| Revision as of 10:21, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 451333365 of page Taurochenodeoxycholic_acid for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 22:06, 8 December 2023 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Alter: doi. Add: s2cid. | Use this bot. Report bugs. |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 451331803 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Taurochenodeoxycholic acid.svg |
|
|
⚫ |
| verifiedrevid = 477860939 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Taurochenodeoxycholic acid.svg |
| ⚫ |
|IUPACName=-phenanthren-17-yl]pentanoylamino]ethanesulfonic acid |
|
|
⚫ |
| ImageSize=200px |
|
|IUPACName_hidden=yes |
|
|
|
| IUPACName=2-(3α,7α-Dihydroxy-5β-cholan-24-amido)ethane-1-sulfonic acid |
| ⚫ |
|OtherNames=12-Deoxycholyltaurine; 12-Desoxycholyltaurine; Chenodeoxycholyltaurine; Chenyltaurine |
|
|
⚫ |
| SystematicName=2-<nowiki/>{(4''R'')-4-phenanthren-1-yl]pentanamido}ethane-1-sulfonic acid |
|
⚫ |
| OtherNames=12-Deoxycholyltaurine; 12-Desoxycholyltaurine; Chenodeoxycholyltaurine; Chenyltaurine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4747 |
|
| CASNo = <!-- blanked - oldvalue: 516-35-8 --> |
|
|
|
| CASNo=516-35-8 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| ChEMBL = 185878 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 651KU15938 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 185878 |
|
| PubChem = 387316 |
|
| PubChem = 387316 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 343282 |
|
| ChemSpiderID = 343282 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 16525 |
|
| ChEBI = 16525 |
|
| SMILES = O=S(=O)(O)CCNC(=O)CC(1CC21(C)CC42(O)C3C(O)CC34C)C |
|
| SMILES = O=S(=O)(O)CCNC(=O)CC(1CC21(C)CC42(O)C3C(O)CC34C)C |
|
| InChI = 1/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17+,18-,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
|
| InChI = 1/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17+,18-,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
|
| InChIKey = BHTRKEVKTKCXOH-BJLOMENOBE |
|
| InChIKey = BHTRKEVKTKCXOH-BJLOMENOBE |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17+,18-,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
|
| StdInChI = 1S/C26H45NO6S/c1-16(4-7-23(30)27-12-13-34(31,32)33)19-5-6-20-24-21(9-11-26(19,20)3)25(2)10-8-18(28)14-17(25)15-22(24)29/h16-22,24,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17+,18-,19-,20+,21+,22-,24+,25+,26-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = BHTRKEVKTKCXOH-BJLOMENOSA-N |
|
| StdInChIKey = BHTRKEVKTKCXOH-BJLOMENOSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=26|H=45|N=1|O=6|S=1 |
|
| C=26 | H=45 | N=1 | O=6 | S=1 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Taurochenodeoxycholic acid''' is a ] formed in the liver of most species, including humans, by conjugation of ] with ].<ref name="pmid10597755">{{cite journal |author=Hofmann AF |title=The continuing importance of bile acids in liver and intestinal disease |journal=Arch. Intern. Med. |volume=159 |issue=22 |pages=2647–58 |year=1999 |pmid=10597755 |doi= 10.1001/archinte.159.22.2647|s2cid=21211064 |doi-access= }}</ref> It is secreted into ] and then into the intestine.<ref name="pmid16872555">{{cite journal | vauthors = Perez de la Cruz Moreno M, Oth M, Deferme S, Lammert F, Tack J, Dressman J, Augustijns P | title = Characterization of fasted-state human intestinal fluids collected from duodenum and jejunum | journal = The Journal of Pharmacy and Pharmacology | volume = 58 | issue = 8 | pages = 1079–89 | date = August 2006 | pmid = 16872555 | doi = 10.1211/jpp.58.8.0009 | url = | doi-access = free }}</ref> It is usually ionized at physiologic pH. However, although it can be crystallized as the sodium salt. |
|
|
|
|
|
It acts as a detergent to solubilize fats in the small intestine and is itself absorbed by active transport in the terminal ].<ref name="pmid4562149">{{cite journal | vauthors = Carey MC, Small DM | title = Micelle formation by bile salts. Physical-chemical and thermodynamic considerations | journal = Archives of Internal Medicine | volume = 130 | issue = 4 | pages = 506–27 | date = October 1972 | pmid = 4562149 | doi = 10.1001/archinte.1972.03650040040005| url = }}</ref> |
|
|
|
|
|
It is used as a ] and ]. |
|
|
|
|
|
==See also== |
|
|
* ], an ] |
|
|
* See article about ] as an interferent in ] (PFOS) mass spectrometry analysis. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{steroid-stub}} |