| Revision as of 06:42, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pha← Previous edit |
Latest revision as of 11:59, 16 January 2024 edit undoKku (talk | contribs)Extended confirmed users115,407 editsm link neurotoxicity |
| (100 intermediate revisions by 51 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 443516228 |
|
| verifiedrevid = 447808729 |
|
| IUPAC_name = (''OC''-6-43)-bis(acetato)amminedichloro(cyclohexylamine)platinum |
|
| IUPAC_name = (''OC''-6-43)-bis(acetato)amminedichloro(cyclohexylamine)platinum |
|
| image = Satraplatin.svg |
|
| image = Satraplatin.svg |
|
|
| image2 = Satraplatin-from-xtal-1995-Mercury-3D-balls.png |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 22: |
Line 23: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 129580-63-8 |
|
| CAS_number = 129580-63-8 |
|
| ATC_prefix = L01 |
|
| ATC_prefix = L01 |
|
| ATC_suffix = XA04 |
|
| ATC_suffix = XA04 |
|
| PubChem = 123974 |
|
| PubChem = 123974 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 85609 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
| Line 36: |
Line 40: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=22 | Cl=2 | N=2 | O=4 | Pt=1 |
|
| C=10 | H=22 | Cl=2 | N=2 | O=4 | Pt=1 |
|
| molecular_weight = 500.277 g/mol |
|
|
| synonyms = BMY 45594<br>BMS 182751<br>(''OC''-6-43)-bis(acetato)amminedichlorocyclohexylamine platinum(IV) |
|
| synonyms = BMY 45594<br>BMS 182751<br>(''OC''-6-43)-bis(acetato)amminedichlorocyclohexylamine platinum(IV) |
|
|
| SMILES = Cl(Cl)(OC(=O)C)(OC(=O)C)()C1CCCCC1 |
|
}} |
|
}} |
|
'''Satraplatin''' (], codenamed '''JM216''') is a ] compound that is currently under investigation as one treatment of patients with advanced ] who have failed previous ]. It has not yet received approval from the U.S. ]<ref>{{cite journal |title=The status of platinum anticancer drugs in the clinic and in clinical trials |journal=Dalton Transactions |volume=39 |pages=8113–27 |year=2010 |doi=10.1039/C0DT00292E |last1=Wheate |first1=Nial J. |last2=Walker |first2=Shonagh |last3=Craig |first3=Gemma E. |last4=Oun |first4=Rabbab |issue=35 |pmid=20593091 }}</ref>. First mentioned in the medical literature in 1993,<ref>{{cite journal |author=Kelland LR, Abel G, McKeage MJ, ''et al.'' |title=Preclinical antitumor evaluation of bis-acetato-ammine-dichloro-cyclohexylamine platinum(IV): an orally active platinum drug |journal=Cancer Res |volume=53 |issue=11 |pages=2581–6 |year=1993 |pmid=8388318 |url=http://cancerres.aacrjournals.org/cgi/reprint/53/11/2581.pdf |format=PDF}} </ref> satraplatin is the first orally active platinum-based chemotherapeutic drug;<ref>{{cite journal |author=Choy H, Park C, Yao M |title=Current status and future prospects for satraplatin, an oral platinum analogue |journal=Clin Cancer Res |volume=14 |issue=6 |pages=1633–8 |year=2008 |pmid=18347164 |doi=10.1158/1078-0432.CCR-07-2176}}</ref> other available platinum analogues—], ], and ]—must be given ]. |
|
'''Satraplatin''' (], codenamed '''JM216''') is a ] agent that was under investigation as a treatment of patients with advanced ] who have failed previous ]. It has not yet received approval from the U.S. ].<ref>{{cite journal | vauthors = Wheate NJ, Walker S, Craig GE, Oun R | title = The status of platinum anticancer drugs in the clinic and in clinical trials | journal = Dalton Transactions | volume = 39 | issue = 35 | pages = 8113–8127 | date = September 2010 | pmid = 20593091 | doi = 10.1039/C0DT00292E | hdl-access = free | s2cid = 205766376 | hdl = 2123/14271 | author-link1 = Nial J. Wheate }}</ref> First mentioned in the medical literature in 1993,<ref>{{cite journal | vauthors = Kelland LR, Abel G, McKeage MJ, Jones M, Goddard PM, Valenti M, Murrer BA, Harrap KR | display-authors = 6 | title = Preclinical antitumor evaluation of bis-acetato-ammine-dichloro-cyclohexylamine platinum(IV): an orally active platinum drug | journal = Cancer Research | volume = 53 | issue = 11 | pages = 2581–2586 | date = June 1993 | pmid = 8388318 | url = http://cancerres.aacrjournals.org/cgi/reprint/53/11/2581.pdf | author-link8 = Kenneth Harrap }}</ref> satraplatin is the first orally active platinum-based chemotherapeutic drug;<ref name = ChoyParkYao>{{cite journal | vauthors = Choy H, Park C, Yao M | title = Current status and future prospects for satraplatin, an oral platinum analogue | journal = Clinical Cancer Research | volume = 14 | issue = 6 | pages = 1633–1638 | date = March 2008 | pmid = 18347164 | doi = 10.1158/1078-0432.CCR-07-2176 | doi-access = free }}</ref> other available platinum analogues—], ], and ]—must be given ]. |
|
|
|
|
|
⚫ |
The drug has also been used in the treatment of lung and ovarian cancers. The proposed mode of action is that the compound binds to the ] of cancer cells rendering them incapable of ].<ref> {{webarchive|url=https://web.archive.org/web/20070704183648/http://www.spectrumpharm.com/satraplatin.html |date=2007-07-04 }}</ref> |
|
It is made available in the United States jointly by ] and GPC Biotech under the name SPERA (Satraplatin Expanded Rapid Access). |
|
|
|
|
|
|
|
== Mode of action == |
| ⚫ |
The drug has also been used in the treatment of lung and ovarian cancers. The proposed mode of action is that the compound binds to the ] of cancer cells rendering them incapable of ]. <ref></ref> |
|
|
|
The proposed mode of action is that the compound binds to the ] of cancer cells rendering them incapable of ]. In addition some cisplatin resistant tumour cell lines were sensitive to satraplatin treatment in vitro. This may be due to an altered mechanism of cellular uptake (satraplatin by passive diffusion instead of active transport for e.g. cisplatin). |
|
|
|
|
|
|
== Clinical development == |
| ⚫ |
==References== |
|
|
|
Satraplatin has been developed for the treatment of men with castrate-refractory, metastatic prostate cancer for several reasons. Its relative ease of administration, potential lack of cross-resistance with other platinum agents, clinical benefits seen in early studies of prostate cancer, and an unmet need in this patient population after ] failure at that time. The only Phase III trial with satraplatin (SPARC Trial) was conducted in pretreated metastatic castrate-resistant prostate cancer (CRPC), revealing a 33% reduction in risk of progression or death versus a placebo.<ref>{{cite journal | vauthors = Sternberg CN, Petrylak DP, Sartor O, Witjes JA, Demkow T, Ferrero JM, Eymard JC, Falcon S, Calabrò F, James N, Bodrogi I, Harper P, Wirth M, Berry W, Petrone ME, McKearn TJ, Noursalehi M, George M, Rozencweig M | display-authors = 6 | title = Multinational, double-blind, phase III study of prednisone and either satraplatin or placebo in patients with castrate-refractory prostate cancer progressing after prior chemotherapy: the SPARC trial | journal = Journal of Clinical Oncology | volume = 27 | issue = 32 | pages = 5431–5438 | date = November 2009 | pmid = 19805692 | doi = 10.1200/JCO.2008.20.1228 | doi-access = free }}</ref> However, no difference in overall survival was observed. An FDA or ]-approved indication has not yet been achieved. |
|
{{reflist}} |
|
|
|
|
|
|
|
Satraplatin appears to have clinical activity against a variety of malignancies such as ], ] and ]. |
| ⚫ |
{{Chemotherapeutic agents}} |
|
|
|
|
|
|
|
Especially in combination with radiotherapy it appears to have good efficacy in combination for lung and squamous head and neck cancer. In a phase I study from Vanderbilt University, seven of eight patients with squamous cell carcinoma of the head and neck, who were treated with 10 to 30 mg of satraplatin thrice a week concurrently with radiotherapy achieved a complete response.<ref>{{Cite journal| vauthors = Cmelak AJ, Choy H, Murphy BA, DeVore R, Bria B, Day T, Porte K, Johnson D | display-authors = 6 |date=|title=Phase I study of JM-216 with concurrent radiation in non-small cell lung cancer and squamous cell head and neck cancer|url=|journal=Proc Am Soc Clin Oncol|volume=1999|pages=|via=}}</ref> |
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
== Side effects == |
|
|
Satraplatin is similar in toxicity profile to carboplatin, with no nephrotoxicity, ], or ototoxicity observed. Moreover, it is much better tolerated than cisplatin and does not require hydration for each dose. A somewhat more intense hematotoxicity is observed. ], diarrhea, constipation, nausea or vomiting, increase risk of infection, bruising.<ref name=":1">{{cite journal | vauthors = Bhargava A, Vaishampayan UN | title = Satraplatin: leading the new generation of oral platinum agents | journal = Expert Opinion on Investigational Drugs | volume = 18 | issue = 11 | pages = 1787–1797 | date = November 2009 | pmid = 19888874 | pmc = 3856359 | doi = 10.1517/13543780903362437 }}</ref> |
|
|
|
|
|
|
== Possible risks and complications == |
|
{{antineoplastic-drug-stub}} |
|
|
|
|
|
|
|
* ]: Cancer can increase the risk of developing a blood clot, and chemotherapy may increase this risk further. A blood clot may cause symptoms such as pain, redness and swelling in a leg, or breathlessness and chest pain. Most clots can be treated with drugs that thin the blood. |
|
] |
|
|
|
* ]: Satraplatin can affect a person's ability to become pregnant and may cause sterility in men. |
|
|
* Use ]: Satraplatin may harm a developing baby. It is important to use effective contraception while taking this drug and for at least a few months afterwards<ref name=":1" /> |
|
|
|
|
|
== Detailed mechanism of action == |
|
|
Many human tumors including testicular, bladder, lung, head, neck, and cervical cancers have been treated with platinum compounds.<ref name=":1" /> All of the marketed platinum analogues must be administered via intravenous infusion is one of the main disadvantages for these platinum compounds due to severe, dose-limiting effects. An acquired resistance to cisplatin/carboplatin in ovarian cancer was discovered due to insufficient amounts of platinum reaching the target DNA or failure to achieve cell death. These drawbacks led to the development of the next generation of platinum analogues such as satraplatin<ref name=":1" /> |
|
|
|
|
|
Satraplatin is a prodrug, meaning it is metabolized in the body and transformed into its working form. The two polar acetate groups on satraplatin increase the drugs ], which in turn allows for a large fraction of the administered dose to make it into the bloodstream where metabolism begins. Once the molecule makes it to the bloodstream the drug loses its acetate groups. At this point the drug is structurally similar to ] with the exception of one cyclohexylamine group in place of an amine group. Since the drug is now structurally similar to cisplatin its mechanism of action is also very similar. The chlorine atoms are displaced and the platinum atom in the drug binds to guanine residues in DNA. This unfortunately happens to not only cancer cells but other regular functioning cells as well causing some of the harsh side effects. By binding to guanine residues satraplatin inhibits DNA replication and transcription which leads to subsequent ]. Where satraplatin differs is its cyclohexamine group. In cisplatin the two amine groups are symmetrical while satraplatin's cyclohexamine makes it asymmetrical which contributes to some of the drug's special properties.<ref name="ChoyParkYao"/> |
|
|
|
|
|
A large problem with cisplatin and other platinum based anti-cancer drugs is that the body can develop resistance to them. A major way that this happens is through a mammalian nucleotide excision repair pathway which repairs damaged DNA. However, some studies show that satraplatin compared to other platinum anti-cancer drugs can be elusive and are not recognized by the DNA repair proteins due to the different adducts on the molecule (cyclohexamine). Since satraplatin is not recognized by the DNA repair proteins the DNA remains damaged, the DNA cannot be replicated, the cell dies, and the problem of resistance is solved.<ref name = ChoyParkYao /> |
|
|
|
|
|
In vitro experiments have shown that satraplatin is more effective in well-defined hematological cancers than cisplatin. ] deficiency and ] gene mutation were identified as biomarkers of enhanced efficacy.<ref>{{cite journal | vauthors = Zander T, Xue J, Markson G, Dahm F, Renner C | title = Satraplatin Demonstrates High Cytotoxic Activity Against Genetically Defined Lymphoid Malignancies | journal = Anticancer Research | volume = 42 | issue = 4 | pages = 1821–1832 | date = April 2022 | pmid = 35347000 | doi = 10.21873/anticanres.15658 | s2cid = 247765144 | doi-access = free }}</ref> |
|
|
|
|
⚫ |
== References == |
|
|
{{Reflist}} |
|
|
|
|
⚫ |
{{Chemotherapeutic agents}} |
|
|
{{Platinum compounds}} |
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
] |