| Revision as of 13:11, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 00:48, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (63 intermediate revisions by 31 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Experimental drug}} |
|
|
{{refimprove|date=February 2016}} |
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 443866268 |
|
| verifiedrevid = 443867582 |
|
| ImageFile = IPI-926.svg |
|
| ImageFile = Saridegib.svg |
|
| ImageSize = 200px |
|
| ImageSize = |
|
|
| IUPACName = ''N''-methanesulfonamide |
|
| ImageAlt = |
|
|
| IUPACName = ''N''-((2''S'',3''R'',3a''S'',3′''R'',4a′''R'',6''S'',6a′''R'',6b′''S'',7a''R'',12a&prmie;''S'',12b′''S'')-3,6,11′,12b′-tetramethyl-2′,3a,3′,4,4′,4a′,5,5&prmie;,6,6′,6a′,6b′,7,7a,7′,8′,10′,12′,12a′,12b′-icosahydro-1′''H'',3''H''-spiropyridine-2,9'-naphthoazulen]-3'-yl)methanesulfonamide |
|
| SystematicName = ''N''-pyridine-2,9′-naphthoazulen]-3′-yl]methanesulfonamide |
|
⚫ |
| OtherNames = saridegib |
|
| IUPACName_hidden = yes |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| OtherNames = |
|
|
|
| IUPHAR_ligand = 8198 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo =1037210-93-7 |
|
| CASNo =1037210-93-7 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| PubChem = |
|
| PubChem = 25027363 |
|
|
| ChEMBL = 538867 |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| ChemSpiderID = 26353073 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = JT96FPU35X |
|
| UNII = JT96FPU35X |
|
|
| KEGG = D10324 |
|
| SMILES = 12(3()C(C2)=C(C)C4(O(C(C)CN5)()5()4C)CC3)()CC6()C(NS(C)(=O)=O)CC61C}} |
|
| SMILES = C1C2((3(O2)CC45CC6C(CC6(5CC4=C(C3)C)C)NS(=O)(=O)C)C)NC1 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| StdInChI=1S/C29H48N2O3S/c1-17-12-26-27(30-16-17)19(3)29(34-26)11-9-22-23-7-6-20-13-21(31-35(5,32)33)8-10-28(20,4)25(23)14-24(22)18(2)15-29/h17,19-23,25-27,30-31H,6-16H2,1-5H3/t17-,19+,20+,21+,22-,23-,25-,26+,27-,28-,29-/m0/s1 |
| ⚫ |
| C=29 | H=48 | N=2 | O=3 | S=1 |
|
|
|
| StdInChIKey = HZLFFNCLTRVYJG-WWGOJCOQSA-N |
| ⚫ |
| Appearance = |
|
| ⚫ |
| Density = |
|
| ⚫ |
| MeltingPt = |
|
| ⚫ |
| BoilingPt = |
|
| ⚫ |
| Solubility = }} |
|
| ⚫ |
| Section3 = {{Chembox Hazards |
|
| ⚫ |
| MainHazards = |
|
| ⚫ |
| FlashPt = |
|
|
| Autoignition = }} |
|
|
}} |
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| C=29 | H=48 | N=2 | O=3 | S=1 |
|
⚫ |
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = }} |
|
⚫ |
|Section4={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
}} |
|
|
|Section3={{Chembox Pharmacology |
|
|
| Legal_status = Investigational |
|
|
| AdminRoutes = Oral |
|
|
}} |
|
|
}} |
|
|
|
|
⚫ |
'''Saridegib''', also known as '''IPI-926''', is an experimental drug candidate undergoing clinical trials for the treatment of various types of cancer, including hard-to-treat hematologic malignancies such as ] and ligand-dependent tumors such as ].<ref name=Pipeline926>{{cite web | url = http://www.infi.com/product-candidates-pipeline-ipi-926.asp | title = Pipeline: IPI-926 | publisher = Infinity Pharmaceuticals | url-status = unfit| archive-url = https://web.archive.org/web/20120119213055/http://www.infi.com/product-candidates-pipeline-ipi-926.asp | archive-date = 2012-01-19 }}</ref> IPI-926 exhibits its pharmacological effect by inhibition of the ] ], a component of the ].<ref name=Tremblay>{{cite journal | pmid = 19522463 | year = 2009 | last1 = Tremblay | first1 = MR | last2 = Lescarbeau | first2 = A | last3 = Grogan | first3 = MJ | last4 = Tan | first4 = E | last5 = Lin | first5 = G | last6 = Austad | first6 = BC | last7 = Yu | first7 = LC | last8 = Behnke | first8 = ML | last9 = Nair | first9 = SJ | last10 = Hagel | first10 = Margit | last11 = White | first11 = Kerry | last12 = Conley | first12 = James | last13 = Manna | first13 = Joseph D. | last14 = Alvarez-Diez | first14 = Teresa M. | last15 = Hoyt | first15 = Jennifer | last16 = Woodward | first16 = Caroline N. | last17 = Sydor | first17 = Jens R. | last18 = Pink | first18 = Melissa | last19 = MacDougall | first19 = John | last20 = Campbell | first20 = Matthew J. | last21 = Cushing | first21 = Jill | last22 = Ferguson | first22 = Jeanne | last23 = Curtis | first23 = Michael S. | last24 = McGovern | first24 = Karen | last25 = Read | first25 = Margaret A. | last26 = Palombella | first26 = Vito J. | last27 = Adams | first27 = Julian | last28 = Castro | first28 = Alfredo C. | title = Discovery of a potent and orally active hedgehog pathway antagonist (IPI-926) | volume = 52 | issue = 14 | pages = 4400–18 | doi = 10.1021/jm900305z | journal = Journal of Medicinal Chemistry| display-authors = 8 }}</ref> Chemically, it is a semi-synthetic ] of the ] ]. The process begins with ] extracted from harvested ] which is taken through a series of alterations resulting in an analogue of the natural product cyclopamine, making IPI-926 the only compound in development/testing that is not fully synthetic.<ref name=Tremblay/> |
|
|
|
|
|
|
Saridegib is a member of a class of anti-cancer compounds known as ]. |
| ⚫ |
'''IPI-926''' is an experimental drug candidate currently undergoing clinical trials for the treatment of various types of cancer.<ref>{{cite web | url = http://www.infi.com/product-candidates-pipeline-ipi-926.asp | title = Pipeline: IPI-926 | publisher = Infinity Pharmaceuticals}}</ref> IPI-926 exhibits its pharmacological effect by inhibition of the ] ], a component of the ].<ref>{{cite journal | pmid = 19522463 | year = 2009 | last1 = Tremblay | first1 = MR | last2 = Lescarbeau | first2 = A | last3 = Grogan | first3 = MJ | last4 = Tan | first4 = E | last5 = Lin | first5 = G | last6 = Austad | first6 = BC | last7 = Yu | first7 = LC | last8 = Behnke | first8 = ML | last9 = Nair | first9 = SJ | title = Discovery of a potent and orally active hedgehog pathway antagonist (IPI-926) | volume = 52 | issue = 14 | pages = 4400–18 | doi = 10.1021/jm900305z | journal = Journal of medicinal chemistry}}</ref> Chemically, it is a ] of the ] ]. |
|
|
|
|
|
|
==References== |
|
==References== |
| Line 33: |
Line 48: |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |