| Revision as of 04:27, 20 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:04, 19 December 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,415 editsNo edit summary |
| (21 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 265859034 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Solanocapsine-2D-skeletal.png |
|
|
⚫ |
| verifiedrevid = 424969220 |
|
| IUPACName= |
|
|
⚫ |
| ImageFile = Solanocapsine.svg |
|
| OtherNames=(2S,4aS,4bS,6aS,6bR,7S,7aR,10R,11aS,12aR,13aS,13bR,15aS)-<br />2-Aminodocosahydro-4a,6a,7,10-tetramethylnaphthindeno<br />pyranopyridin-11a(1H)-ol; |
|
|
3β-Amino-22,26-epimino-16α,23-epoxy-5α,22αH,25βH-cholestan-23β-ol; |
|
| IUPACName = 3β-Amino-16,23-epoxy-16α,28-seco-5α-solanidan-23β-ol |
|
|
| SystematicName = (2''S'',4a''S'',3b''S'',6a''S'',6b''R'',7''S'',7a''R'',10''R'',11a''S'',12a''R'',13a''S'',13b''R'',15a''S'')-2-Amino-4a,6a,7,10-tetramethyldocosahydronaphthoindenopyranopyridin-11a(1''H'')-ol |
|
(3β,5α,16α,22α,23β,25β)-3-Amino-16,23-epoxy-16,28-secosolanidan-23-ol |
|
| OtherNames = 3β-Amino-22,26-epimino-16α,23-epoxy-5α,22αH,25βH-cholestan-23β-ol; (3β,5α,16α,22α,23β,25β)-3-Amino-16,23-epoxy-16,28-secosolanidan-23-ol |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo=639-86-1 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| SMILES=N1CC2(C)(CC3()2(CC4(C)3()<br />C5()4()(C)C6(C(C)CN6)(O)O5)()C1 |
|
|
⚫ |
| CASNo =639-86-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = WWQ51S32N8 |
|
|
| PubChem = 73419 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 66133 |
|
⚫ |
| SMILES = C1C2(((3(O2)C43(CC54CC65(CC(C6)N)C)C)C)NC1)O |
|
|
| InChI = 1/C27H46N2O2/c1-15-13-27(30)24(29-14-15)16(2)23-22(31-27)12-21-19-6-5-17-11-18(28)7-9-25(17,3)20(19)8-10-26(21,23)4/h15-24,29-30H,5-14,28H2,1-4H3/t15-,16+,17+,18+,19-,20+,21+,22-,23+,24-,25+,26+,27+/m1/s1 |
|
|
| InChIKey = ZPTJKUUQUDRHTL-QAQRTNARBX |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C27H46N2O2/c1-15-13-27(30)24(29-14-15)16(2)23-22(31-27)12-21-19-6-5-17-11-18(28)7-9-25(17,3)20(19)8-10-26(21,23)4/h15-24,29-30H,5-14,28H2,1-4H3/t15-,16+,17+,18+,19-,20+,21+,22-,23+,24-,25+,26+,27+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZPTJKUUQUDRHTL-QAQRTNARSA-N |
|
|
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=27 | H=46 | N=2 | O=2 |
|
| Formula=C<sub>27</sub>H<sub>46</sub>N<sub>2</sub>O<sub>2</sub> |
|
|
⚫ |
| Appearance =Long flat colorless prisms (ethanol-H<sub>2</sub>O)<ref name=barger>{{ cite journal |author1=Barger, L. G. |author2=Fraenkel-Conrat, H. L. | title = 337. Alkaloids from ''Solanum pseudocapsicum'', L. | journal = Journal of the Chemical Society | year = 1936 | volume = 1936 | pages = 1537–1542 | doi = 10.1039/JR9360001537 }}</ref> |
|
| MolarMass=430.666 |
|
|
|
| MeltingPtC = 222 |
| ⚫ |
| Appearance=long flat colorless prisms (ethanol-H<sub>2</sub>O)<ref name=barger>Barger, L. G.; Fraenkel-Conrat, H. L. ''Journal of the Chemical Society'', '''1936''', 1537-42.</ref> |
|
|
| MeltingPt=222 <sup>o</sup>C<ref name=barger/>, 216-217<sup>o</sup>C<ref>Schlittler, E.; Uehlinger, H. ''Helvetica Chimica Acta'', '''1952''', ''35'', 2034-44.</ref> |
|
| MeltingPt_ref = <ref name=barger/> 216-217 °C <ref>{{ cite journal |author1=Schlittler, E. |author2=Uehlinger, H. | title = Über das Sterinalkaloid Solanocapsin | language = German | journal = Helvetica Chimica Acta | year = 1952 | volume = 35 | issue = 6 | pages = 2034–2044 | doi = 10.1002/hlca.19520350633 }}</ref> |
|
}} |
|
}} |
|
}} |
|
}} |
| ⚫ |
'''Solanocapsine''' is a toxic steroidal ] from ''Solanum pseudocapsicum'' (]). |
|
|
|
|
|
|
⚫ |
'''Solanocapsine''' is a toxic ] from ] (''Solanum pseudocapsicum''). |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{alkaloid-stub}} |