Misplaced Pages

Sodium orthophenyl phenol: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 18:31, 10 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI').← Previous edit Latest revision as of 18:23, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,122 edits removed Category:Phenols; added Category:Phenolates using HotCat 
(21 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Chembox {{Chembox
| Verifiedfields = changed
| verifiedrevid = 426288563
| Watchedfields = changed
| verifiedrevid = 444111037
| ImageFile = Sodium orthophenyl phenol.svg | ImageFile = Sodium orthophenyl phenol.svg
| ImageSize = 200px | ImageSize = 200px
| ImageAlt = | ImageAlt =
| IUPACName = Sodium -2-olate | ImageFile1 = Sodium orthophenyl phenol ball-and-stick.png
| ImageSize1 = 200px
| OtherNames = (1,1'-Bip​henyl)-2-​ol, sodiu​m salt; 2-Hydroxy​diphenyl ​sodium; ''o''-Phenylp​henol sod​ium; ''o''-Phenylp​henol, so​dium; Sodium ''o''-​phenylphe​nol; Sodium 2-phenylphenolate; Sodium ''o''-phenylphenate
| ImageAlt1 =
| Section1 = {{Chembox Identifiers
| PIN = Sodium -2-olate
| CASNo = 132-27-4
| OtherNames = {{Unbulleted list|(1,1′-Biphenyl)-2-ol, sodium salt|2-Hydroxydiphenyl sodium|''o''-Phenylphenol sodium|''o''-Phenylphenol, sodium|Sodium ''o''-phenylphenol|Sodium 2-phenylphenolate|Sodium ''o''-phenylphenate}}
| CASNo_Ref = {{cascite|correct|CAS}}
|Section1={{Chembox Identifiers
| PubChem = 23675735
| CASNo = 132-27-4
| StdInChI = 1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1
| CASNo_Ref = {{cascite|correct|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = KFV9K7N7UI
| PubChem = 23675735
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1
| SMILES = C1=C(C2=CC=CC=C2)C=CC=C1. | SMILES = C1=C(C2=CC=CC=C2)C=CC=C1.
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10764729 | ChemSpiderID = 10764729
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| ChEMBL = 1903906
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KSQXVLVXUFHGJQ-UHFFFAOYSA-N | StdInChIKey = KSQXVLVXUFHGJQ-UHFFFAOYSA-N
| InChI = InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1 | InChI = InChI=1S/C12H10O.Na/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-9,13H;/q;+1
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=12|H=9|Na=1|O=1 | C=12 | H=9 | Na=1 | O=1
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}


Line 39: Line 49:


{{DEFAULTSORT:Sodium Orthophenyl Phenol}} {{DEFAULTSORT:Sodium Orthophenyl Phenol}}
] ]
] ]




{{Organic-compound-stub}} {{phenol-stub}}

]