Revision as of 22:09, 18 March 2010 editSlamDiego (talk | contribs)Extended confirmed users10,709 edits RVV.← Previous edit |
Latest revision as of 15:29, 19 March 2024 edit undoTautropfli (talk | contribs)149 editsm Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.Tag: 2017 wikitext editor |
(28 intermediate revisions by 23 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
|Reference=<ref>, Joint Expert Committee on Food Additives</ref> |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageFile=Sorbitan tristearate.png |
|
|
|
| verifiedrevid = 350676682 |
⚫ |
|ImageSize=200px |
|
|
⚫ |
| Reference=<ref>, Joint Expert Committee on Food Additives</ref> |
⚫ |
|IUPACName= <small>Octadecanoic acid -4-hydroxy-3-tetrahydrofuranyl] ester</small> |
|
|
⚫ |
| ImageFile=Sorbitan tristearate.png |
|
|OtherNames=Sorbitan trioctadecanoate<br>Span 65<br>E492<br>Anhydrosorbitan tristearate<br>Anhydrosorbitol tristearate |
|
|
⚫ |
| ImageSize=200px |
|
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| IUPACName= <small>Octadecanoic acid -4-hydroxy-3-tetrahydrofuranyl] ester</small> |
⚫ |
| CASNo=26658-19-5 |
|
|
|
| OtherNames={{Unbulleted list |
⚫ |
| PubChem=62815 |
|
|
|
| Sorbitan trioctadecanoate |
⚫ |
| EINECS =247-891-4 |
|
|
|
| E492 |
⚫ |
| SMILES=CCCCCCCCCCCCCCCCCC(=O)OCC(1((CO1)O)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC |
|
|
|
| Anhydrosorbitan tristearate |
⚫ |
| InChi=1/C60H114O8/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-56(62)65-53-55(67-57(63)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)60-59(54(61)52-66-60)68-58(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h54-55,59-61H,4-53H2,1-3H3/t54-,55?,59+,60-/m1/s1 |
|
|
|
| Anhydrosorbitol tristearate |
|
|
| Span 65 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
| Formula=C<sub>60</sub>H<sub>114</sub>O<sub>8</sub> |
|
|
⚫ |
| CASNo=26658-19-5 |
⚫ |
| MolarMass=963.54 g/mol |
|
|
⚫ |
| PubChem=62815 |
⚫ |
| Appearance=Waxy solid |
|
|
⚫ |
| EINECS =247-891-4 |
⚫ |
| Density= |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
⚫ |
| MeltingPt= |
|
|
|
| UNII = 6LUM696811 |
⚫ |
| BoilingPt= |
|
|
⚫ |
| SMILES=CCCCCCCCCCCCCCCCCC(=O)OCC(1((CO1)O)OC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC |
⚫ |
| Solubility= |
|
|
⚫ |
| InChI=1/C60H114O8/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-56(62)65-53-55(67-57(63)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)60-59(54(61)52-66-60)68-58(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h54-55,59-61H,4-53H2,1-3H3/t54-,55?,59+,60-/m1/s1 |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section2={{Chembox Properties |
|
⚫ |
| Formula=C<sub>60</sub>H<sub>114</sub>O<sub>8</sub> |
⚫ |
| MainHazards= |
|
|
⚫ |
| MolarMass=963.54 g/mol |
⚫ |
| FlashPt= |
|
|
⚫ |
| Appearance=Waxy solid |
|
| Autoignition= |
|
|
⚫ |
| Density= |
|
⚫ |
| MeltingPt= |
|
⚫ |
| BoilingPt= |
|
⚫ |
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Sorbitan tristearate''', also known as '''Span 65''', is a nonionic ]. It is variously used as a dispersing agent, ], and ], ] and in ]s. As a food additive, it has the ] E492. |
|
'''Sorbitan tristearate''' is a nonionic ]. It is variously used as a dispersing agent, ], and ], ] and in ]s. As a food additive, it has the ] E492. Brand names for polysorbates include Alkest, Canarcel, and Span. The consistency of sorbitan tristearate is waxy; its color is light cream to tan. |
|
|
|
|
The consistency of sorbitan tristearate is waxy; its color is light cream to tan. |
|
|
|
|
|
|
== See also == |
|
== See also == |
Line 40: |
Line 50: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|