| Revision as of 11:31, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 05:26, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (29 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414491946 |
|
| verifiedrevid = 428736494 |
|
|ImageFile1=Sucrose acetate isobutyrate.svg |
|
|ImageFile1=Sucrose acetate isobutyrate.svg |
|
|
| IUPACName=1-''O''-Acetyl-3,4,6-tris-''O''--β-<small>D</small>-fructofuranosyl α-<small>D</small>-glucopyranoside 6-acetate 2,3,4-tris(2-methylpropanoate) |
|
|IUPACName=oxy-4-(2-methylpropanoyloxy)-5-(2-methylpropanoyloxymethyl)oxolan-3-yl] 2-methylpropanoate |
|
|
|
| SystematicName=(2''R'',3''R'',4''S'',5''R'',6''R'')-2--6-<nowiki/>{-3,4-bis-5-<nowiki/>{methyl}oxolan-2-yl]oxy}oxane-3,4,5-triyl tris(2-methylpropanoate) |
|
| IUPACName_hidden=yes |
|
|
|OtherNames=SAIB, Sucrose acetoisobutyrate, HSDB 5657, EINECS 204-771-6, AI3-25354, E444 |
|
| OtherNames=Sucrose acetoisobutyrate<br/>Sucrose diacetate hexaisobutyrate<br/>HSDB 5657; AI3-25354; E444 |
|
|Section1= {{Chembox Identifiers |
|
|Section1= {{Chembox Identifiers |
|
|
| Abbreviations = SAIB |
| ⚫ |
| CASNo=27216-37-1 |
|
|
|
| EINECS = 204-771-6 |
| ⚫ |
| PubChem=31339 |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| SMILES=CC(C)C(=O)OCC1C(C(C(O1)(COC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C(C)C)OC(= |
|
|
⚫ |
| CASNo=27216-37-1 |
|
O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = H5KI1C3YTV |
|
⚫ |
| PubChem=31339 |
|
⚫ |
| SMILES=CC(C)C(=O)OC1(((O1)(COC(=O)C)O2((((O2)COC(=O)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| Formula=C<sub>40</sub>H<sub>62</sub>O<sub>19</sub> |
|
| C=40|H=62|O=19 |
|
|
| Appearance= |
|
| MolarMass=846.909 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3= {{Chembox Hazards |
|
| MainHazards=126-13-6 |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt= |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Sucrose acetoisobutyrate''' ('''SAIB''') is an ] and has ] E444.<ref>, Food Standards Agency</ref> In the United States, SAIB is categorized as ] (GRAS) as a food additive in cocktail mixers, beer, malt beverages, or wine coolers<ref>, U.S. Food and Drug Administration</ref> and is a potential replacement for ]. |
|
'''Sucrose acetoisobutyrate (SAIB)''' is an ] and has ] E444. |
|
|
|
|
|
|
== Chemistry == |
|
== Chemistry == |
|
=== Synthesis === |
|
| ⚫ |
By esterification of ] with ] and isobutyric anhydrides. |
|
|
|
|
|
|
⚫ |
SAIB can be prepared by ] of ] with ] and ]. |
| ⚫ |
== Use == |
|
|
|
|
|
⚫ |
== Uses == |
|
* Beverage emulsions - weighting agent |
|
* Beverage emulsions - weighting agent |
|
* Color cosmetics and skin care |
|
* Color cosmetics and skin care |
|
* Flavorings (Orange Flavor) |
|
* Flavorings (orange flavor) |
|
* Fragrance fixative |
|
* Fragrance fixative |
|
* Hair care |
|
* Hair care |
|
|
* Horse styling products |
|
|
|
|
|
== References == |
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
== External links== |
|
* |
|
* |
|
* |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
] |
|