Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Streptolydigin: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 17:59, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456652690 of page Streptolydigin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').  Latest revision as of 20:47, 29 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,249 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
⚫ | verifiedrevid = 470471049
| Watchedfields = changed
⚫ | verifiedrevid = 401065076
| IUPAC_name = 2-non-3-ene-2,2'-oxirane]-7 | IUPAC_name = 2-non-3-ene-2,2'-oxirane]-7
| image = Streptolydigin.png | image = Streptolydigin.png


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| pregnancy_category = | pregnancy_category =
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound =
| metabolism = | metabolism =
| elimination_half-life = | elimination_half-life =


<!--Identifiers--> <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = <!-- blanked - oldvalue: 7229-50-7 --> | CAS_number = 7229-50-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6MON4029Q8
| ATC_prefix = none | ATC_prefix = none
| ATC_suffix = | ATC_suffix =
| ATC_supplemental = | ATC_supplemental =
| PubChem = 220508 | PubChem = 220508
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB04785 | DrugBank = DB04785
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16736035 | ChemSpiderID = 16736035
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1628265 --> | ChEMBL = 1236068
| ChEBI_Ref = {{ebicite|changed|EBI}}
⚫ | C=32 | H=44 | N=2 | O=9
| ChEBI = 45773
| molecular_weight = 600.708 g/mol

<!--Chemical data-->
⚫ | C=32 | H=44 | N=2 | O=9
| smiles = CNC(=O)C(C)C2C(=O)/C(C(=O)N2C1CCC(O)C(C)O1)=C(\O)/C=C/C(/C)=C/C(C)C5OC4(C)OC(\C=C/C34CO3)C5C | smiles = CNC(=O)C(C)C2C(=O)/C(C(=O)N2C1CCC(O)C(C)O1)=C(\O)/C=C/C(/C)=C/C(C)C5OC4(C)OC(\C=C/C34CO3)C5C
| InChI = 1/C32H44N2O9/c1-16(14-17(2)28-18(3)23-12-13-32(15-40-32)31(6,42-23)43-28)8-9-22(36)25-27(37)26(19(4)29(38)33-7)34(30(25)39)24-11-10-21(35)20(5)41-24/h8-9,12-14,17-21,23-24,26,28,35-36H,10-11,15H2,1-7H3,(H,33,38)/b9-8+,16-14+,25-22+
| InChIKey = KVTPRMVXYZKLIG-NCFIBNQNBP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C32H44N2O9/c1-16(14-17(2)28-18(3)23-12-13-32(15-40-32)31(6,42-23)43-28)8-9-22(36)25-27(37)26(19(4)29(38)33-7)34(30(25)39)24-11-10-21(35)20(5)41-24/h8-9,12-14,17-21,23-24,26,28,35-36H,10-11,15H2,1-7H3,(H,33,38)/b9-8+,16-14+,25-22+ | StdInChI = 1S/C32H44N2O9/c1-16(14-17(2)28-18(3)23-12-13-32(15-40-32)31(6,42-23)43-28)8-9-22(36)25-27(37)26(19(4)29(38)33-7)34(30(25)39)24-11-10-21(35)20(5)41-24/h8-9,12-14,17-21,23-24,26,28,35-36H,10-11,15H2,1-7H3,(H,33,38)/b9-8+,16-14+,25-22+
Line 42: Line 44:
| StdInChIKey = KVTPRMVXYZKLIG-NCFIBNQNSA-N | StdInChIKey = KVTPRMVXYZKLIG-NCFIBNQNSA-N
}} }}

'''Streptolydigin''' (Stl) is an ] that works by inhibiting ] chain elongation by binding to ], thus inhibiting ] synthesis inside a ].<ref>{{cite journal | vauthors = Tuske S, Sarafianos SG, Wang X, Hudson B, Sineva E, Mukhopadhyay J, Birktoft JJ, Leroy O, Ismail S, Clark AD, Dharia C, Napoli A, Laptenko O, Lee J, Borukhov S, Ebright RH, Arnold E | display-authors = 6 | title = Inhibition of bacterial RNA polymerase by streptolydigin: stabilization of a straight-bridge-helix active-center conformation | journal = Cell | volume = 122 | issue = 4 | pages = 541–52 | date = August 2005 | pmid = 16122422 | pmc = 2754413 | doi = 10.1016/j.cell.2005.07.017 }}</ref><ref>{{cite journal | vauthors = Temiakov D, Zenkin N, Vassylyeva MN, Perederina A, Tahirov TH, Kashkina E, Savkina M, Zorov S, Nikiforov V, Igarashi N, Matsugaki N, Wakatsuki S, Severinov K, Vassylyev DG | display-authors = 6 | title = Structural basis of transcription inhibition by antibiotic streptolydigin | journal = Molecular Cell | volume = 19 | issue = 5 | pages = 655–66 | date = September 2005 | pmid = 16167380 | doi = 10.1016/j.molcel.2005.07.020 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Vassylyev DG, Vassylyeva MN, Zhang J, Palangat M, Artsimovitch I, Landick R | s2cid = 4320480 | title = Structural basis for substrate loading in bacterial RNA polymerase | journal = Nature | volume = 448 | issue = 7150 | pages = 163–8 | date = July 2007 | pmid = 17581591 | doi = 10.1038/nature05931 | arxiv = 0707.3064 | bibcode = 2007Natur.448..163V }}</ref> Streptolydigin inhibits bacterial RNA polymerase, but not eukaryotic RNA polymerase.<ref>{{cite journal | vauthors = Tuske S, Sarafianos SG, Wang X, Hudson B, Sineva E, Mukhopadhyay J, Birktoft JJ, Leroy O, Ismail S, Clark AD, Dharia C, Napoli A, Laptenko O, Lee J, Borukhov S, Ebright RH, Arnold E | display-authors = 6 | title = Inhibition of bacterial RNA polymerase by streptolydigin: stabilization of a straight-bridge-helix active-center conformation | journal = Cell | volume = 122 | issue = 4 | pages = 541–52 | date = August 2005 | pmid = 16122422 | pmc = 2754413 | doi = 10.1016/j.cell.2005.07.017 }}</ref> It has antibacterial activity against a number of ] ].{{cn|date=January 2023}}

== References ==
{{Reflist}}

]
]
]
]

{{antibiotic-stub}}