| Revision as of 16:28, 6 December 2010 editCitation bot (talk | contribs)Bots5,424,102 editsm Citations: added: doi, pmid. Rjwilmsi← Previous edit |
Latest revision as of 16:00, 28 November 2024 edit undoAnomieBOT (talk | contribs)Bots6,568,448 editsm Dating maintenance tags: {{Cn}} |
| (16 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| verifiedrevid = 400875358 |
|
| ImageFile = Telomestatin.png |
|
| ImageFile = Telomestatin.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageAlt = |
|
| ImageAlt = |
|
|
| PIN = (8<sup>4</sup>''R'')-6<sup>5</sup>,7<sup>5</sup>-Dimethyl-8<sup>4</sup>,8<sup>5</sup>-dihydro-1(2,4),2,3,4,5,6,7(4,2)-heptakis(oxazolo)-8(2,4)-thiazolocyclooctaphane |
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 265114-54-3 |
|
|
| PubChem = 11954679 |
|
| CASNo = 265114-54-3 |
|
|
| PubChem = 11954679 |
| ⚫ |
| SMILES = CC1=C(C2=NC(C3=NC(C4=NC(C5=NC(C6=NC(C7=NC(C8=N9()CS8)=CO7)=CO6)=CO5)=CO4)=CO3)=C(C)O2)N=C9O1 |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 443683 |
|
⚫ |
| SMILES = CC1=C(C2=NC(C3=NC(C4=NC(C5=NC(C6=NC(C7=NC(C8=N9()CS8)=CO7)=CO6)=CO5)=CO4)=CO3)=C(C)O2)N=C9O1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=26 | H=14 | N=8 | O=7 | S=1 |
|
| C=26 | H=14 | N=8 | O=7 | S=1 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Telomestatin''' is a ] ] that acts by inhibiting the ] activity of the cancer cells.<ref name=Shin-ya>{{cite journal | doi = 10.1021/ja005780q | author = Shin-ya, Kazuo; Wierzba, Konstanty; Matsuo, Ken-ichi; Ohtani, Toshio; Yamada, Yuji; Furihata, Kazuo; Hayakawa, Yoichi; Seto, Haruo | title = Telomestatin, a novel telomerase inhibitor from Streptomyces anulatus | journal = Journal of the American Chemical Society | year = 2001 | volume = 123 | issue = 6 | pages = 1262–1263 | pmid = 11456694}}</ref> It was first isolated from the bacteria '']''.<ref name=Shin-ya/> Telomestatin induces the formation of basket-type ] (G4) structures from hybrid-type G-quadruplexes in the ]. Upon formation of G4 structure there will be a decrease in the activity of the telomerase, which is involved in the replication of the telomeres and as a result the cell dies due to ] type ]. |
|
'''Telomestatin''' is a ] ] that acts by inhibiting the ] activity of ''in vitro'' cancer cells.<ref name=Shin-ya>{{cite journal | doi = 10.1021/ja005780q |author1=Shin-ya, Kazuo |author2=Wierzba, Konstanty |author3=Matsuo, Ken-ichi |author4=Ohtani, Toshio |author5=Yamada, Yuji |author6=Furihata, Kazuo |author7=Hayakawa, Yoichi |author8=Seto, Haruo | title = Telomestatin, a novel telomerase inhibitor from Streptomyces anulatus | journal = Journal of the American Chemical Society | year = 2001 | volume = 123 | issue = 6 | pages = 1262–1263 | pmid = 11456694}}</ref> It was first isolated from the bacteria '']''.<ref name=Shin-ya/> Telomestatin induces the formation of basket-type ] (G4) structures from hybrid-type G-quadruplexes in the ]. Upon formation of G4 structure there will be a decrease in the activity of the telomerase, which is involved in the replication of the telomeres and as a result the cell dies due to ] type ].{{cn|date=November 2024}} |
|
|
|
|
|
==References== |
|
==References== |
| Line 30: |
Line 35: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |