| Revision as of 19:07, 5 May 2011 editMystBot (talk | contribs)177,678 editsm r2.7.1) (robot Adding: pl:Soforoza← Previous edit |
Latest revision as of 00:38, 20 July 2023 edit undo2405:4802:1d22:1a90:7882:ac94:3471:4873 (talk)No edit summary |
| (21 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 385317664 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile=Sophorose.svg |
|
|
⚫ |
| verifiedrevid = 427627026 |
| ⚫ |
| ImageSize=300px |
|
|
⚫ |
| ImageFile=Sophorose.svg |
| ⚫ |
| IUPACName=(2''S'',3''R'',4''S'',5''S'',6''R'')-2-(hydroxymethyl)-6-oxyoxane-3,4,5-triol (alpha-Sophorose) |
|
|
⚫ |
| ImageSize=300px |
| ⚫ |
| OtherNames=2-O-beta-D-Glucopyranosyl-alpha-D-glucose |
|
|
|
| IUPACName=2-''O''-β-<small>D</small>-Glucopyranosyl-α-<small>D</small>-glucopyranose |
|
⚫ |
|SystematicName=(2''S'',3''R'',4''S'',5''S'',6''R'')-2-(hydroxymethyl)-6-oxyoxane-3,4,5-triol (alpha-Sophorose) |
|
⚫ |
| OtherNames=2-O-beta-D-Glucopyranosyl-alpha-D-glucose |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=534-46-3 |
|
| CASNo=534-46-3 |
| ⚫ |
| PubChem=88719 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C(1((((O1)O)O2((((O2)CO)O)O)O)O)O)O |
|
|
|
| UNII = ZHQ3C30OP1 |
|
⚫ |
| PubChem=88719 |
|
⚫ |
| SMILES=C(1((((O1)O)O2((((O2)CO)O)O)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 80053 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 1230 |
|
|
| InChI = 1/C12H22O11/c13-1-3-6(16)8(18)10(11(20)21-3)23-12-9(19)7(17)5(15)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11+,12+/m1/s1 |
|
|
| InChIKey = HIWPGCMGAMJNRG-NCFXGAEVBZ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H22O11/c13-1-3-6(16)8(18)10(11(20)21-3)23-12-9(19)7(17)5(15)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11+,12+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = HIWPGCMGAMJNRG-NCFXGAEVSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>12</sub>H<sub>22</sub>O<sub>11</sub> |
|
| Formula=C<sub>12</sub>H<sub>22</sub>O<sub>11</sub> |
|
| MolarMass = 342.30 g/mol |
|
| MolarMass = 342.30 g/mol |
|
⚫ |
| Appearance= |
|
| ExactMass = 342.116212 |
|
|
|
| Density= 1.768 g/mL |
| ⚫ |
| Appearance= |
|
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Sophorose''' is a ], a ] of ]. It differs from other glucose dimers such as ] in having an unusual β-1,2 bond. It was isolated in 1938 from pods of '']''.<ref>{{cite journal |last1=J.B. Harborne |title=Flavonoid sophorosides |journal=Experientia |date=1963 |volume=19 |pages=7–8 |doi=10.1007/BF02135323|pmid=13952724 |s2cid=37926298 }}</ref> It is a component of ].<ref>{{cite book|doi=10.1201/b15250-15|chapter=Sophorolipids|title=Applications of Microbial Engineering|pages=367–407|year=2013|last1=Ribeiro|first1=Isabel|last2=Castro|first2=Matilde|last3=Ribeiro|first3=Maria|isbn=978-1-4665-8577-5}} |
|
'''Sophorose''' is a ]. It is one of the foremost parts of ], ] ] ]. It is a product of the ] of ]. <ref>.</ref> |
|
|
|
</ref> It is a product of the ] of ]. <ref>{{cite journal|doi=10.1111/j.1365-2621.1966.tb01905.x|title=The Thermal Degradation of Sugars I. Thermal Polymerization of Glucose|year=1966|last1=Sugisawa|first1=Hirqshi|last2=Edo|first2=Hiroshi|journal=Journal of Food Science|volume=31|issue=4|pages=561}}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
|
|
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
⚫ |
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
| ⚫ |
] |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|