| Revision as of 00:51, 11 September 2011 editYobot (talk | contribs)Bots4,733,870 editsm →References: WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)← Previous edit |
Latest revision as of 00:07, 9 March 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,383,276 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Maxim Masiutin - 17855 |
| (11 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 417421121 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 449646558 |
|
| ImageFile = TAPSO.svg |
|
| ImageFile = TAPSO.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = <nowiki>3-amino]-2-hydroxypropane-1-sulfonic acid</nowiki> |
|
| IUPACName = <nowiki>3-amino]-2-hydroxypropane-1-sulfonic acid</nowiki> |
|
| OtherNames = 3--2-hydroxypropanesulfonic acid |
|
| OtherNames = 3--2-hydroxypropanesulfonic acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 68399-81-5 |
|
|
| PubChem = 109334 |
|
| CASNo = 68399-81-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = }} |
|
|
|
| UNII = 45Q4J0071U |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| PubChem = 109334 |
| ⚫ |
| Formula = C<sub>7</sub>H<sub>17</sub>NO<sub>7</sub>S |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| MolarMass = 259.28 g/mol |
|
|
| Appearance = |
|
| ChemSpiderID = 98301 |
|
|
| SMILES = O=S(=O)(O)CC(O)CNC(CO)(CO)CO |
| ⚫ |
| Density = |
|
|
|
| InChI = 1/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15) |
| ⚫ |
| MeltingPt = |
|
|
|
| InChIKey = RZQXOGQSPBYUKH-UHFFFAOYAF |
| ⚫ |
| BoilingPt = |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| Solubility = }} |
|
|
|
| StdInChI = 1S/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15) |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| MainHazards = |
|
|
|
| StdInChIKey = RZQXOGQSPBYUKH-UHFFFAOYSA-N}} |
| ⚫ |
| FlashPt = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| Autoignition = }} |
|
|
⚫ |
| Formula = C<sub>7</sub>H<sub>17</sub>NO<sub>7</sub>S |
|
⚫ |
| MolarMass = 259.28 g/mol |
|
|
| Appearance = |
|
⚫ |
| Density = |
|
⚫ |
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
| Solubility = }} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
'''TAPSO''' is used to make ]s. It has a ] value of 7.635 (I=0, 25°C).<ref>{{cite journal |title=Thermodynamic Quantities for the Ionization Reactions of Buffers |last=Goldberg |first=R. |coauthors=Kishore, N.; Lennen, R. |
|
'''TAPSO''' is used to make ]s. It has a ] value of 7.635 (I=0, 25°C).<ref>{{cite journal |title=Thermodynamic Quantities for the Ionization Reactions of Buffers |last=Goldberg |first=R. |author2=Kishore, N. |author3=Lennen, R. |journal=J. Phys. Chem. Ref. Data |volume=31 |pages=231–370 |year=2002 |issue=2 |url=https://www.nist.gov/data/PDFfiles/jpcrd615.pdf |doi=10.1063/1.1416902 |access-date=2017-07-13 |archive-date=2008-10-06 |archive-url=https://web.archive.org/web/20081006062140/https://www.nist.gov/data/PDFfiles/jpcrd615.pdf |url-status=dead }}</ref> It can be used to make buffer solutions in the ] 7.0-8.2. |
|
|journal=J. Phys. Chem. Ref. Data |volume=31 |pages=231–370 |year=2002 |url=http://www.nist.gov/data/PDFfiles/jpcrd615.pdf |doi=10.1063/1.1416902 |
|
|
}}</ref> It can be used to make buffer solutions in the ] 7.0-8.2. |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |