| Revision as of 19:14, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 401069124 of page Sudan_Yellow_3G for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 05:06, 26 November 2024 edit Guy Harris (talk | contribs)Extended confirmed users76,511 edits dab "toner" |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401067554 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Sudan Yellow 3G.png |
|
|
⚫ |
| verifiedrevid = 470482820 |
| ⚫ |
| ImageSize = 200px |
|
|
⚫ |
| ImageFile = Sudan Yellow 3G.svg |
| ⚫ |
| ImageAlt = |
|
|
⚫ |
| ImageSize = 200px |
|
⚫ |
| ImageAlt = |
|
| IUPACName = 3-Methyl-1-phenyl-4-(phenyldiazenyl)-1''H''-pyrazol-5(4''H'')-one |
|
| IUPACName = 3-Methyl-1-phenyl-4-(phenyldiazenyl)-1''H''-pyrazol-5(4''H'')-one |
|
| PIN = |
|
| PIN = |
|
| OtherNames = Solvent Yellow 16; C.I. disperse yellow; C.I. 12700; 4-phenylazo-1-phenyl-3-methyl-5-pyrazolone; 2,4-dihydro-5-methyl-2-phenyl-4-(phenylazo)-3''H''-pyrazol-3-one |
|
| OtherNames = Solvent Yellow 16; C.I. disperse yellow; C.I. 12700; 4-phenylazo-1-phenyl-3-methyl-5-pyrazolone; 2,4-dihydro-5-methyl-2-phenyl-4-(phenylazo)-3''H''-pyrazol-3-one |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 14850402 |
|
| ChemSpiderID = 14850402 |
|
| InChI = 1/C16H14N4O/c1-12-15(18-17-13-8-4-2-5-9-13)16(21)20(19-12)14-10-6-3-7-11-14/h2-11,19H,1H3/b18-17+ |
|
| InChI = 1/C16H14N4O/c1-12-15(18-17-13-8-4-2-5-9-13)16(21)20(19-12)14-10-6-3-7-11-14/h2-11,19H,1H3/b18-17+ |
| Line 17: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XOCUHWXGSSSCTJ-ISLYRVAYSA-N |
|
| StdInChIKey = XOCUHWXGSSSCTJ-ISLYRVAYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 4314-14-1 --> |
|
|
| PubChem = |
|
| CASNo = 4314-14-1 |
|
|
| ChEMBL = 3145171 |
| ⚫ |
| SMILES = CC=3NN(c1ccccc1)C(=O)C=3/N=N/c2ccccc2 |
|
|
|
| EINECS = 224-330-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = N83897KOD7 |
|
|
| PubChem = 624132 |
|
⚫ |
| SMILES = CC=3NN(c1ccccc1)C(=O)C=3/N=N/c2ccccc2 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=16|H=14|N=4|O=1 |
|
| C=16 | H=14 | N=4 | O=1 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Sudan Yellow 3G''', also known as '''Solvent Yellow 16''', '''C.I. disperse yellow''' and '''C.I. 12700''', is a yellow ]. It is soluble in fats and oils.<ref name="Ullmann">{{Ullmann|first1 = Klaus|last1 = Hunger|first2 = Peter|last2 = Mischke|first3 = Wolfgang|last3 = Rieper|first4 = Roderich|last4 = Raue|first5 = Klaus|last5 = Kunde|first6 = Aloys|last6 = Engel|title = Azo Dyes|year = 2005|doi = 10.1002/14356007.a03_245}}</ref> |
|
|
|
|
|
Sudan Yellow 3G is used as a ] in ] and printer ]s, and as a dye in ]s, including inks for ]s. In ], it is used in some yellow ]s.<ref name="Ullmann"/> |
|
|
|
|
|
==References== |
|
|
<references /> |
|
|
|
|
|
|
|
|
{{DEFAULTSORT:Sudan Yellow 3g}} |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Heterocyclic-stub}} |