| Revision as of 05:13, 7 May 2011 editMastiBot (talk | contribs)Extended confirmed users62,165 editsm r2.7.1) (robot Removing: de:Rubixrhardtudo← Previous edit |
Latest revision as of 00:33, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move semisystematic name |
| (21 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 406883640 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref>'']'', 11th Edition, '''8265'''.</ref> |
|
|
⚫ |
| verifiedrevid = 427861501 |
| ⚫ |
|ImageFile=Rubixanthin.png |
|
|
⚫ |
| Reference =<ref>'']'', 11th Edition, '''8265'''.</ref> |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| ImageFile =Rubixanthin.png |
| ⚫ |
|IUPACName= <small>(1''R'')-4--3,5,5-trimethylcyclohex-3-en-1-ol</small> |
|
|
⚫ |
| ImageSize =250px |
|
|OtherNames=•(3''R'')-''beta'', ]-Caroten-3-ol<br>•Natural yellow 27<br>•E161d |
|
|
|
| ImageFile1 = Rubixanthin 3D.png |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| IUPACName = (3''R'')-β,ψ-Caroten-3-ol |
| ⚫ |
| CASNo=3763-55-1 |
|
|
⚫ |
| SystematicName = (1''R'')-4--3,5,5-trimethylcyclohex-3-en-1-ol |
| ⚫ |
| PubChem=5281252 |
|
|
|
| OtherNames = {{ubl|Natural yellow 27|E161d}} |
| ⚫ |
| SMILES=CC1=C(C(C(C1)O)(C)C)\C=C\C(=C\C=C\C(=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C=C(/C)\CCC=C(C)C)\C)\C |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo =3763-55-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 0PWJ89032Q |
|
⚫ |
| PubChem =5281252 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 8907 |
|
⚫ |
| SMILES =CC1=C(C(C(C1)O)(C)C)\C=C\C(=C\C=C\C(=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C\C=C(/C)\CCC=C(C)C)\C)\C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C40H56O/c1-31(2)17-13-20-34(5)23-15-25-35(6)24-14-21-32(3)18-11-12-19-33(4)22-16-26-36(7)27-28-39-37(8)29-38(41)30-40(39,9)10/h11-12,14-19,21-28,38,41H,13,20,29-30H2,1-10H3/b12-11+,21-14+,22-16+,25-15+,28-27+,32-18+,33-19+,34-23+,35-24+,36-26+/t38-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ABTRFGSPYXCGMR-AXXBKCDFSA-N |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4444664 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>40</sub>H<sub>56</sub>O |
|
| Formula =C<sub>40</sub>H<sub>56</sub>O |
|
| MolarMass=552.85 g/mol |
|
| MolarMass =552.85 g/mol |
|
| Appearance=Red-orange crystals |
|
| Appearance =Red-orange crystals |
|
| Density= |
|
| Density = |
|
|
| MeltingPtC = 160 |
|
| MeltingPt=160 °C |
|
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Rubixanthin''', or '''natural yellow 27''', is a natural ] ] with a red-orange color found in ]s. As a ] it used under the ] E161d as a ]. |
|
'''Rubixanthin''', or '''natural yellow 27''', is a natural ] ] with a red-orange color found in ]s. As a ] it used under the ] E161d as a ]; it is not approved for use in the USA{{Cn|date=October 2011}} or EU<ref>UK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |access-date=2011-10-27}}</ref> but is approved in Australia and New Zealand<ref>Australia New Zealand Food Standards Code{{cite web |url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |access-date=2011-10-27}}</ref> where it is listed as 161d. |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Carotenoids}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|