Revision as of 18:31, 10 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI').← Previous edit |
Latest revision as of 18:23, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,122 edits removed Category:Phenols; added Category:Phenolates using HotCat |
(21 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 426288563 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444111037 |
|
| ImageFile = Sodium orthophenyl phenol.svg |
|
| ImageFile = Sodium orthophenyl phenol.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = Sodium -2-olate |
|
| ImageFile1 = Sodium orthophenyl phenol ball-and-stick.png |
|
|
| ImageSize1 = 200px |
|
| OtherNames = (1,1'-Biphenyl)-2-ol, sodium salt; 2-Hydroxydiphenyl sodium; ''o''-Phenylphenol sodium; ''o''-Phenylphenol, sodium; Sodium ''o''-phenylphenol; Sodium 2-phenylphenolate; Sodium ''o''-phenylphenate |
|
|
|
| ImageAlt1 = |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| PIN = Sodium -2-olate |
⚫ |
| CASNo = 132-27-4 |
|
|
|
| OtherNames = {{Unbulleted list|(1,1′-Biphenyl)-2-ol, sodium salt|2-Hydroxydiphenyl sodium|''o''-Phenylphenol sodium|''o''-Phenylphenol, sodium|Sodium ''o''-phenylphenol|Sodium 2-phenylphenolate|Sodium ''o''-phenylphenate}} |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| PubChem = 23675735 |
|
|
⚫ |
| CASNo = 132-27-4 |
⚫ |
| StdInChI = 1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1 |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = KFV9K7N7UI |
|
⚫ |
| PubChem = 23675735 |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1 |
|
| SMILES = C1=C(C2=CC=CC=C2)C=CC=C1. |
|
| SMILES = C1=C(C2=CC=CC=C2)C=CC=C1. |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 10764729 |
|
| ChemSpiderID = 10764729 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ChEMBL = 1903906 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KSQXVLVXUFHGJQ-UHFFFAOYSA-N |
|
| StdInChIKey = KSQXVLVXUFHGJQ-UHFFFAOYSA-N |
|
| InChI = InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1 |
|
| InChI = InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=12|H=9|Na=1|O=1 |
|
| C=12 | H=9 | Na=1 | O=1 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
Line 39: |
Line 49: |
|
|
|
|
|
{{DEFAULTSORT:Sodium Orthophenyl Phenol}} |
|
{{DEFAULTSORT:Sodium Orthophenyl Phenol}} |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{Organic-compound-stub}} |
|
{{phenol-stub}} |
|
|
|
|
] |
|