| Revision as of 12:22, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444217414 of page Terbuthylazine for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 00:11, 18 October 2024 edit 87.211.116.227 (talk) chem. groups, persists in soilTag: Visual edit |
| Line 1: |
Line 1: |
|
|
{{more citations needed|date=January 2021}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 444216267 |
|
| verifiedrevid = 470602280 |
|
|ImageFile=Terbuthylazine.png |
|
| ImageFile = Terbuthylazine.png |
|
|
| ImageAlt = Skeletal formula of terbuthylazine |
|
|ImageSize= |
|
|
|
| ImageFile1 = Terbuthylazine-3D-spacefill.png |
| ⚫ |
|IUPACName=N-tert-butyl-6-chloro-N'-ethyl-1,3,5-triazine-2,4-diamine |
|
|
|
| ImageAlt1 = Space-filling model of the terbuthylazine molecule |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN=''N''<sup>2</sup>-''tert''-Butyl-6-chloro-''N''<sup>4</sup>-ethyl-1,3,5-triazine-2,4-diamine |
|
⚫ |
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 20848 |
|
| ChemSpiderID = 20848 |
|
| InChI = 1/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15) |
|
| InChI = 1/C9H16ClN5/c1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h5H2,1-4H3,(H2,11,12,13,14,15) |
| Line 17: |
Line 19: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=5915-41-3 |
|
| CASNo=5915-41-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=22206 |
|
|
|
| UNII = M095B391J7 |
|
⚫ |
| PubChem=22206 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C18810 |
|
| KEGG = C18810 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 30263 |
|
| ChEBI = 30263 |
|
| SMILES = Clc1nc(nc(n1)NC(C)(C)C)NCC |
|
| SMILES = Clc1nc(nc(n1)NC(C)(C)C)NCC |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>9</sub>H<sub>16</sub>ClN<sub>5</sub> |
|
| Formula=C<sub>9</sub>H<sub>16</sub>ClN<sub>5</sub> |
|
| MolarMass=229.710 g/mol |
|
| MolarMass=229.710 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Terbuthylazine''' is a selective ]. Chemically, it is a halogenated ]; compared with ] (1958 inv., ] lab) and ], it has a ] group <chem display="inline">-</chem> in place of the ] <chem display="inline">-</chem> and ] group, respectively.<ref>{{cite journal|title=Sorption of terbuthylazine and atrazine in relation to the physico-chemical properties of three soils|journal=]|volume=28|issue=3|pages=467–476|doi=10.1016/0045-6535(94)90291-7|year=1994|last1=Dousset|first1=S.|last2=Mouvet|first2=C.|last3=Schiavon|first3=M.|bibcode=1994Chmsp..28..467D }}</ref><ref>{{cite journal|title=Dissipation of terbuthylazine, metolachlor, and mesotrione in soils with contrasting texture|journal=]|volume=53|issue=10|pages=661–668|doi=10.1080/03601234.2018.1474556|year=2018|last1=Carretta|first1=L.|last2=Cardinali|first2=A.|last3=Marotta|first3=E.|last4=Zanin|first4=G.|last5=Masin|first5=R.|pmid=29842837|bibcode=2018JESHB..53..661C |s2cid=44163175 }}</ref>The sim-azine molecule with 2 ethyl groups is symmetric and flat (excepting its equal <chem display="inline">NH-C2H5</chem>ends). The threefold substituted triazines have ] of the free (non-bonding, <math display="inline">\pi</math>-) electron pairs, resulting in equivalent ] structures. |
|
|
|
|
|
<Simazine remains active in the soil for 2 to 7 months or longer after application. Atrazine remains in soil for a matter of months (although in some soils can persist to at least 4 years)<ref>Atrazine: Chemical Summary. Toxicity and Exposure Assessment for Children's Health (PDF) (Report). U.S. ]. 2007-04-24. Archived from the original (PDF) on 2012-03-16.</ref> and can migrate from soil to ].> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
{{Herbicides}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |