| Revision as of 11:17, 3 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pha← Previous edit |
Latest revision as of 08:54, 10 June 2024 edit undoOAbot (talk | contribs)Bots440,440 editsm Open access bot: pmc updated in citation with #oabot. |
| (29 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443475530 |
|
| verifiedrevid = 448210005 |
|
| IUPAC_name = (2a''S'',2b''R'',3''S'',4''S'',6''S'',8a''R'',10''S'',11a''S'',11b''R'',13a''R'')-2a-(acetyloxy)-6-{-3-(3-fluoropyridin-2-yl)-2-hydroxypropanoyl]oxy}-10--4-hydroxy-7,11b,14,14-tetramethyl-2a,2b,3,4,5,6,8a,11a,11b,12,13,13a-dodecahydro-2''H''-4,8-methanodioxolocyclodecabenzoxet-3-yl benzoate |
|
| IUPAC_name = (2a''S'',2b''R'',3''S'',4''S'',6''S'',8a''R'',10''S'',11a''S'',11b''R'',13a''R'')-2a-(acetyloxy)-6-{-3-(3-fluoropyridin-2-yl)-2-hydroxypropanoyl]oxy}-10--4-hydroxy-7,11b,14,14-tetramethyl-2a,2b,3,4,5,6,8a,11a,11b,12,13,13a-dodecahydro-2''H''-4,8-methanodioxolocyclodecabenzoxet-3-yl benzoate |
|
| image = Tesetaxel.png |
|
| image = Tesetaxel.png |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 14: |
Line 15: |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = Investigational |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 333754-36-2 |
|
| CAS_number = 333754-36-2 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 6918574 |
|
| PubChem = 6918574 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = UG97LO5M8Y |
|
| UNII = UG97LO5M8Y |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5293771 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=46 | H=60 | F=1 | N=3 | O=13 |
|
| C=46 | H=60 | F=1 | N=3 | O=13 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| molecular_weight = 881.98 g/mol |
|
|
|
| StdInChI=1S/C46H60FN3O13/c1-24-28(58-40(54)34(52)33(32-27(47)17-14-20-48-32)49-41(55)63-42(3,4)5)21-46(56)38(61-39(53)26-15-12-11-13-16-26)36-44(8,19-18-29-45(36,23-57-29)62-25(2)51)37-35(31(24)43(46,6)7)59-30(60-37)22-50(9)10/h11-17,20,28-30,33-38,52,56H,18-19,21-23H2,1-10H3,(H,49,55)/t28-,29+,30+,33-,34+,35+,36-,37+,38-,44+,45-,46+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MODVSQKJJIBWPZ-VLLPJHQWSA-N |
|
|
| smiles = CC1=C23(4(CC5(4((C2(C)C)(C1OC(=O)((C6=C(C=CC=N6)F)NC(=O)OC(C)(C)C)O)O)OC(=O)C7=CC=CC=C7)(CO5)OC(=O)C)C)O(O3)CN(C)C |
|
}} |
|
}} |
|
|
|
|
|
|
'''Tesetaxel''' is an orally administered ] being investigated as a ] agent for various types of cancer, including ],<ref name="ClinBre">{{ClinicalTrialsGov|NCT01221870|Tesetaxel as First-line Therapy for Metastatic Breast Cancer}}</ref> ],<ref>{{cite journal| vauthors = Evans T, Dobrila R, Berardi R, Sumpter KA, Wall LR, Oyama R, Anthoney DA |title=A phase II study of DJ-927 as second-line therapy in patients (pts) with advanced gastric cancer (GC) who have failed a 5-FU non taxane based regimen|journal=Journal of Clinical Oncology|date=June 2006|volume=24|issue=18_suppl|page=4081|doi= 10.1200/jco.2006.24.18_suppl.4081}}</ref> ],<ref>{{ClinicalTrialsGov|NCT00080834|DJ-927 as Second-Line Therapy in Treating Patients With Progressive Locally Advanced or Metastatic Colorectal Adenocarcinoma}}</ref> and other solid tumors.<ref>{{ClinicalTrialsGov|NCT01315431|A Study of Tesetaxel Plus Capecitabine in Patients With Solid Tumors}}</ref> It differs from other members of the taxane class (e.g. ] or ]) in that it is administered orally, not intravenously.<ref name="Main">{{cite journal | vauthors = Shionoya M, Jimbo T, Kitagawa M, Soga T, Tohgo A | title = DJ-927, a novel oral taxane, overcomes P-glycoprotein-mediated multidrug resistance in vitro and in vivo | journal = Cancer Science | volume = 94 | issue = 5 | pages = 459–66 | date = May 2003 | pmid = 12824894| doi = 10.1111/j.1349-7006.2003.tb01465.x | doi-access = free | pmc = 11160250 }}</ref> |
|
'''Tesetaxel''' is a drug used in ]. |
|
|
|
|
|
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
|
] |
|
|
|
|
{{antineoplastic-drug-stub}} |
|