| Revision as of 08:59, 3 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 00:59, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (14 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 379648743 |
|
| verifiedrevid = 432322356 |
|
|ImageFile=Scilliroside.png |
|
| ImageFile=Scilliroside structure.png |
|
|ImageSize= |
|
| ImageSize=240 |
| ⚫ |
|IUPACName= oxy- 2,3,6,7,9,11,12,15,16,17- decahydro- 1H- cyclopenta phenanthren- 6-yl] acetate |
|
|
|
| IUPACName=6β-(Acetyloxy)-3β-(β-<small>D</small>-glucopyranosyloxy)-8,14-dihydroxybufa-4,20,22-trienolide |
|
|OtherNames= |
|
|
⚫ |
| SystematicName=(1''R'',3a''R'',3b''S'',5''R'',7''S'',9a''R'',9b''R'',11a''R'')-3a,3b-Dihydroxy-9a,11a-dimethyl-1-(2-oxo-2''H''-pyran-5-yl)-7-{oxy}-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1''H''-cyclopentaphenanthren-5-yl acetate |
|
|
| OtherNames=(3β,6β)-6-(Acetyloxy)-3-(β-<small>D</small>-glucopyranosyloxy)-8,14-dihydroxybufa-4,20,22-trienolide |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=507-60-8 |
|
| CASNo=507-60-8 |
| ⚫ |
| PubChem=441871 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2815004NHO |
|
⚫ |
| PubChem=441871 |
|
|
| ChEBI = 28332 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C08880 |
|
| KEGG = C08880 |
|
|
|
| ⚫ |
| SMILES=CC(=O)O1C2((CC3(2(CC3C4=COC(=O)C=C4)O)C)5(C1=C(CC5)O6((((O6)CO)O)O)O)C)O |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 390447 |
|
⚫ |
| SMILES = CC(=O)O1C2((CC3(2(CC3c4ccc(=O)oc4)O)C)5(C1=C(CC5)O6((((O6)CO)O)O)O)C)O |
|
|
| InChI = 1/C32H44O12/c1-16(34)42-21-13-31(39)23(8-10-30(3)19(7-11-32(30,31)40)17-4-5-24(35)41-15-17)29(2)9-6-18(12-20(21)29)43-28-27(38)26(37)25(36)22(14-33)44-28/h4-5,12,15,18-19,21-23,25-28,33,36-40H,6-11,13-14H2,1-3H3/t18-,19+,21+,22+,23+,25+,26-,27+,28+,29-,30+,31-,32+/m0/s1 |
|
|
| InChIKey = LSMIOFMZNVEEBR-ICLSSMQGBS |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C32H44O12/c1-16(34)42-21-13-31(39)23(8-10-30(3)19(7-11-32(30,31)40)17-4-5-24(35)41-15-17)29(2)9-6-18(12-20(21)29)43-28-27(38)26(37)25(36)22(14-33)44-28/h4-5,12,15,18-19,21-23,25-28,33,36-40H,6-11,13-14H2,1-3H3/t18-,19+,21+,22+,23+,25+,26-,27+,28+,29-,30+,31-,32+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LSMIOFMZNVEEBR-ICLSSMQGSA-N |
|
|
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>32</sub>H<sub>44</sub>O<sub>12</sub> |
|
| Formula=C<sub>32</sub>H<sub>44</sub>O<sub>12</sub> |
|
| MolarMass=620.685 |
|
| MolarMass=620.685 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards=Toxic |
|
| MainHazards=Toxic |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Scilliroside''' is a toxic compound derived from the plant '']'' (] ''Urginea maritima''), which is sometimes used as a ].<ref>el Bahri L, Djegham M, Makhlouf M. Urginea maritima L (Squill): a poisonous plant of North Africa. ''Veterinary and Human Toxicology''. 2000 Apr;42(2):108-10. PMID 10750179</ref> |
|
'''Scilliroside''' is a toxic compound derived from the plant '']'' (] ''Urginea maritima''), which is sometimes used as a ].<ref>{{cite journal | vauthors = el Bahri L, Djegham M, Makhlouf M | title = Urginea maritima L (Squill): a poisonous plant of North Africa | journal = Veterinary and Human Toxicology | volume = 42 | issue = 2 | pages = 108–10 | date = April 2000 | pmid = 10750179 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
| Line 42: |
Line 59: |
|
] |
|
] |
|
|
|
|
|
⚫ |
{{steroid-stub}} |
|
|
|
| ⚫ |
{{chemistry-stub}} |
|