| Revision as of 17:57, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 401002606 of page Sterubin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 00:30, 3 December 2023 edit Citation bot (talk | contribs)Bots5,418,260 edits Add: doi-access, issue. | Use this bot. Report bugs. | #UCB_CommandLine |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400106321 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 470470833 |
|
| ImageFile = Sterubin.png |
|
| ImageFile = Sterubin.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 2-(3,4-Dihydroxy-phenyl)-5-hydroxy-7-methoxy-chroman-4-one |
|
| IUPACName = (2''S'')-3′,4′,5-Trihydroxy-7-methoxyflavan-4-one |
|
|
| SystematicName = (2''S'')-2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydro-4''H''-1-benzopyran-4-one |
|
| OtherNames = 7-Methoxy-3',4',5-trihydroxyflavanone |
|
| OtherNames = 7-Methoxy-3′,4′,5-trihydroxyflavanone |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 1064932 |
|
| ChemSpiderID = 1064932 |
| Line 15: |
Line 17: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DSAJORLEPQBKDA-AWEZNQCLSA-N |
|
| StdInChIKey = DSAJORLEPQBKDA-AWEZNQCLSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 51857-11-5 --> |
|
| CASNo = 51857-11-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 0IT00NY6AC |
|
| PubChem = 1268276 |
|
| PubChem = 1268276 |
|
| SMILES = O=C2c3c(O(c1ccc(O)c(O)c1)C2)cc(OC)cc3O |
|
| SMILES = O=C2c3c(O(c1ccc(O)c(O)c1)C2)cc(OC)cc3O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>6</sub> |
|
| Formula = C<sub>16</sub>H<sub>14</sub>O<sub>6</sub> |
|
| MolarMass = 302.28 g/mol |
|
| MolarMass = 302.28 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = 1.458 g/mL |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Sterubin''' (7-methoxy-3',4',5-trihydroxyflavanone) is a ] flavanone extracted from Yerba Santa ('']'') a plant growing in ].<ref>Patricia Kaminski and Richard Katz. . Flower Essence Society.</ref> |
|
|
|
|
|
Sterubin is one of the four ]s identified by ] in this plant which elicit taste-modifying properties. The others are ], its sodium salt, and ].<ref>{{cite journal |vauthors=Ley JP, Krammer G, Reinders G, Gatfield IL, Bertram HJ |title=Evaluation of bitter masking flavanones from Herba Santa (''Eriodictyon californicum'' (H. and A.) Torr., Hydrophyllaceae) |journal=J. Agric. Food Chem. |volume=53 |issue=15 |pages=6061–6 |date=July 2005 |pmid=16028996 |doi=10.1021/jf0505170 }}</ref> |
|
|
|
|
|
Recent research has demonstrated some neuroprotective properties of Sterubin ''in vitro'', but more research is needed before it can be considered a true drug candidate.<ref>{{cite journal |author1=Wolfgang Fischer |author2=Antonio Currais |author3=Zhibin Liang |author4=Antonio Pinto |author5=Pamela Maher |title=Old age-associated phenotypic screening for Alzheimer's disease drug candidates identifies sterubin as a potent neuroprotective compound from Yerba santa |journal=Redox Biology |volume=21 |date=February 2019 |page=101089 |pmid=30594901 |doi=10.1016/j.redox.2018.101089 |pmc=6309122 }}</ref><ref>{{cite journal |author1=Zhibin Liang |author2=Pamela Maher |title=Structural Requirements for the Neuroprotective and Anti-Inflammatory Activities of the Flavanone Sterubin |journal=Antioxidants |volume=11 |date=November 2022 |issue=11 |page=2197 |pmid=36358569 |pmc=9686938 |doi=10.3390/antiox11112197 |doi-access=free }}</ref><ref>Batya Swift Yasgur. . (Paywalled) Medscape. February 2019.</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Flavanone}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{aromatic-stub}} |