| Revision as of 06:29, 11 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEBI').← Previous edit |
Latest revision as of 02:40, 11 February 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers30,619 edits Added the cs1 style template to denote Vancouver ("vanc") citation style, because references contain "vauthors" attribute to specify the list of authors. Added doi. | Use this bot. | #UCB_Other |
| (37 intermediate revisions by 24 users not shown) |
| Line 1: |
Line 1: |
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444215306 |
|
⚫ |
| ImageFile=Temefos.svg |
|
⚫ |
| ImageFile2=Temefos 3D.png |
|
⚫ |
| ImageSize=300px |
|
⚫ |
| ImageSize2=300px |
|
|
| PIN=''O''-phenyl}sulfanyl)phenyl] ''O'',''O''-dimethyl phosphorothioate |
|
⚫ |
| OtherNames=-<br />dimethoxy-sulfanylidene-phosphorane |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = ONP3ME32DL |
|
| UNII = ONP3ME32DL |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| verifiedrevid = 414541346 |
|
| ⚫ |
|ImageFile=Temefos.svg |
|
| ⚫ |
|ImageFile2=Temefos 3D.png |
|
| ⚫ |
|ImageSize=300px |
|
| ⚫ |
|ImageSize2=300px |
|
|
|IUPACName=''O'',''O'',''O′'',''O′''-Tetramethyl ''O'',''O''′-sulfanediylbis(1,4-phenylene) diphosphorothioate |
|
| ⚫ |
|OtherNames=-<br>dimethoxy-sulfanylidene-phosphorane |
|
| ⚫ |
|Section1= {{Chembox Identifiers |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 5199 |
|
| ChemSpiderID = 5199 |
|
| InChI = 1/C16H20O6P2S3/c1-17-23(25,18-2)21-13-5-9-15(10-6-13)27-16-11-7-14(8-12-16)22-24(26,19-3)20-4/h5-12H,1-4H3 |
|
| InChI = 1/C16H20O6P2S3/c1-17-23(25,18-2)21-13-5-9-15(10-6-13)27-16-11-7-14(8-12-16)22-24(26,19-3)20-4/h5-12H,1-4H3 |
| Line 19: |
Line 21: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WWJZWCUNLNYYAU-UHFFFAOYSA-N |
|
| StdInChIKey = WWJZWCUNLNYYAU-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=3383-96-8 |
|
| CASNo=3383-96-8 |
|
| PubChem=5392 |
|
| PubChem=5392 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1355821 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D06062 |
|
| KEGG = D06062 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 38954 |
|
| ChEBI = 38954 |
|
| SMILES = S=P(OC)(OC)Oc2ccc(Sc1ccc(OP(=S)(OC)OC)cc1)cc2 |
|
| SMILES = S=P(OC)(OC)Oc2ccc(Sc1ccc(OP(=S)(OC)OC)cc1)cc2 |
|
| MeSHName=Temefos |
|
| MeSHName=Temefos |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|C=16|H=20|O=6|P=2|S=3 |
|
| C=16 | H=20 | O=6 | P=2 | S=3 |
|
| Appearance= |
|
| Appearance= white, crystalline solid<ref name=PGCH/> |
|
| Density=1.32 g cm<sup>-3</sup> |
|
| Density=1.32 g cm<sup>−3</sup> |
|
| MeltingPtC=30 |
|
| MeltingPtC=30 |
|
|
| BoilingPtC=120-125<ref name=PGCH/> |
|
| BoilingPt= |
|
|
|
| BoilingPt_notes = (decomposes) |
|
| Solubility= |
|
|
|
| Solubility= insoluble<ref name=PGCH/> |
|
|
| VaporPressure = 0.00000007 mmHg (20°C)<ref name=PGCH/> |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
|
| PEL = 15 mg/m<sup>3</sup><ref name=PGCH>{{PGCH|0589}}</ref> |
|
|
| IDLH = N.D.<ref name=PGCH/> |
|
|
| REL = TWA 10 mg/m<sup>3</sup> (total) TWA 5 mg/m<sup>3</sup> (resp)<ref name=PGCH/> |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Temefos''' or '''Temephos''' (trade name '''Abate''') is an ] ] used to treat water infested with disease-carrying ]<ref></ref> including ]es, ]s, and ] ]e. |
|
'''Temefos''' or '''temephos''' (trade name '''Abate''') is an ] ] used to treat water infested with disease-carrying ]<ref></ref> including ]es, ]s, and ] ]e. |
|
|
|
|
|
As with other organophosphates, temephos affects the ] through inhibition of ]. In larvae, this results in death before reaching the adult stage. |
|
As with other organophosphates, temephos affects the ] through inhibition of ]. In larvae, this results in death before reaching the adult stage. |
|
|
|
|
|
In the ] where the ]-borne disease ] is ], temephos is widely used and applied by both private and public pest control in areas of ] where the '']'' mosquito breeds in order to reduce the population of this disease-carrying insect.<ref></ref> Temephos is also used in the ] ] program to kill water fleas that carry guinea worm larvae. |
|
In the ] where the ]-borne disease ] is ], temephos is widely used and applied by both private and public pest control in areas of ] where the '']'' mosquito breeds in order to reduce the population of this disease-carrying insect.<ref></ref> Temephos is also used in the ] program to kill ] that carry guinea worm larvae. |
|
|
|
| ⚫ |
Resistance to temephos by ''A. aegypti'' has been seen in ]. The Brazilian Aedes aegypti resistance monitoring program detected temephos resistance in ''A. aegypti'' populations from several localities in the country in 1999 (Funasa 2000, Lima et al. 2003). In 1999, mosquitoes from the city of ] were already resistant to temephos.<ref>{{cite journal |author=Lima JB, Da-Cunha MP, Da Silva RC, ''et al.'' |title=Resistance of Aedes aegypti to organophosphates in several municipalities in the State of Rio de Janeiro and Espírito Santo, Brazil |journal=Am. J. Trop. Med. Hyg. |volume=68 |issue=3 |pages=329–33 |year=2003 |pmid=12685640 |doi=}}</ref> |
|
|
|
|
|
|
|
|
|
⚫ |
Resistance to temephos by ''A. aegypti'' has been seen in ]. The Brazilian Aedes aegypti resistance monitoring program detected temephos resistance in ''A. aegypti'' populations from several localities in the country in 1999 (Funasa 2000, Lima et al. 2003). In 1999, mosquitoes from the city of ] were already resistant to temephos.<ref>{{cite journal |vauthors=Lima JB, Da-Cunha MP, Da Silva RC, etal |title=Resistance of Aedes aegypti to organophosphates in several municipalities in the State of Rio de Janeiro and Espírito Santo, Brazil |journal=Am. J. Trop. Med. Hyg. |volume=68 |issue=3 |pages=329–33 |year=2003 |doi=10.4269/ajtmh.2003.68.329 |pmid=12685640 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
==External links== |
|
* |
|
* |
|
* |
|
* |
|
* |
|
* |
|
|
* {{PPDB|618}} |
|
|
|
|
|
|
== Bibliography == |
|
{{insecticides}} |
|
|
|
* Dejous C & Elouard J.M (1977) (in French). |
|
{{Cholinergics}} |
|
|
|
|
|
|
|
{{Insecticides}} |
|
|
{{Acetylcholine metabolism and transport modulators}} |
|
|
{{Authority control}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|
|
] |
|
|
] |
|