| Revision as of 05:39, 5 May 2010 editBogBot (talk | contribs)Bots53,132 editsm activated IUPHAR link← Previous edit |
Latest revision as of 03:20, 21 October 2024 edit undo76.174.0.57 (talk) See also. |
| (34 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=SCH_23390.svg |
|
|
|
| verifiedrevid = 360226113 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=SCH_23390.svg |
| ⚫ |
|IUPACName=7-chloro-3-methyl-1-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| IUPACName=7-chloro-3-methyl-1-phenyl-1,2,4,5-tetrahydro-3-benzazepin-8-ol |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=87075-17-0 |
|
| CASNo=87075-17-0 |
| ⚫ |
| PubChem=5018 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = UGT5535REQ |
|
⚫ |
| PubChem=5018 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 73297 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 62 |
|
| IUPHAR_ligand = 943 |
|
| IUPHAR_ligand = 943 |
|
| SMILES=CN1CCC2=CC(=C(C=C2C(C1)C3=CC=CC=C3)O)Cl |
|
| SMILES=CN1CCC2=CC(=C(C=C2C(C1)C3=CC=CC=C3)O)Cl |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>17</sub>H<sub>18</sub>ClNO |
|
| Formula=C<sub>17</sub>H<sub>18</sub>ClNO |
|
| MolarMass=287.78 g/mol |
|
| MolarMass=287.78 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''SCH23390''' is a synthetic compound that acts as a ] ] and has either minimal or negligible effects on the ]. |
|
'''SCH-23390''' also known as halobenzazepine, is a synthetic compound that acts as a ] ] and has either minimal or negligible effects on the ]. |
|
|
|
|
|
|
In a 1990 study in rats SCH-23390 offered significant protection from death in ] overdosage, without providing protection from death by ] overdose. The compound provided significant protection from cocaine overdose in rats only at the lowest dose tested in the measurement series. |
|
{{pharm-stub}} |
|
|
|
This suggested that D-amphetamine and methamphetamine at high (lethal) doses have different mechanisms of toxicity in rats.<ref>{{ cite journal | pmid = 2215083 | year = 1990 | last1 = Derlet | first1 = R. W. | last2 = Albertson | first2 = T. E. | last3 = Rice | first3 = P. | title = The Effect of SCH 23390 Against Toxic Doses of Cocaine, d-Amphetamine and Methamphetamine | volume = 47 | issue = 9 | pages = 821–827 | journal = Life Sciences | doi = 10.1016/0024-3205(90)90555-6 }}</ref> |
|
|
|
|
|
== References == |
|
==See also== |
|
|
* ] (NNC 22-0010) |
|
{{reflist}} |
|
|
|
* ] (SCH-39166) |
|
|
* ] (ADX-10061) |
|
|
* ] (NNC 01-0756) |
|
|
|
|
|
|
==References== |
|
{{Dopaminergics}} |
|
|
|
{{Reflist}} |
|
|
|
|
|
|
|
| ⚫ |
] |
|
|
|
{{Dopamine receptor modulators}} |
| ⚫ |
] |
|
|
|
|
| ⚫ |
] |
|
|
|
] |
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
|
{{nervous-system-drug-stub}} |