Misplaced Pages

Talaporfin: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 17:46, 30 August 2011 editBunnyhop11 (talk | contribs)Extended confirmed users19,862 edits dab pdt← Previous edit Latest revision as of 01:18, 11 February 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. Added s2cid. | Use this bot. | #UCB_Other 
(20 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{cs1 config|name-list-style=vanc}}
{{Drugbox
| Verifiedfields = changed
⚫ | verifiedrevid = 447519392
⚫ | IUPAC_name = ''N''-{acetyl}-<small>L</small>-aspartic acid
⚫ | image = Talaporfin.png

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|talaporfin}}
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category =
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status = Rx-only
⚫ | routes_of_administration = ]

<!--Pharmacokinetic data-->
⚫ | bioavailability =
⚫ | protein_bound =
| metabolism =
⚫ | elimination_half-life =
⚫ | excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
⚫ | CAS_number = 110230-98-3
⚫ | CAS_supplemental = <br/>{{CAS|220201-34-3}} (sodium salt)
⚫ | ATC_prefix = none
⚫ | ATC_suffix =
⚫ | ATC_supplemental =
⚫ | PubChem = 5486799
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = P4ROX5ELT2 | UNII = P4ROX5ELT2
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫ | verifiedrevid = 443992135
| ChemSpiderID = 16737134
⚫ | IUPAC_name = ''N''-{acetyl}-<small>L</small>-aspartic acid

⚫ | image = Talaporfin.png
<!--Chemical data-->
⚫ | CAS_number = 110230-98-3
⚫ | chemical_formula =
⚫ | CAS_supplemental = <br/>{{CAS|220201-34-3}} (sodium salt)
⚫ | ATC_prefix = none
⚫ | ATC_suffix =
⚫ | ATC_supplemental =
⚫ | PubChem = 5486799
⚫ | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
⚫ | DrugBank =
⚫ | chemical_formula =
| C=38 | H=41 | N=5 | O=9 | C=38 | H=41 | N=5 | O=9
⚫ | smiles = CCC1=C2C=C3C(=C(C(=N3)C(=C4((C(=N4)C=C5C(=C(C(=CC(=C1C)N2)N5)C=C)C)C)CCC(=O)O)CC(=O)N(CC(=O)O)C(=O)O)C(=O)O)C
| molecular_weight = 711.76 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
⚫ | smiles = CCC1=C2C=C3C(=C(C(=N3)C(=C4((C(=N4)C=C5C(=C(C(=CC(=C1C)N2)N5)C=C)C)C)CCC(=O)O)CC(=O)N(CC(=O)O)C(=O)O)C(=O)O)C
| StdInChI = 1S/C38H41N5O9/c1-7-20-16(3)24-12-26-18(5)22(9-10-32(45)46)35(42-26)23(11-31(44)41-30(37(49)50)15-33(47)48)36-34(38(51)52)19(6)27(43-36)14-29-21(8-2)17(4)25(40-29)13-28(20)39-24/h7,12-14,18,22,30,39,43H,1,8-11,15H2,2-6H3,(H,41,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)/b24-12-,25-13-,26-12-,27-14-,28-13-,29-14-,35-23-,36-23-/t18-,22-,30-/m0/s1
⚫ | bioavailability =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫ | protein_bound =
| metabolism = | StdInChIKey = VSEIDZLLWQQJGK-WSUYNKMOSA-N
⚫ | elimination_half-life =
⚫ | excretion =
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category=
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status = Rx-only
⚫ | routes_of_administration = ]
}} }}


'''Talaporfin''' (], also known as '''aspartyl chlorin''', mono-L-aspartyl chlorine e6, '''NPe6''', or '''LS11''') is a ] used in ] (PDT). '''Talaporfin''' (], also known as '''aspartyl chlorin''', mono-L-aspartyl chlorin e6, '''NPe6''', or '''LS11''') is a ] based ] used in ] (PDT).


It absorbs red light at 664-667&nbsp;nm normally provided by a laser tuned to this wavelength.<ref name="pmid17409904">{{cite journal | vauthors = Usuda J, Kato H, Okunaka T, Furukawa K, Tsutsui H, Yamada K, Suga Y, Honda H, Nagatsuka Y, Ohira T, Tsuboi M, Hirano T | title = Photodynamic therapy (PDT) for lung cancers | journal = Journal of Thoracic Oncology| volume = 1 | issue = 5 | pages = 489–93 | date = June 2006 | pmid = 17409904 | doi = 10.1016/S1556-0864(15)31616-6 | doi-access = | s2cid = 19722977 }}</ref>
It absorbs red light at 664nm normally provided by a laser tuned to this wavelength.<ref>http://journals.lww.com/jto/Fulltext/2006/06000/Photodynamic_Therapy__PDT__for_Lung_Cancers.18.aspx "Photodynamic Therapy (PDT) for Lung Cancers" 2006</ref>


It was approved in Japan (in 2004) for ] of lung cancer and marketed as '''Laserphyrin'''.<ref>http://meeting.ascopubs.org/cgi/content/abstract/24/18_suppl/7229 "Photodynamic therapy using Laserphyrin for centrally located early stage lung cancer" 2006</ref> It was approved in Japan (in 2004) for ] of lung cancer and marketed as '''Laserphyrin'''.<ref>{{cite journal | vauthors = Usuda J, Kato H, Okunaka T, Furukawa K, Honda H, Suga Y, Hirata T, Ohira T, Tsuboi M, Hirano T | title = Photodynamic therapy using Laserphyrin for centrally located early stage lung cancer. | journal = Journal of Clinical Oncology | date = June 2006 | volume = 24 | issue = 18 suppl | pages = 7229 | doi = 10.1200/jco.2006.24.18_suppl.7229 | url = http://meeting.ascopubs.org/cgi/content/abstract/24/18_suppl/7229 }}</ref>


==References== ==References==
{{reflist}} {{reflist}}



{{Chemotherapeutic agents}} {{Chemotherapeutic agents}}



] ]
] ]


{{antineoplastic-drug-stub}}