| Revision as of 16:07, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 459771453 of page Sorafenib for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 05:34, 9 August 2024 edit Boghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,726 edits consistent citation formatting |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{Use dmy dates|date=March 2022}} |
|
{{Drugbox |
|
|
|
{{cs1 config|name-list-style=vanc|display-authors=6}} |
|
| Verifiedfields = changed |
|
|
|
{{Infobox drug |
|
| verifiedrevid = 459451106 |
|
|
|
| verifiedrevid = 464405524 |
|
| IUPAC_name = 4-carbamoylamino]<br>phenoxy]-''N''-methyl-pyridine-2-carboxamide |
|
|
| image = Sorafenib.svg |
|
| image = Sorafenib2DACS.svg |
|
| width = 250 |
|
| width = 300 |
|
|
| alt = |
|
| image2 = Sorafenib 3D 3gcs.png |
|
| image2 = Sorafenib 3D 3gcs.png |
|
|
| width2 = 250 |
|
|
| alt2 = |
|
|
|
|
|
<!--Clinical data--> |
|
<!-- Clinical data --> |
|
|
| pronounce = |
|
| tradename = Nexavar |
|
|
|
| tradename = Nexavar, others |
|
| Drugs.com = {{drugs.com|monograph|nexavar}} |
|
|
|
| Drugs.com = {{drugs.com|monograph|sorafenib}} |
|
| MedlinePlus = a607051 |
|
| MedlinePlus = a607051 |
|
| licence_EU = Nexavar |
|
| DailyMedID = Sorafenib |
|
|
| licence_EU = yes |
|
| licence_US = Sorafenib |
|
| licence_US = Sorafenib |
|
| pregnancy_AU = D |
|
| pregnancy_AU = D |
|
|
| pregnancy_AU_comment = |
|
| pregnancy_US = D |
|
|
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
|
|
| routes_of_administration = ] |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
|
| class = |
|
| legal_US = Rx-only |
|
|
|
| ATCvet = |
|
| routes_of_administration = Oral |
|
|
|
| ATC_prefix = L01 |
|
|
| ATC_suffix = EX02 |
|
|
| ATC_supplemental = |
|
|
|
|
|
<!-- Legal status --> |
|
|
| legal_AU = S4 |
|
|
| legal_AU_comment = |
|
|
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> |
|
|
| legal_BR_comment = |
|
|
| legal_CA = Rx-only |
|
|
| legal_CA_comment = |
|
|
| legal_DE = <!-- Anlage I, II, III or Unscheduled --> |
|
|
| legal_DE_comment = |
|
|
| legal_NZ = <!-- Class A, B, C --> |
|
|
| legal_NZ_comment = |
|
|
| legal_UK = POM |
|
|
| legal_UK_comment = |
|
|
| legal_US = Rx-only |
|
|
| legal_US_comment = <ref name="Nexavar FDA label" /> |
|
|
| legal_EU = Rx-only |
|
|
| legal_EU_comment = <ref name="Nexavar EPAR">{{cite web | title=Nexavar EPAR | website=] (EMA) | date=17 September 2018 | url=https://www.ema.europa.eu/en/medicines/human/EPAR/nexavar | access-date=18 September 2022 | archive-date=14 October 2021 | archive-url=https://web.archive.org/web/20211014220703/https://www.ema.europa.eu/en/medicines/human/EPAR/nexavar | url-status=live }}</ref> |
|
|
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> |
|
|
| legal_UN_comment = |
|
|
| legal_status = <!-- For countries not listed above --> |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!-- Pharmacokinetic data --> |
|
| bioavailability = 29-49% |
|
| bioavailability = 38–49% |
|
| protein_bound = 99.5% |
|
| protein_bound = 99.5% |
|
| metabolism = ] ] and ] (]-mediated) |
|
| metabolism = ] ] and ] (] & ]-mediated) |
|
|
| metabolites = |
|
|
| onset = |
|
| elimination_half-life = 25–48 hours |
|
| elimination_half-life = 25–48 hours |
|
|
| duration_of_action = |
|
| excretion = Fecal (77%) and ] (19%) |
|
|
|
| excretion = Feces (77%) and urine (19%) |
|
|
|
|
|
<!--Identifiers--> |
|
<!-- Identifiers --> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 284461-73-0 |
|
| CAS_number = 284461-73-0 |
|
| ATC_prefix = L01 |
|
| CAS_supplemental = |
|
| ATC_suffix = XE05 |
|
|
| PubChem = 216239 |
|
| PubChem = 216239 |
|
|
| IUPHAR_ligand = 5711 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00398 |
|
| DrugBank = DB00398 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 187440 |
|
| ChemSpiderID = 187440 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9ZOQ3TZI87 |
|
| UNII = 9ZOQ3TZI87 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D08524 |
|
| KEGG = D08524 |
|
|
| KEGG2 = D06272 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 50924 |
|
| ChEBI = 50924 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1336 |
|
| ChEMBL = 1336 |
|
|
| NIAID_ChemDB = |
|
|
| PDB_ligand = BAX |
|
|
| synonyms = Sorafenib tosylate |
|
|
|
|
|
<!--Chemical data--> |
|
<!-- Chemical and physical data --> |
|
| C=21 | H=16 | Cl=1 | F=3 | N=4 | O=3 |
|
| IUPAC_name = 4-carbamoylamino]<br>phenoxy]-''N''-methyl-pyridine-2-carboxamide| C=21 | H=16 | Cl=1 | F=3 | N=4 | O=3 |
|
|
| SMILES = CNC(=O)c1cc(ccn1)Oc2ccc(cc2)NC(=O)Nc3ccc(c(c3)C(F)(F)F)Cl |
|
| molecular_weight = 464.825 g/mol |
|
|
| smiles = CNC(=O)c1cc(ccn1)Oc2ccc(cc2)NC(=O)Nc3ccc(c(c3)C(F)(F)F)Cl |
|
|
| InChI = 1/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) |
|
|
| InChIKey = MLDQJTXFUGDVEO-UHFFFAOYAZ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) |
|
| StdInChI = 1S/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) |
|
|
| StdInChI_comment = |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = MLDQJTXFUGDVEO-UHFFFAOYSA-N |
|
| StdInChIKey = MLDQJTXFUGDVEO-UHFFFAOYSA-N |
|
|
| density = |
|
| synonyms = Nexavar<br>Sorafenib tosylate |
|
|
|
| density_notes = |
|
|
| melting_point = |
|
|
| melting_high = |
|
|
| melting_notes = |
|
|
| boiling_point = |
|
|
| boiling_notes = |
|
|
| solubility = |
|
|
| sol_units = |
|
|
| specific_rotation = |
|
}} |
|
}} |
|
|
|
|
|
'''Sorafenib''', sold under the brand name '''Nexavar''',<ref>{{cite press release |url=https://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/2007/ucm109030.htm |title=FDA Approves Nexavar for Patients with Inoperable Liver Cancer |publisher=FDA |date=19 November 2007 |access-date=10 November 2012 |archive-date=2 January 2017 |archive-url=https://web.archive.org/web/20170102045657/http://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/2007/ucm109030.htm |url-status=dead }}</ref> is a ] inhibitor drug approved for the treatment of primary kidney cancer (advanced ]), advanced primary liver cancer (]), FLT3-ITD positive AML and radioactive iodine resistant advanced thyroid carcinoma. |
|
|
|
|
|
==Mechanism of action== |
|
|
Sorafenib is a ] with activity against many ]s, including ], ] and ]s.<ref name="pmid18852116">{{cite journal | vauthors = Wilhelm SM, Adnane L, Newell P, Villanueva A, Llovet JM, Lynch M | title = Preclinical overview of sorafenib, a multikinase inhibitor that targets both Raf and VEGF and PDGF receptor tyrosine kinase signaling | journal = Molecular Cancer Therapeutics | volume = 7 | issue = 10 | pages = 3129–3140 | date = October 2008 | pmid = 18852116 | doi = 10.1158/1535-7163.MCT-08-0013 | doi-access = free }}</ref><ref name=Keeting2009/> Of the RAF kinases, sorafenib is more selective for ] than ].<ref name="pmid18794803">{{cite journal | vauthors = Smalley KS, Xiao M, Villanueva J, Nguyen TK, Flaherty KT, Letrero R, Van Belle P, Elder DE, Wang Y, Nathanson KL, Herlyn M | title = CRAF inhibition induces apoptosis in melanoma cells with non-V600E BRAF mutations | journal = Oncogene | volume = 28 | issue = 1 | pages = 85–94 | date = January 2009 | pmid = 18794803 | pmc = 2898184 | doi = 10.1038/onc.2008.362 }}</ref> (See ] for details the drug's interaction with B-Raf.) |
|
|
|
|
|
Sorafenib treatment induces ],<ref name=" pmid = 24213221">{{cite journal | vauthors = Zhang Y, Xue D, Wang X, Lu M, Gao B, Qiao X | title = Screening of kinase inhibitors targeting BRAF for regulating autophagy based on kinase pathways | journal = Molecular Medicine Reports | volume = 9 | issue = 1 | pages = 83–90 | date = January 2014 | pmid = 24213221 | doi = 10.3892/mmr.2013.1781 | doi-access = free }}</ref> which may suppress tumor growth. Based on its 1,3-disubstituted urea structure, sorafenib is also a potent ] inhibitor and this activity likely reduces the severity of its adverse effects.<ref>{{cite book | vauthors = Singh N, Hammock B | veditors = Offermanns S, Rosenthal W | title=Encyclopedia of Molecular Pharmacology | publisher=Springer, Cham |date=30 March 2020 | chapter=Soluble Epoxide Hydrolase |doi = 10.1007/978-3-030-21573-6 | hdl=10138/346042 | isbn=978-3-030-21573-6| s2cid=171511522 }}</ref> |
|
|
|
|
|
==Medical uses== |
|
|
Sorafenib is indicated as a treatment for advanced ] (RCC), unresectable ]s (HCC) and ].<ref name = MSR>{{cite web|title=Nexavar (sorafenib) dosing, indications, interactions, adverse effects, and more|work=Medscape Reference|publisher=WebMD|access-date=26 December 2013|url=http://reference.medscape.com/drug/nexavar-sorafenib-342260#showall|archive-date=27 December 2013|archive-url=https://web.archive.org/web/20131227052838/http://reference.medscape.com/drug/nexavar-sorafenib-342260#showall|url-status=live}}</ref><ref name = "Nexavar FDA label">{{cite web|title=Nexavar (sorafenib) tablet, film coated |work=DailyMed|publisher=Bayer HealthCare Pharmaceuticals Inc.|date=November 2013|access-date=26 December 2013|url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=b50667e4-5ebc-4968-a646-d605058dbef0|archive-date=20 September 2015|archive-url=https://web.archive.org/web/20150920064541/http://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=b50667e4-5ebc-4968-a646-d605058dbef0|url-status=live}}</ref><ref name = EMC>{{cite web|title=Nexavar 200mg film-coated tablets - Summary of Product Characteristics (SPC) - (eMC)|work=electronic Medicines Compendium|publisher=Bayer plc|date=27 March 2013|access-date=26 December 2013|url=http://www.medicines.org.uk/emc/medicine/18520/SPC/Nexavar+200mg+film-coated+tablets/|archive-date=27 December 2013|archive-url=https://web.archive.org/web/20131227025137/http://www.medicines.org.uk/emc/medicine/18520/SPC/Nexavar+200mg+film-coated+tablets/|url-status=live}}</ref><ref name = TGA>{{cite web|title=PRODUCT INFORMATION NEXAVAR (sorafenib tosylate)|work=TGA eBusiness Services|publisher=Bayer Australia Ltd|date=12 December 2012|access-date=26 December 2013|url=https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-07403-3|format=PDF|archive-date=14 January 2016|archive-url=https://web.archive.org/web/20160114035221/https://www.ebs.tga.gov.au/ebs/picmi/picmirepository.nsf/pdf?OpenAgent&id=CP-2010-PI-07403-3|url-status=live}}</ref> |
|
|
|
|
|
===Kidney cancer=== |
|
|
Clinical trial results, published January 2007, showed that, compared with placebo, treatment with sorafenib prolongs ] in patients with advanced clear cell renal cell carcinoma in whom previous therapy has failed. The median progression-free survival was 5.5 months in the sorafenib group and 2.8 months in the placebo group (] for disease progression in the sorafenib group, 0.44; 95% confidence interval , 0.35 to 0.55; P<0.01).<ref name="pmid17215530">{{cite journal | vauthors = Escudier B, Eisen T, Stadler WM, Szczylik C, Oudard S, Siebels M, Negrier S, Chevreau C, Solska E, Desai AA, Rolland F, Demkow T, Hutson TE, Gore M, Freeman S, Schwartz B, Shan M, Simantov R, Bukowski RM | title = Sorafenib in advanced clear-cell renal-cell carcinoma | journal = The New England Journal of Medicine | volume = 356 | issue = 2 | pages = 125–134 | date = January 2007 | pmid = 17215530 | doi = 10.1056/NEJMoa060655 | doi-access = free }}</ref> |
|
|
|
|
|
In Australia this is one of two ]-labelled indications for sorafenib, although it is not listed on the ] for this indication.<ref name = TGA/><ref name = PBS/> |
|
|
|
|
|
===Liver cancer=== |
|
|
At ] 2007, results from the SHARP trial<ref name=Llovet2008>{{cite journal | vauthors = Llovet JM, Ricci S, Mazzaferro V, Hilgard P, Gane E, Blanc JF, de Oliveira AC, Santoro A, Raoul JL, Forner A, Schwartz M, Porta C, Zeuzem S, Bolondi L, Greten TF, Galle PR, Seitz JF, Borbath I, Häussinger D, Giannaris T, Shan M, Moscovici M, Voliotis D, Bruix J | title = Sorafenib in advanced hepatocellular carcinoma | journal = The New England Journal of Medicine | volume = 359 | issue = 4 | pages = 378–390 | date = July 2008 | pmid = 18650514 | doi = 10.1056/NEJMoa0708857 | citeseerx = 10.1.1.531.1130 }}</ref> were presented, which showed efficacy of sorafenib in ]. The primary endpoint was median ], which showed a 44% improvement in patients who received sorafenib compared to placebo (] 0.69; 95% CI, 0.55 to 0.87; p=0.0001). Both median survival and ] showed 3-month improvements; however, there was no significant difference in median time to symptomatic progression (''p''=0.77). There was no difference in quality of life measures, possibly attributable to toxicity of sorafenib or symptoms related to underlying progression of liver disease. Of note, this trial only included patients with ].<ref name=Llovet2008/> Because of this trial sorafenib obtained FDA approval for the treatment of advanced hepatocellular carcinoma in November 2007.<ref name=Keeting2009/> |
|
|
|
|
|
In a randomized, double-blind, phase II trial combining sorafenib with ], the median ] was not significantly delayed compared with doxorubicin alone in patients with advanced hepatocellular carcinoma. Median durations of overall survival and ] were significantly longer in patients receiving sorafenib plus doxorubicin than in those receiving doxorubicin alone.<ref name=Keeting2009>{{cite journal | vauthors = Keating GM, Santoro A | title = Sorafenib: a review of its use in advanced hepatocellular carcinoma | journal = Drugs | volume = 69 | issue = 2 | pages = 223–240 | year = 2009 | pmid = 19228077 | doi = 10.2165/00003495-200969020-00006 }}</ref> |
|
|
|
|
|
A prospective single-centre phase II study which included the patients with unresectable hepatocellular carcinoma (HCC) concluding that the combination of sorafenib and ]-] in patients with unresectable HCC is well tolerated and safe, with most toxicities related to sorafenib.<ref name="pmid21911714">{{cite journal | vauthors = Pawlik TM, Reyes DK, Cosgrove D, Kamel IR, Bhagat N, Geschwind JF | title = Phase II trial of sorafenib combined with concurrent transarterial chemoembolization with drug-eluting beads for hepatocellular carcinoma | journal = Journal of Clinical Oncology | volume = 29 | issue = 30 | pages = 3960–3967 | date = October 2011 | pmid = 21911714 | pmc = 4829081 | doi = 10.1200/JCO.2011.37.1021 }}</ref> |
|
|
|
|
|
In Australia this is the only indication for which sorafenib is listed on the ] and hence the only government-subsidised indication for sorafenib.<ref name = PBS>{{cite web|title=Pharmaceutical Benefits Scheme (PBS) -SORAFENIB|work=Pharmaceutical Benefits Scheme|publisher=Australian Government Department of Health|access-date=27 December 2013|url=http://www.pbs.gov.au/medicine/item/9380Q|archive-date=27 December 2013|archive-url=https://web.archive.org/web/20131227071546/http://www.pbs.gov.au/medicine/item/9380Q|url-status=live}}</ref> Along with renal cell carcinoma, hepatocellular carcinoma is one of the ]-labelled indications for sorafenib.<ref name = TGA/> |
|
|
|
|
|
===Thyroid cancer=== |
|
|
On 22 November 2013, sorafenib was approved by the FDA for the treatment of locally recurrent or metastatic, progressive differentiated thyroid carcinoma (DTC) refractory to radioactive iodine treatment.<ref name=FDA-2013-11>{{cite web|url=http://www.cancer.gov/cancertopics/druginfo/fda-sorafenib-tosylate|title=FDA Approval for Sorafenib Tosylate|date=5 October 2006|website=National Cancer Institute|access-date=27 November 2013|archive-date=6 April 2015|archive-url=https://web.archive.org/web/20150406012049/http://www.cancer.gov/cancertopics/druginfo/fda-sorafenib-tosylate|url-status=live}}</ref> |
|
|
|
|
|
The phase III DECISION trial showed significant improvement in progression-free survival but not in overall survival. However, as is known, the side effects were very frequent, specially hand and foot skin reaction.<ref>{{cite news|url=https://www.medpagetoday.com/meetingcoverage/asco/39545|title=ASCO: Sorafenib Halts Resistant Thyroid Cancer|date=4 June 2013|website=www.medpagetoday.com|access-date=21 December 2018|archive-date=23 March 2021|archive-url=https://web.archive.org/web/20210323215502/https://www.medpagetoday.com/MeetingCoverage/ASCO/39545|url-status=live}}</ref> |
|
|
|
|
|
==Adverse effects== |
|
|
'''<big>Adverse effects by frequency</big>'''<br> |
|
|
''Note: Potentially serious side effects are in '''bold'''.''<br> |
|
|
'''Very common (>10% frequency)'''<br> |
|
|
{{div col|colwidth=18em}} |
|
|
* ] |
|
|
* ''']'''<ref group = Note>Low blood ] levels</ref> |
|
|
* ''']'''<ref group = Note>Bleeding; including serious bleeds such as intracranial and intrapulmonary bleeds</ref> |
|
|
* ]<ref group = Note>High blood pressure</ref> |
|
|
* Diarrhea |
|
|
* Rash |
|
|
* ] (hair loss; occurs in roughly 30% of patients receiving sorafenib) |
|
|
* ] |
|
|
* ] (itchiness) |
|
|
* ] |
|
|
* Increased ] |
|
|
* Increased ] |
|
|
* Fatigue |
|
|
* Pain<ref group = Note>Including abdominal pain, headache, tumour pain, etc.</ref> |
|
|
* Nausea |
|
|
* Vomiting<ref group = Note>Considered a low (~10-30%) risk chemotherapeutic agent for causing emesis)</ref><ref name = MSRCH>{{cite web|title=Chemotherapy-Induced Nausea and Vomiting Treatment & Management|work=Medscape Reference|publisher=WebMD|date=3 July 2012|access-date=26 December 2013|url=http://emedicine.medscape.com/article/1355706-treatment#showall|archive-date=27 December 2013|archive-url=https://web.archive.org/web/20131227052153/http://emedicine.medscape.com/article/1355706-treatment#showall|url-status=live}}</ref> |
|
|
{{div col end}} |
|
|
|
|
|
'''Common (1-10% frequency)'''<br> |
|
|
{{div col|colwidth=18em}} |
|
|
* ''']'''<ref group = Note>Low level of ]s in the blood</ref> |
|
|
* ''']'''<ref group = Note>Low level of ] in the blood</ref> |
|
|
* ''']'''<ref group = Note>Low level of ]s in the blood</ref> |
|
|
* ''']'''<ref group = Note>Low level of ]s in the blood</ref> |
|
|
* ] (weight loss) |
|
|
* ''']'''<ref group = Note>Low blood ]</ref> |
|
|
* ''']'''<ref group = Note>Low blood ]</ref> |
|
|
* '''Depression''' |
|
|
* Peripheral sensory neuropathy |
|
|
* ]<ref group = Note>Hearing ringing in the ears</ref> |
|
|
* ''']''' |
|
|
* ''']'''<ref group = Note>Heart attack</ref> |
|
|
* ''']'''<ref group = Note>Lack of blood supply for the heart muscle</ref> |
|
|
* Hoarseness |
|
|
* Constipation |
|
|
* ]<ref group = Note>Mouth swelling, also dry mouth and ]</ref> |
|
|
* ]<ref group = Note>Indigestion</ref> |
|
|
* ]<ref group = Note>Not being able to swallow</ref> |
|
|
* Dry skin |
|
|
* ] |
|
|
* ] |
|
|
* Skin desquamation |
|
|
* ]<ref group = Note>Sore joints</ref> |
|
|
* ]<ref group = Note>Muscle aches</ref> |
|
|
* ''']'''<ref group = Note>Kidney failure</ref> |
|
|
* ]<ref group = Note>Excreting protein in the urine. Not dangerous in itself but it is indicative kidney damage</ref> |
|
|
* ] |
|
|
* ] (weakness) |
|
|
* Fever |
|
|
* Influenza-like illness |
|
|
{{div col end}} |
|
|
* Transient increase in transaminase |
|
|
|
|
|
'''Uncommon (0.1-1% frequency)'''<br> |
|
|
{{div col|colwidth=22em}} |
|
|
* ] |
|
|
* '''Infection''' |
|
|
* Hypersensitivity reactions<ref group = Note>Including skin reactions and ] (hives)</ref> |
|
|
* ''']'''<ref group = Note>Underactive thyroid</ref> |
|
|
* ''']'''<ref group = Note>Overactive thyroid</ref> |
|
|
* ''']'''<ref group = Note>Low blood sodium</ref> |
|
|
* '''Dehydration''' |
|
|
* '''Reversible posterior ]''' |
|
|
* ''']''' |
|
|
* ]<ref group = Note>Runny nose</ref> |
|
|
* '''Interstitial lung disease-like events'''<ref group = Note>], radiation pneumonitis, acute respiratory distress, etc.</ref> |
|
|
* ] (GORD) |
|
|
* ''']'''<ref group = Note>Swelling of the ]</ref> |
|
|
* ''']'''<ref group = Note>Swelling of the ]</ref> |
|
|
* '''Gastrointestinal perforations'''<ref group = Note>Formation of a hole in the ], leading to potentially fatal bleeds</ref> |
|
|
* Increase in ] leading, potentially, to ]<ref group = Note>Yellowing of the skin and eyes due to a failure of the liver to adequately cope with the amount of bilirubin produced by the day-to-day actions of the body</ref> |
|
|
* ''']'''<ref group = Note>Swelling of the ]</ref> |
|
|
* ''']'''<ref group = Note>Swelling of the ]</ref> |
|
|
* ] |
|
|
* ''']'''<ref group="Note" name="auto">A potentially fatal skin reaction</ref> |
|
|
* ''']'''<ref group = Note>A fairly benign form of skin cancer</ref> |
|
|
* ''']''' |
|
|
* ] (swelling of the breast tissue in men) |
|
|
* '''Transient increase in blood alkaline phosphatase''' |
|
|
* '''] abnormal''' |
|
|
* '''] level abnormal''' |
|
|
* '''bulbous skin reaction'''<ref>{{cite journal| vauthors = Hagopian B |title=Unusually Severe Bullous Skin Reaction to Sorafenib: A Case Report|journal= Journal of Medical Cases|date=August 2010|volume=1|issue=1|pages=1–3|doi=10.4021/jmc112e|doi-access=free}}</ref> |
|
|
{{div col end}} |
|
|
|
|
|
'''Rare (0.01-0.1% frequency)''' |
|
|
{{div col|colwidth=18em}} |
|
|
* '''] prolongation'''<ref group = Note>A potentially fatal abnormality in the electrical activity of the heart</ref> |
|
|
* ''']'''<ref group = Note>Swelling of the skin and mucous membranes</ref> |
|
|
* ''']'''<ref group = Note>A potentially fatal allergic reaction</ref> |
|
|
* ''']'''<ref group = Note>Swelling of the liver</ref> |
|
|
* Radiation recall dermatitis |
|
|
* ''']'''<ref group="Note" name="auto"/> |
|
|
* ''']''' |
|
|
* ''']'''<ref group="Note" name="auto"/> |
|
|
* ''']''' |
|
|
* ''']'''<ref group = Note>The rapid breakdown of muscle tissue leading to the build-up of ] in the blood and resulting in damage to the kidneys</ref> |
|
|
{{div col end}} |
|
|
|
|
|
==History== |
|
|
|
|
|
===Renal cancer=== |
|
|
Sorafenib was approved by the U.S. ] (FDA) in December 2005,<ref name=FDAapproval1>{{Cite web |url=http://www.accessdata.fda.gov/drugsatfda_docs/appletter/2005/021923ltr.pdf |title=FDA Approval letter for use of sorafenib in advanced renal cancer |access-date=19 November 2009 |archive-date=30 March 2021 |archive-url=https://web.archive.org/web/20210330040359/https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2005/021923ltr.pdf |url-status=live }}</ref> and received ] marketing authorization in July 2006,<ref name=EUapproval>{{cite web | publisher = ] | work = Enterprise and Industry. | url = http://ec.europa.eu/enterprise/pharmaceuticals/register/h342.htm | title = Nexavar | archive-url = https://web.archive.org/web/20080201001404/http://ec.europa.eu/enterprise/pharmaceuticals/register/h342.htm | archive-date = 1 February 2008 | access-date = 24 April 2007 }}</ref> both for use in the treatment of advanced renal cancer. |
|
|
|
|
|
===Liver cancer=== |
|
|
The European Commission granted marketing authorization to the drug for the treatment of patients with ](HCC), the most common form of liver cancer, in October 2007,<ref name=Euapproval>{{cite press release|title=Nexavar (Sorafenib) Approved for Hepatocellular Carcinoma in Europe|url=http://www.pslgroup.com/news/content.nsf/medicalnews/852571020057CCF685257384005A45B1?OpenDocument&id=&count=10|publisher=Bayer HealthCare Pharmaceuticals and Onyx Pharmaceuticals|date=30 October 2007|access-date=10 November 2012|url-status=dead|archive-url=https://web.archive.org/web/20120206215725/http://www.pslgroup.com/news/content.nsf/medicalnews/852571020057CCF685257384005A45B1?OpenDocument&id=&count=10|archive-date=6 February 2012}}</ref> and FDA approval for this indication followed in November 2007.<ref name=FDAapproval2>{{Cite web |url=http://www.accessdata.fda.gov/drugsatfda_docs/appletter/2007/021923s004,s005,s006,s007.pdf |title=FDA Approval letter for use of sorafenib in inoperable hepatocellular carcinoma |access-date=19 November 2009 |archive-date=31 March 2021 |archive-url=https://web.archive.org/web/20210331020338/https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2007/021923s004,s005,s006,s007.pdf |url-status=live }}</ref> |
|
|
|
|
|
In November 2009, the UK's ] declined to approve the drug for use within the ] in England, Wales and Northern Ireland, stating that its effectiveness (increasing survival in primary liver cancer by 6 months) did not justify its high price, at up to £3000 per patient per month.<ref name=bbc1>{{cite web |url=http://news.bbc.co.uk/1/hi/health/8367614.stm |publisher=BBC News |title=Liver drug 'too expensive' |date=19 November 2009 |access-date=10 November 2012 |archive-date=11 September 2017 |archive-url=https://web.archive.org/web/20170911102550/http://news.bbc.co.uk/1/hi/health/8367614.stm |url-status=live }}</ref> In Scotland the drug had already been refused authorization by the ] for use within ], for the same reason.<ref name=bbc1/> |
|
|
|
|
|
In March 2012, the Indian Patent Office granted a domestic company, ], a license to manufacture generic sorafenib, bringing its price down by 97%. Bayer sells a month's supply, 120 tablets, of Nexavar for{{INRConvert|280000}}. Natco Pharma will sell 120 tablets for {{INRConvert|8800}}, while still paying a 6% royalty to Bayer. The royalty was later raised to 7% on appeal by Bayer.<ref>{{cite web |url=http://www.lawyerscollective.org/updates/supreme-court-says-no-to-bayer-upholds-compulsory-license-on-nexavar.html |url-status=dead |archive-url=https://web.archive.org/web/20150217113537/http://www.lawyerscollective.org/updates/supreme-court-says-no-to-bayer-upholds-compulsory-license-on-nexavar.html |archive-date=17 February 2015 |title=» Supreme Court says no to Bayer, upholds compulsory license on Nexavar}}</ref><ref>{{cite web |url=http://www.ipindia.nic.in/ipoNew/compulsory_License_12032012.pdf |title=Application for Compulsory Licence Under Section 84(1) of the Patents Act, 1970 in Respect of Patent No.215758 | work = Controller of Patents Mumbai |access-date=2 April 2012 |url-status=dead |archive-url=https://web.archive.org/web/20120321173251/http://www.ipindia.nic.in/ipoNew/compulsory_License_12032012.pdf |archive-date=21 March 2012 }}</ref><ref>{{cite journal |doi=10.1038/483250a |title = Indian generics | date = 9–15 March 2012 |journal=Nature |volume=483 |issue=7389 |pages=250–1|bibcode=2012Natur.483..250. |doi-access=free }}</ref> Under ] and the World Trade Organisation TRIPS Agreement, the government can issue a ] when a drug is not available at an affordable price.<ref name="India Patents (Amendment) Act, 2005">{{cite web|title=India Patents (Amendment) Act, 2005|url=http://www.wipo.int/wipolex/en/text.jsp?file_id=128116|publisher=WIPO|access-date=16 January 2013|archive-date=16 January 2013|archive-url=https://web.archive.org/web/20130116013515/http://www.wipo.int/wipolex/en/text.jsp?file_id=128116|url-status=live}}</ref> |
|
|
|
|
|
== Society and culture == |
|
|
=== Nexavar controversy === |
|
|
|
|
|
In January 2014, Bayer's CEO ] allegedly stated that Nexavar was developed for "Western patients who can afford it, not for Indians". A kidney cancer patient would pay $96,000 (£58,000) for a year's course of the Bayer-made drug, whereas the cost of the Indian version of the ] would be around $2,800 (£1,700).<ref>{{Cite web | url=https://archives.cjr.org/the_audit/bloombergs_viral_misquote_1.php | vauthors = Chittum R | date = 29 January 2014 | work = Columbia Journalism Review | title=Bloomberg's viral misquote | access-date=12 September 2019 | archive-date=10 February 2021 | archive-url=https://web.archive.org/web/20210210092049/https://archives.cjr.org/the_audit/bloombergs_viral_misquote_1.php | url-status=live }}</ref> |
|
|
|
|
|
==Research== |
|
|
|
|
|
===Lung=== |
|
|
In some kinds of lung cancer (with squamous-cell histology) sorafenib administered in addition to ] and ] may be ''detrimental'' to patients.<ref>{{cite web | vauthors = Chustecka Z | date = April 25, 2008 |url=http://www.medscape.com/viewarticle/573511|title=Addition of Sorafenib May Be Detrimental in Some Lung Cancer Patients| work = MedScape |access-date=29 October 2010|archive-date=29 August 2021|archive-url=https://web.archive.org/web/20210829064212/https://www.medscape.com/viewarticle/573511|url-status=live}}</ref> |
|
|
|
|
|
===Ovarian cancer=== |
|
|
Sorafenib has been studied as maintenance therapy after ovarian cancer treatment and in combination with chemotherapy for recurrent ovarian cancer but did not show results that led to approval of the drug for these indications.<ref>{{cite journal | vauthors = Ciccone MA, Maoz A, Casabar JK, Machida H, Mabuchi S, Matsuo K | title = Clinical outcome of treatment with serine-threonine kinase inhibitors in recurrent epithelial ovarian cancer: a systematic review of literature | journal = Expert Opinion on Investigational Drugs | volume = 25 | issue = 7 | pages = 781–796 | date = July 2016 | pmid = 27101098 | pmc = 7534810 | doi = 10.1080/13543784.2016.1181748 | s2cid = 28717797 }}</ref> |
|
|
|
|
|
===Brain (recurrent glioblastoma)=== |
|
|
There is a phase I/II study at the Mayo Clinic<ref name="Mayo">{{ClinicalTrialsGov|NCT00329719|Sorafenib and Temsirolimus in Treating Patients With Recurrent Glioblastoma}}</ref> of sorafenib and CCI-779 (]) for recurrent ]. <!-- too much detail : that can be given without causing unacceptable side effects, to determine what effects sorafenib and CCI-779 have on a patient and the brain tumor, to compare patient's response to sorafenib and CCI-779 with laboratory studies of a patient's blood cells and tumor tissues, and to study if the combination will be able to slow the growth of a tumor. --> |
|
|
|
|
|
===Desmoid tumor (aggressive fibromatosis)=== |
|
|
A study performed in 2008 showed that sorafenib is active against ]. This study is being used as justification for using sorafenib as an initial course of treatment in some patients with the condition.<ref>{{cite journal | vauthors = Gounder MM, Lefkowitz RA, Keohan ML, D'Adamo DR, Hameed M, Antonescu CR, Singer S, Stout K, Ahn L, Maki RG | title = Activity of Sorafenib against desmoid tumor/deep fibromatosis | journal = Clinical Cancer Research | volume = 17 | issue = 12 | pages = 4082–4090 | date = June 2011 | pmid = 21447727 | pmc = 3152981 | doi = 10.1158/1078-0432.CCR-10-3322 }}</ref> |
|
|
|
|
|
A phase III clinical trial is testing the effectiveness of sorafenib to treat desmoid tumors (also known as aggressive fibromatosis), after positive results in the first two trial stages. Dosage is typically half of that applied for malignant cancers (400 mg vs 800 mg). NCI are sponsoring this trial.<ref>{{cite web|title=Sorafenib Tosylate in Treating Patients With Desmoid Tumors or Aggressive Fibromatosis|url=http://clinicaltrials.gov/show/NCT02066181|website=Clinicaltrials.gov|access-date=12 November 2014|archive-date=13 November 2014|archive-url=https://web.archive.org/web/20141113012518/http://clinicaltrials.gov/show/NCT02066181|url-status=live}}</ref><ref>{{cite journal | vauthors = Gounder MM, Lefkowitz RA, Keohan ML, D'Adamo DR, Hameed M, Antonescu CR, Singer S, Stout K, Ahn L, Maki RG | title = Activity of Sorafenib against desmoid tumor/deep fibromatosis | journal = Clinical Cancer Research | volume = 17 | issue = 12 | pages = 4082–4090 | date = June 2011 | pmid = 21447727 | pmc = 3152981 | doi = 10.1158/1078-0432.ccr-10-3322 }}</ref><ref>{{cite journal | vauthors = Mangla A, Agarwal N, Schwartz G | title = Desmoid Tumors: Current Perspective and Treatment | journal = Current Treatment Options in Oncology | volume = 25 | issue = 2 | pages = 161–175 | date = February 2024 | pmid = 38270798 | pmc = 10873447 | doi = 10.1007/s11864-024-01177-5 | doi-access = free }}</ref> |
|
|
|
|
|
==See also== |
|
|
* ], a ] ] of sorafenib with improved ] properties |
|
|
|
|
|
==Notes== |
|
|
{{reflist|group = Note}} |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
|
* {{cite web | url = https://druginfo.nlm.nih.gov/drugportal/name/sorafenib | publisher = U.S. National Library of Medicine | work = Drug Information Portal | title = Sorafenib }} |
|
|
* {{cite web | title=Sorafenib | website=National Cancer Institute | url=https://www.cancer.gov/publications/dictionaries/cancer-drug/def/sorafenib-tosylate }} |
|
|
*{{ClinicalTrialsGov|NCT00217399|Sorafenib and Anastrozole in Treating Postmenopausal Women With Metastatic Breast Cancer}} |
|
|
|
|
|
{{Extracellular chemotherapeutic agents}} |
|
|
{{Cytokine receptor modulators}} |
|
|
{{Growth factor receptor modulators}} |
|
|
{{Portal bar | Medicine}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |