| Revision as of 18:45, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456844955 of page Tazobactam for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 21:30, 14 August 2023 edit Iljhgtn (talk | contribs)Extended confirmed users37,107 edits Removing unsourced contentTag: Visual edit |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{distinguish|Teixobactin}} |
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 430486404 |
|
| verifiedrevid = 470478033 |
|
| IUPAC_name = (2''S'',3''S'',5''R'')-3-methyl-7-oxo-3-(1''H''-1,2,3-triazol-1-ylmethyl)-4-thia-1-azabicycloheptane-2-carboxylic acid 4,4-dioxide |
|
| IUPAC_name = (2''S'',3''S'',5''R'')-3-Methyl-7-oxo-3-(1''H''-1,2,3-triazol-1-ylmethyl)-4-thia-1-azabicycloheptane-2-carboxylic acid 4,4-dioxide |
|
| image = Tazobactam.svg |
|
| image = Tazobactam structure.svg |
|
|
| image2 = Tazobactam-from-xtal-3D-bs-17.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|tazobactam}} |
|
| Drugs.com = {{drugs.com|international|tazobactam}} |
|
| pregnancy_category = |
|
| pregnancy_category = B |
|
| legal_status = |
|
| licence_EU = yes |
|
|
| legal_status = Rx-only |
|
| routes_of_administration = |
|
| routes_of_administration = Intravenous |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 89786-04-9 |
|
| CAS_number = 89786-04-9 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
|
| ATC_suffix = CG02 |
|
| ATC_suffix = CG02 |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 123630 |
|
| PubChem = 123630 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01606 |
|
| DrugBank = DB01606 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9421 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 110216 |
|
| ChemSpiderID = 110216 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = SE10G96M8W |
|
| UNII = SE10G96M8W |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00660 |
|
| KEGG = D00660 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| Line 39: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=12 | N=4 | O=5 | S=1 |
|
| C=10 | H=12 | N=4 | O=5 | S=1 |
|
| molecular_weight = 300.289 g/mol |
|
|
| smiles = O=S2(=O)((N1C(=O)C12)C(=O)O)(Cn3nncc3)C |
|
| smiles = O=S2(=O)((N1C(=O)C12)C(=O)O)(Cn3nncc3)C |
|
| InChI = 1/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 |
|
|
| InChIKey = LPQZKKCYTLCDGQ-WEDXCCLWBT |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 |
|
| StdInChI = 1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10+/m1/s1 |
| Line 49: |
Line 52: |
|
| StdInChIKey = LPQZKKCYTLCDGQ-WEDXCCLWSA-N |
|
| StdInChIKey = LPQZKKCYTLCDGQ-WEDXCCLWSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Tazobactam''' is a ] that ] the action of bacterial ], especially those belonging to the ] and ] groups. It is commonly used as its sodium ], tazobactam sodium. |
|
|
|
|
|
Tazobactam is combined with the ] ] ] in the drug ], used in infections due to '']''. Tazobactam broadens the spectrum of piperacillin by making it effective against organisms that express ] and would normally degrade piperacillin.<ref>{{cite journal | vauthors = Yang Y, Rasmussen BA, Shlaes DM | title = Class A beta-lactamases--enzyme-inhibitor interactions and resistance | journal = Pharmacology & Therapeutics | volume = 83 | issue = 2 | pages = 141–151 | date = August 1999 | pmid = 10511459 | doi = 10.1016/S0163-7258(99)00027-3 }}</ref> |
|
|
|
|
|
Tazobactam was patented in 1982 and came into medical use in 1992.<ref>{{cite book| vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery|date=2006|publisher=John Wiley & Sons|isbn=9783527607495|page=490|url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA490 |language=en}}</ref> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{PenicillinAntiBiotics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{antibiotic-stub}} |