| Revision as of 06:37, 29 August 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Adding category Category:Anilides (using HotCat)← Previous edit |
Latest revision as of 10:58, 6 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,443 edits more ids |
| (21 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox | |
|
|
|
{{Drugbox |
| ⚫ |
| IUPAC_name = N-(3-methyl)(4-piperidyl)]-4-methylphenyl)-2-methylpropanamide |
|
|
|
| verifiedrevid = 381642548 |
| ⚫ |
| image = SNAP-94847_structure.png |
|
|
⚫ |
| IUPAC_name = ''N''-(3-methyl)(4-piperidyl)]-4-methylphenyl)-2-methylpropanamide |
| ⚫ |
| CAS_number = |
|
|
⚫ |
| image = SNAP-94847_structure.png |
| ⚫ |
| ATC_prefix = |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=29 | H=32 | F=2 | N=2 | O=2 |
|
|
| molecular_weight = 478.572 |
|
| ⚫ |
| smiles = Fc1ccc(cc1F)Oc(cc4)ccc4CN(CC3)CCC3c2cc(NC(=O)C(C)C)ccc2C |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
| ⚫ |
}} |
|
|
|
|
|
|
|
<!--Clinical data--> |
| ⚫ |
'''SNAP-94847''' is a drug used in scientific research, which is a selective, non-peptide ] at the ] ] ]. In animal studies it has been shown to produce both ] and ] effects,<ref name="pmid17237257">{{cite journal |author=David DJ, Klemenhagen KC, Holick KA, Saxe MD, Mendez I, Santarelli L, Craig DA, Zhong H, Swanson CJ, Hegde LG, Ping XI, Dong D, Marzabadi MR, Gerald CP, Hen R |title=Efficacy of the MCHR1 antagonist N-methyl}(4-piperidyl))-4-methylphenyl]-2-methylpropanamide (SNAP 94847) in mouse models of anxiety and depression following acute and chronic administration is independent of hippocampal neurogenesis |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=321 |issue=1 |pages=237–48 |year=2007 |month=April |pmid=17237257 |doi=10.1124/jpet.106.109678 |url=}}</ref><ref name="pmid18793675">{{cite journal |author=Smith DG, Hegde LG, Wolinsky TD, Miller S, Papp M, Ping X, Edwards T, Gerald CP, Craig DA |title=The effects of stressful stimuli and hypothalamic-pituitary-adrenal axis activation are reversed by the melanin-concentrating hormone 1 receptor antagonist SNAP 94847 in rodents |journal=Behavioural Brain Research |volume=197 |issue=2 |pages=284–91 |year=2009 |month=February |pmid=18793675 |doi=10.1016/j.bbr.2008.08.026 |url=}}</ref> and also reduces food consumption suggesting a possible ] effect.<ref name="pmid19340414">{{cite journal |author=Nair SG, Adams-Deutsch T, Pickens CL, Smith DG, Shaham Y |title=Effects of the MCH1 receptor antagonist SNAP 94847 on high-fat food-reinforced operant responding and reinstatement of food seeking in rats |journal=Psychopharmacology |volume=205 |issue=1 |pages=129–40 |year=2009 |month=July |pmid=19340414 |doi=10.1007/s00213-009-1523-6 |url=}}</ref> |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
|
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 487051-12-7 |
|
|
| CAS_number_Ref = {{Cascite|changed|CAS}} |
|
⚫ |
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 16756754 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| ChemSpiderID = 10795817 |
|
|
| ChEMBL = 242004 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=29 | H=32 | F=2 | N=2 | O=2 |
|
⚫ |
| smiles = Fc1ccc(cc1F)Oc(cc4)ccc4CN(CC3)CCC3c2cc(NC(=O)C(C)C)ccc2C |
|
|
| StdInChI = 1S/C29H32F2N2O2/c1-19(2)29(34)32-23-7-4-20(3)26(16-23)22-12-14-33(15-13-22)18-21-5-8-24(9-6-21)35-25-10-11-27(30)28(31)17-25/h4-11,16-17,19,22H,12-15,18H2,1-3H3,(H,32,34) |
|
|
| StdInChIKey = VMLZFUVIKCGATC-UHFFFAOYSA-N |
|
⚫ |
}} |
|
|
|
|
|
⚫ |
'''SNAP-94847''' is a drug used in scientific research, which is a selective, non-peptide ] at the ] ] ]. In animal studies it has been shown to produce both ] and ] effects,<ref name="pmid17237257">{{cite journal |vauthors=David DJ, Klemenhagen KC, Holick KA, Saxe MD, Mendez I, Santarelli L, Craig DA, Zhong H, Swanson CJ, Hegde LG, Ping XI, Dong D, Marzabadi MR, Gerald CP, Hen R |title=Efficacy of the MCHR1 antagonist N-methyl}(4-piperidyl))-4-methylphenyl]-2-methylpropanamide (SNAP 94847) in mouse models of anxiety and depression following acute and chronic administration is independent of hippocampal neurogenesis |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=321 |issue=1 |pages=237–48 |date=April 2007 |pmid=17237257 |doi=10.1124/jpet.106.109678 |s2cid=717425 }}</ref><ref name="pmid18793675">{{cite journal |vauthors=Smith DG, Hegde LG, Wolinsky TD, Miller S, Papp M, Ping X, Edwards T, Gerald CP, Craig DA |title=The effects of stressful stimuli and hypothalamic-pituitary-adrenal axis activation are reversed by the melanin-concentrating hormone 1 receptor antagonist SNAP 94847 in rodents |journal=Behavioural Brain Research |volume=197 |issue=2 |pages=284–91 |date=February 2009 |pmid=18793675 |doi=10.1016/j.bbr.2008.08.026 |s2cid=205878561 }}</ref> and also reduces food consumption suggesting a possible ] effect.<ref name="pmid19340414">{{cite journal |vauthors=Nair SG, Adams-Deutsch T, Pickens CL, Smith DG, Shaham Y |title=Effects of the MCH1 receptor antagonist SNAP 94847 on high-fat food-reinforced operant responding and reinstatement of food seeking in rats |journal=Psychopharmacology |volume=205 |issue=1 |pages=129–40 |date=July 2009 |pmid=19340414 |doi=10.1007/s00213-009-1523-6 |pmc=3143407}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Neuropeptide agonists and antagonists}} |
|
|
{{Anxiolytics}} |
|
{{Anxiolytics}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Anxiolytic-stub}} |