Revision as of 19:56, 29 August 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Matabolism section← Previous edit |
Latest revision as of 15:55, 23 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Added pmid. |
(33 intermediate revisions by 24 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 447366952 |
|
| Name = Sinapine |
|
| Name = Sinapine |
|
| ImageFile = Sinapine thiocyanate.PNG |
|
| ImageFile = Sinapine.svg |
|
|
| ImageName = Chemical structure of sinapine |
|
| ImageSize = 200px |
|
|
|
| PIN = 2-{oxy}-''N'',''N'',''N''-trimethylethan-1-aminium |
|
| ImageName = Chemical structure of sinapine thiocyanate |
|
|
|
| OtherNames = Sinapoylcholine; Sinapic acid choline ester |
|
| ImageAlt = Chemical structure of sinapine thiocyanate |
|
|
|
|Section1={{Chembox Identifiers |
|
| ImageCaption = Chemical structure of sinapine ] |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| IUPACName = |
|
|
|
| CASNo = 18696-26-9 |
|
| OtherNames = Sinapoylcholine<!-- <br> --> |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|Section1= {{Chembox Identifiers |
|
|
| CASNo = |
|
| UNII = 09211A0HHL |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
| PubChem = 5280385 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| PubChem = |
|
|
| SMILES = |
|
| ChemSpiderID = 80576 |
|
|
| SMILES = O=C(/C=C/C1=CC(OC)=C(C(OC)=C1)O)OCC(C)(C)C |
|
| InChI = |
|
|
|
| InChI = 1/C16H23NO5/c1-17(2,3)8-9-22-15(18)7-6-12-10-13(20-4)16(19)14(11-12)21-5/h6-7,10-11H,8-9H2,1-5H3/p+1 |
|
|
| InChIKey = HUJXHFRXWWGYQH-IKLDFBCSAX |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H23NO5/c1-17(2,3)8-9-22-15(18)7-6-12-10-13(20-4)16(19)14(11-12)21-5/h6-7,10-11H,8-9H2,1-5H3/p+1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = HUJXHFRXWWGYQH-UHFFFAOYSA-O |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=24 | N=1 | O=5 |
|
| Formula = C<sub>16</sub>H<sub>24</sub>NO<sub>5</sub> |
|
|
| MolarMass = 310.36 g/mol |
|
|
| ExactMass = 310.165447 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = 178 |
|
| MeltingPt = <!-- °C --> |
|
|
|
| MeltingPt_ref = <ref>{{cite journal|last1=Gmelin|first1=R|last2=Bredenberg JB|first2=son|title=.|journal=Arzneimittel-Forschung|date=February 1966|volume=16|issue=2|pages=123–7|pmid=6014002|language=German}}</ref> |
|
| BoilingPt = <!-- °C --> |
|
|
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
| HPhrases = |
|
|
| PPhrases = |
|
|
| GHS_ref = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
|
'''Sinapine''' is an alkaloidal amine found in ] seeds. It is considered a ] ester of ]. |
|
|
|
|
|
|
|
'''Sinapine''' is an ]al amine found in some seeds, particularly ] of plants in the ] ].<ref name=CompRev>{{cite journal|last1=Niciforovic|first1=Neda|last2=Abramovi|first2=Helena|title=Sinapic Acid and Its Derivatives: Natural Sources and Bioactivity|journal=Comprehensive Reviews in Food Science and Food Safety|date=2014|volume=13|issue=1|pages=34–51|doi=10.1111/1541-4337.12041|pmid=33412688 }}</ref> It is the ] ester of ]. |
|
Sinapine was discovered by ] <!-- and ] -->in 1825.<ref> |
|
|
Metabolism of Sinapine in Mustard Plants. I. Degradation of Sinapine into Sinapic Acid & Choline. Alexander Tzagoloff, Plant Physiol. 1963 March; 38(2), pp. 202–206, {{PMCID|PMC549906}}</ref> |
|
|
|
|
|
|
|
Sinapine was discovered by ] <!-- and ] -->in 1825.<ref>{{Cite journal |
|
==Metabolism== |
|
|
|
| last1 = Tzagoloff | first1 = A. |
|
] is an enzyme whose two substrates are sinapoylcholine (sinapine) and H<sub>2</sub>O and whose two products are sinapate (]) and ]. |
|
|
|
| title = Metabolism of Sinapine in Mustard Plants. I. Degradation of Sinapine into Sinapic Acid & Choline |
|
|
| journal = Plant Physiology |
|
|
| volume = 38 |
|
|
| issue = 2 |
|
|
| pages = 202–206 |
|
|
| year = 1963 |
|
|
| pmid = 16655775 |
|
|
| pmc = 549906 |
|
|
| doi=10.1104/pp.38.2.202 |
|
|
}}</ref> |
|
|
|
|
|
|
==Occurrence== |
|
] is an enzyme whose two substrates are ] and ], whereas its two products are ] and sinapoylcholine (sinapine). |
|
|
|
Sinapine typically occurs in the outer seed coat of ] and is plentiful in some types of ] leftover after ].<ref name=CompRev /> Typical oil seed cake residues high in sinapine include '']'' (1.22% by mass),<ref>{{cite journal|last1=Matthäus|first1=B .|last2=Zubr|first2=J.|title=Variability of specific components in Camelina sativa oilseed cakes|journal=Industrial Crops and Products|date=2000|volume=12|issue=1|pages=9–18|doi=10.1016/S0926-6690(99)00040-0}}</ref> and ] (0.39-1.06% by mass).<ref>{{cite book|last1=Vuorela|first1=Satu|title=Analysis, isolation, and bioactivities of rapeseed phenolics|date=2005|publisher=University of Helsinki|location=Helsinki, Finland|isbn=9789521027215|pages=19–20|url=https://helda.helsinki.fi/bitstream/handle/10138/20877/analysis.pdf?sequence=1|accessdate=14 June 2014}}</ref> |
|
|
|
|
|
==References== |
|
==Isolation== |
|
|
The typical protocol for extracting Sinapine from seed cakes entails ] the cake with ] via a ] followed by extraction with 70% methanol held at 75 °C.<ref>{{cite book|last1=Vuorela|first1=Satu|title=Analysis, isolation, and bioactivities of rapeseed phenolics|date=2005|publisher=University of Helsinki|location=Helsinki, Finland|isbn=9789521027215|pages=19–20|url=https://helda.helsinki.fi/bitstream/handle/10138/20877/analysis.pdf?sequence=1|accessdate=14 June 2014}}</ref> |
|
{{reflist}} |
|
|
|
|
|
|
|
== Metabolism == |
|
] |
|
|
|
] is an enzyme whose two substrates are sinapine and H<sub>2</sub>O and whose two products are ] and ]. |
|
] |
|
|
|
|
|
|
] is an enzyme whose two substrates are ] and ], whereas its two products are ] and sinapine. |
|
|
|
|
|
== See also == |
|
|
{{Div col|colwidth=16em}} |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
{{Div col end}} |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
|
] |
|
{{amine-stub}} |
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |