| Revision as of 23:31, 12 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 21:34, 19 September 2024 edit undoChris Capoccia (talk | contribs)Extended confirmed users86,243 editsNo edit summary |
| (32 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 438028540 |
|
|
|
| Watchedfields = changed |
|
|ImageFile=Sodium dehydroacetate.tif |
|
|
⚫ |
| verifiedrevid = 439174792 |
| ⚫ |
|ImageSize=200px |
|
|
|ImageName=The structure of Sodium dehydroacetate |
|
| ImageFile=Sodium dehydroacetate.svg |
|
⚫ |
| ImageSize=200px |
| ⚫ |
|IUPACName=- |
|
|
|
| ImageName=Chemical structure of sodium dehydroacetate |
| ⚫ |
|OtherNames=- |
|
|
⚫ |
| IUPACName= |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames=E266 |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=4418-26-2 |
|
| CASNo=4418-26-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8W46YN971G |
|
|
| PubChem = 44135708 |
|
|
| InChI = 1S/C8H8O4.Na/c1-4-3-6(10)7(5(2)9)8(11)12-4;/h3,9H,1-2H3;/q;+1/p-1 |
|
|
| SMILES = CC1=CC(=O)C(=C(C))C(=O)O1. |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=8 | H=7 | Na=1 | O=4 |
|
| Formula=C<sub>8</sub>H<sub>7</sub>NaO<sub>4</sub> |
|
|
|
| Appearance = |
|
| MolarMass=- |
|
|
| Appearance= |
|
| Density= |
|
| Density=- |
|
| MeltingPt= |
|
| MeltingPt=- |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
⚫ |
| SolubleOther = |
|
| Solubility=- |
|
| ⚫ |
| SolubleOther =- |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
| LD50 = - |
|
| LD50 = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Sodium dehydroacetate''' is a ] with the formula Na(CH<sub>3</sub>C<sub>5</sub>HO(O<sub>2</sub>)(CH<sub>3</sub>)CO). It is the ] ] of ]. It is used as a preservative in food,<ref>{{cite journal |doi=10.1016/j.postharvbio.2019.01.006 |title=Combination of sodium dehydroacetate and sodium silicate reduces sour rot of citrus fruit |date=2019 |last1=Li |first1=Lu |last2=Tang |first2=Xu |last3=Ouyang |first3=Qiuli |last4=Tao |first4=Nengguo |journal=Postharvest Biology and Technology |volume=151 |pages=19–25 }}</ref> cosmetics and personal care products such as shower gels, which is highly effective against a broad range of bacteria even at low concentrations such as 0.075 g/kg in meat. Its use is regulated in China, Japan and the USA, thus it can only be used in certain foods such as picked vegetables, fermented soy, compound seasonings and pickled mushrooms in China, and only peeled pumpkins in the US at 65 parts per million. It is not approved for use in the EU. It adds an acetic odor to food which can be mitigated using flavorings.<ref>{{Cite web|url=https://www.zmuni.com/en/news/food-additives-gradually-going-down-the-drain-sodium-dehydroacetate-e-266/|title=Food Additives Gradually Going Down the Drain: Sodium Dehydroacetate (E 266)|date=November 30, 2022|website=ZMUni Compliance Centre}}</ref> It can also be used in bread and pastries.<ref>{{Cite web|url=https://foodadditives.net/preservatives/sodium-dehydroacetate/|title=What is Sodium Dehydroacetate in food: Uses and Safety|first=James|last=Han|date=July 20, 2020|website=foodadditives.net}}</ref> It is highly effective when applied to oranges.<ref>{{cite journal |last1=Li |first1=Lu |last2=Tang |first2=Xu |last3=Ouyang |first3=Qiuli |last4=Tao |first4=Nengguo |title=Combination of sodium dehydroacetate and sodium silicate reduces sour rot of citrus fruit |journal=Postharvest Biology and Technology |date=May 2019 |volume=151 |pages=19–25 |doi=10.1016/j.postharvbio.2019.01.006 }}</ref> |
|
|
|
|
|
⚫ |
It has ] E266. |
|
{| align="right" border="1" cellspacing="0" cellpadding="3" style="float: right; clear: right; margin: 0 0 0 0.5em; background: #FFFFFF; border-collapse: collapse; border-color: #C0C090;" |
|
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
⚫ |
] |
|
'''Sodium dehydroacetate''' is a ] with formula Na(CH<sub>3</sub></sub>C<sub>5</sub>HO(O<sub>2</sub>)(CH<sub>3</sub>)CO). It is the ] ] of ]. |
|
|
⚫ |
] |
|
⚫ |
] |
|
|
|
|
| ⚫ |
It has ] "E266". |
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|