup>, Cl<small>-</small>) |
|
| Formula = C<sub>15</sub>H<sub>11</sub>ClO<sub>6</sub> (C<sub>15</sub>H<sub>11</sub>O<sub>6</sub><sup>+</sup>, Cl<sup>−</sup>) |
|
| MolarMass = 322.69 g/mol |
|
| MolarMass = 322.69 g/mol |
|
| ExactMass = 287.055014 u (322.024416 u, chloride) |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 30: |
Line 39: |
|
'''Robinetinidin''' is an ], a type of flavonoid. |
|
'''Robinetinidin''' is an ], a type of flavonoid. |
|
|
|
|
|
|
]s, condensed tannins oligomers containing robinetinidol, can be found in '']''.<ref></ref> They yield robinetinidin when depolymerized under oxidative conditions. |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ], the corresponding flavan-3ol |
|
* ], the corresponding flavan-3ol |
|
* ], the corresponding ] |
|
* ], the corresponding ] |
| Line 43: |
Line 54: |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |