| Revision as of 18:41, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444131311 of page Tanomastat for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI'). |
Latest revision as of 20:50, 8 November 2024 edit Innerstream (talk | contribs)Autopatrolled, Extended confirmed users4,049 edits partial revert of my last edit - content from BAY 12-9566 appears to be unreliable AI-generated text with falsified references |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 470477373 |
|
⚫ |
| ImageFile = Tanomastat.svg |
|
⚫ |
| ImageSize = |
|
⚫ |
| IUPACName = (''S'')-4-(4'-Chlorobiphenyl-4-yl)-4-oxo-2-butanoic acid |
|
⚫ |
| OtherNames = BAY 12-9566 |
|
⚫ |
| Section1 = {{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = AM1ZX94EXH |
|
| UNII = AM1ZX94EXH |
|
⚫ |
| InChI = 1S/C23H19ClO3S/c24-20-12-10-17(11-13-20)16-6-8-18(9-7-16)22(25)14-19(23(26)27)15-28-21-4-2-1-3-5-21/h1-13,19H,14-15H2,(H,26,27)/t19-/m1/s1 |
| ⚫ |
| ImageFile = Tanomastat.svg |
|
|
⚫ |
| InChIKey = JXAGDPXECXQWBC-LJQANCHMSA-N |
| ⚫ |
| ImageSize = |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| IUPACName = 4-(4'-chlorobiphenyl-4-yl)-4-oxo-2-butanoic acid |
|
|
⚫ |
| CASNo = 179545-77-8 |
| ⚫ |
| OtherNames = |
|
|
⚫ |
| Beilstein = 10706708 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ⚫ |
| InChI = 1S/C23H19ClO3S/c24-20-12-10-17(11-13-20)16-6-8-18(9-7-16)22(25)14-19(23(26)27)15-28-21-4-2-1-3-5-21/h1-13,19H,14-15H2,(H,26,27) |
|
|
⚫ |
| ChEMBL = 261932 |
| ⚫ |
| InChIKey1 = JXAGDPXECXQWBC-UHFFFAOYSA-N |
|
|
⚫ |
| PubChem = 6918336 |
|
| InChI1 = 1S/C23H19ClO3S/c24-20-12-10-17(11-13-20)16-6-8-18(9-7-16)22(25)14-19(23(26)27)15-28-21-4-2-1-3-5-21/h1-13,19H,14-15H2,(H,26,27) |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| CASNo = |
|
|
⚫ |
| ChemSpiderID = 5293540 |
| ⚫ |
| Beilstein = 10706708 |
|
|
|
| SMILES = C1=CC=C(C=C1)SC(CC(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)Cl)C(=O)O |
| ⚫ |
| ChEMBL = 83616 |
|
|
⚫ |
}} |
| ⚫ |
| PubChem = 177347 |
|
|
⚫ |
|Section2 = {{Chembox Properties |
| ⚫ |
| ChemSpiderID = 154422 |
|
|
⚫ |
| C=23 | H=19 | Cl=1 | O=3 | S=1 |
|
| StdInChIKey = JXAGDPXECXQWBC-UHFFFAOYSA-N |
|
|
⚫ |
| Appearance = |
|
| SMILES = Clc3ccc(c2ccc(C(=O)CC(C(=O)O)CSc1ccccc1)cc2)cc3 |
|
|
|
| Density = |
|
| StdInChI = 1S/C23H19ClO3S/c24-20-12-10-17(11-13-20)16-6-8-18(9-7-16)22(25)14-19(23(26)27)15-28-21-4-2-1-3-5-21/h1-13,19H,14-15H2,(H,26,27) |
|
|
|
| MeltingPt = |
| ⚫ |
}} |
|
|
|
| BoilingPt = |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| Solubility = |
| ⚫ |
| Formula = |C=23|H=19|Cl=1|O=3|S=1| |
|
|
⚫ |
}} |
|
| MolarMass = |
|
|
⚫ |
|Section3 = {{Chembox Hazards |
| ⚫ |
| Appearance = |
|
|
| Density = |
|
| MainHazards = |
|
| MeltingPt = |
|
| FlashPt = |
|
| BoilingPt = |
|
| AutoignitionPt = |
|
⚫ |
}} |
| ⚫ |
| Solubility = |
|
| ⚫ |
}} |
|
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
|
|
|
|
|
'''Tanomastat''' (development code '''BAY 12-9566''') is a non-peptidic biphenyl inhibitor of ]s (MMPs), primarily studied for its potential to treat various types of ], including ] and other malignancies. |
|
|
|
|
|
Excision of malignant tumors comprises first line treatment for cancer of solid tissues. This procedure not infrequently misses small fragments of the tumor that may have broken off before surgery from the principal site of the disease. These fragments, ], often proliferate at quite remote locations where they cause much of the pathology of cancer. A series of proteolytic enzymes present in tumor cells, known as ], help establish growth of these ] at the newly invaded sites; these ] are also involved in the formation of new blood vessels that will nourish the invasive cell masses. Consequently, considerable research has been devoted to ] as a target for anticancer drugs. Clinical results with these |
|
|
compounds have to date produced equivocal results.<ref>{{Cite journal |last1=Coussens |first1=L. M. |author-link=Lisa Coussens |year=2002 |title=Matrix Metalloproteinase Inhibitors and Cancer--Trials and Tribulations |journal=Science |volume=295 |issue=5564 |pages=2387–92 |doi=10.1126/science.1067100 |pmid=11923519 |bibcode=2002Sci...295.2387C |s2cid=19944201}}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
{{Antivirals}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |