| Revision as of 19:15, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 455080576 of page Sudan_III for the Chem/Drugbox validation project (updated: 'KEGG'). |
Latest revision as of 13:45, 9 April 2024 edit Skoot13 (talk | contribs)Extended confirmed users1,873 edits ce |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401067109 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Sudan III |
|
|
⚫ |
| verifiedrevid = 470483022 |
| ⚫ |
| ImageFile = Sudan III.svg |
|
|
⚫ |
| Name = Sudan III |
|
| ImageSize = 250px |
|
|
| ImageName = Sudan III |
|
| ImageFile1 =AW Sudan III.jpg |
|
|
| ImageName1 = A sample of dye Sudan III |
| ⚫ |
| IUPACName = 1-((4-(phenyldiazenyl)phenyl)diazenyl)naphthalen-2-ol |
|
|
|
| ImageFile2 = Solvent Red 23.svg |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageSize2 = 200px |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| ImageName2 = Sudan III |
|
⚫ |
| PIN = 1-<nowiki/>{diazenyl}naphthalen-2-ol |
|
|
| OtherNames = Sudan Red BK, Fat Ponceau G, Cerasin Red, C.I. 26100, Solvent Red 23, Solvent Red 164, Sudan Red, Sudan Red III, Sudan V, Sudan Red B, Sudan G, Scarlet B, and Tony Red |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16736189 |
|
| ChemSpiderID = 16736189 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 82535 |
|
|
| ChEMBL = 2001927 |
|
|
| PubChem = 62331 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = ND733RX3JN |
|
| UNII = ND733RX3JN |
| Line 21: |
Line 29: |
|
| CASNo = 85-86-9 |
|
| CASNo = 85-86-9 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: C19527 --> |
|
| KEGG = C19527 |
|
| SMILES = Oc4ccc1ccccc1c4/N=N/c3ccc(\N=N/c2ccccc2)cc3 |
|
| SMILES = Oc4ccc1ccccc1c4/N=N/c3ccc(\N=N/c2ccccc2)cc3 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=22|H=16|N=4|O=1 |
|
| Formula = C<sub>22</sub>H<sub>16</sub>N<sub>4</sub>O |
|
|
|
| Density = |
|
| MolarMass = 352.39 g/mol |
|
|
| Density = |
|
| MeltingPtC = 199 |
|
| MeltingPt = 199 °C |
|
| BoilingPt = |
|
⚫ |
}} |
|
| BoilingPt = |
|
|
|
| Section7 = {{Chembox Hazards |
| ⚫ |
}} |
|
|
|
| Hazards_ref=<ref>{{cite web |title=Safety Data Sheet Sudan III |url=https://www.fishersci.com/store/msds?partNumber=S25593&productDescription=SUDAN+III+10G&vendorId=VN00115888&countryCode=US&language=en |website=fishersci.com |access-date=24 August 2020}}</ref> |
|
|
| ExternalSDS = |
|
|
| PPhrases = {{P-phrases|101|102|103|270|261|264|271|273|280|302+352|304+340|305+351+338|310|312|321|332+313|337+313|362|403+233|405|501}} |
|
|
| GHSPictograms = {{GHS05}}{{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|318|319|335|413}} |
|
|
|
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Sudan III''' is a ] (fat-soluble dye) ]. It is structurally related to ].<ref name="Ullmann">{{Ullmann|first1 = Klaus|last1 = Hunger|first2 = Peter|last2 = Mischke|first3 = Wolfgang|last3 = Rieper|first4 = Roderich|last4 = Raue|first5 = Klaus|last5 = Kunde|first6 = Aloys|last6 = Engel|display-authors=3|title = Azo Dyes|year = 2005|doi = 10.1002/14356007.a03_245}}</ref> |
|
|
|
|
|
==Uses== |
|
|
It is used to color nonpolar substances such as ]s, ]s, ]es, ]s, various ] products, and ] ]s. Its main use is as a ] in the United States mandated by the ] (IRS) to distinguish low-taxed ] from automotive ], and by the ] (EPA) to mark fuels with higher ] content; it is a replacement for ] with better solubility in hydrocarbons.<ref>{{cite web |url=http://www.chevron.com/products/prodserv/fuels/bulletin/diesel/L2_3_9_rf.htm |title=L2_3_9_rf |access-date=2006-02-02 |url-status=dead |archive-url=https://web.archive.org/web/20050510225159/http://www.chevron.com/products/prodserv/fuels/bulletin/diesel/L2_3_9_rf.htm |archive-date=2005-05-10 }}</ref> The IRS requires "a concentration spectrally equivalent to at least 3.9 pounds of... Solvent Red 26 per thousand barrels of fuel" ({{convert|0.0039|lb/oilbbl|mg/L|1|disp=out}});<ref>{{cite web |url=https://www.irs.gov/pub/irs-pdf/p510.pdf |title=Publication 510: Excise Taxes (Including Fuel Tax Credits and Refunds) |date=February 2020 |work=IRS.gov |accessdate=February 10, 2021 |page=9}}</ref> the concentrations required by EPA are roughly 5 times lower. It should be stored at room temperature.<ref name="sas">{{cite web |title=Sudan III |url=https://www.sigmaaldrich.com/deepweb/assets/sigmaaldrich/product/documents/225/689/s4131pis.pdf |website=Sigma Aldrich |access-date=15 February 2023}}</ref> |
|
|
|
|
|
===Biological staining=== |
|
|
Sudan III is a dye used for ]ing. Similar dyes include ], ], and ]. They are used for ] of ] in frozen sections, and some protein bound ] and ] on ] sections. It has the appearance of reddish brown crystals and a maximum absorption at 507(304) nm.<ref>R. D. Lillie. Conn's Biological Stains. Williams & Wilkins, Baltimore, MD., U.S.A.</ref> It has a more orange shade than Oil Red O, lending to its less popular status. In botany, it is used with Light Green SF Yellowish to differentiate between suberized and cutinized plant tissue.<ref name=sas/> |
|
|
|
|
|
==Safety== |
|
|
], Sudan III, and ] have been classified as category 3 ]s by the ].<ref name="pmid18418879">{{cite journal |vauthors=Refat NA, Ibrahim ZS, Moustafa GG, Sakamoto KQ, Ishizuka M, Fujita S |display-authors=3|title=The induction of cytochrome P450 1A1 by Sudan dyes |journal=J. Biochem. Mol. Toxicol. |volume=22 |issue=2 |pages=77–84 |year=2008 |pmid=18418879 |doi=10.1002/jbt.20220 |s2cid=206010951 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
*Susan Budavari, Editor, (1996). The Merck Index, Ed. 12. Merck & Co., Inc., Whitehouse Station, NJ, USA |
|
|
*Edward Gurr, (1971). Synthetic Dyes in Biology, Medicine and Chemistry. Academic Press, London, England. |
|
|
|
|
|
==External links== |
|
|
* entry |
|
|
|
|
|
{{Stains}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |