| Revision as of 17:31, 3 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 13:24, 3 June 2020 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added FDA UNII |
| (14 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{refimprove|date=January 2009}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400340347 |
|
| verifiedrevid = 400341865 |
|
| ImageFile = Oil Yellow DE.png |
|
| ImageFile = Oil Yellow DE.png |
|
| ImageFile1 = |
|
| ImageFile1 = |
| Line 8: |
Line 7: |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = Solvent yellow 56 <br /> C.I. 11021 |
|
| OtherNames = Solvent yellow 56 <br /> C.I. 11021 |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16286 |
|
| ChemSpiderID = 16286 |
|
| InChI = 1/C16H19N3/c1-3-19(4-2)16-12-10-15(11-13-16)18-17-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3/b18-17+ |
|
| InChI = 1/C16H19N3/c1-3-19(4-2)16-12-10-15(11-13-16)18-17-14-8-6-5-7-9-14/h5-13H,3-4H2,1-2H3/b18-17+ |
| Line 17: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = SJJISKLXUJVZOA-ISLYRVAYSA-N |
|
| StdInChIKey = SJJISKLXUJVZOA-ISLYRVAYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 2481-94-9 |
|
| CASNo = 2481-94-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 17204 |
|
|
|
| UNII = 5E973680S8 |
| ⚫ |
| SMILES = N(=N/c1ccc(N(CC)CC)cc1)\c2ccccc2 |
|
|
⚫ |
| PubChem = 17204 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 91087 |
|
⚫ |
| SMILES = N(=N/c1ccc(N(CC)CC)cc1)\c2ccccc2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = |
|
| C=16 | H=19 | N=3 |
|
| MolarMass = g/mol |
|
| Formula = |
|
| Appearance = |
|
| MolarMass = |
|
| Density = |
|
| Appearance = |
|
| MeltingPt = 168 °C |
|
| Density = |
|
| BoilingPt = |
|
| MeltingPtC = 168 |
|
| Solubility = |
|
| BoilingPt = |
|
|
| Solubility = |
| ⚫ |
}} |
|
| ⚫ |
| Section3 = {{Chembox Hazards |
|
| ⚫ |
| MainHazards = |
|
| ⚫ |
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Solvent Yellow 56''' is the ] ''N'',''N''-diethyl-''p''-(phenylazo)aniline. It is an ], which has the appearance of a reddish yellow powder. Its ] is 219-616-8.<ref name="Ullmann">{{Ullmann|first1 = Klaus|last1 = Hunger|first2 = Peter|last2 = Mischke|first3 = Wolfgang|last3 = Rieper|first4 = Roderich|last4 = Raue|first5 = Klaus|last5 = Kunde|first6 = Aloys|last6 = Engel|title = Azo Dyes|year = 2005|doi = 10.1002/14356007.a03_245}}</ref> Its structure is similar to ], which used as a ] in ], and to ]. |
|
'''Oil Yellow DE''' is a synthetic greenish-yellow ] which has the appearance of a reddish yellow powder. Its ] is 219-616-8. |
|
|
|
|
|
Chemically it is N,N-diethyl-p-(phenylazo)aniline, C<sub>16</sub>H<sub>19</sub>N<sub>3</sub>. Its structure is similar to ], used as a ] in ], and to ]. |
|
|
|
|
|
|
==Uses== |
|
==Uses== |
|
It is used to dye ] ]s, ]s, ]s and ], notably ], ] and ]es, and ] ]s. |
|
It is used to dye ] ]s, ]s, ]s, ] (candles), notably ], ] and ]es, and ] ]s. In pyrotechnics, it is used in some yellow ]s, reflecting its tendency to sublime.<ref name="Ullmann"/> |
|
|
|
|
In pyrotechnics, it is used in some yellow ]s. |
|
|
|
==References== |
|
|
<references /> |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |