| Revision as of 12:53, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,049 edits Saving copy of the {{chembox}} taken from revid 451786818 of page Thallous_malonate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 09:27, 17 August 2023 edit 2405:4802:1d0f:45c0:9499:6fa5:7ee0:efd6 (talk)No edit summaryTags: references removed Visual edit |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 451381441 |
|
|
|
| Watchedfields = changed |
|
| Name = |
|
|
|
| verifiedrevid = 470605859 |
|
| ImageFile = File-Thallous malonate molecule.png |
|
|
| ImageSize = 250px |
|
| Name = |
|
|
| ImageFile = Thallous malonate Structure.svg |
|
| IUPACName = propanedioate; thallium(+1) cation<ref name="wolfram">{{cite web|url=http://www.wolframalpha.com/input/?i=C3H2O4Tl2&lk=1&a=ClashPrefs_*Chemical-|title=wolframalpha chemical data|publisher=wolfram|accessdate=June 25, 2011}}</ref> |
|
|
|
| ImageSize = |
|
| SystematicName = dithallium(1+) propanedioate |
|
|
|
| IUPACName = Dithallium(I) malonate |
|
| OtherNames = Dithallium Malonate, (Propanedioic Acid, Dithallium Salt), (Malonic Acid, Thallium Salt (1:2)), Formomalenic Thallium<ref name="gov data">{{cite web|url=http://cameochemicals.noaa.gov/chemical/5206|title=United States government data|author=|date=|work=|publisher=Cameo Chemicals|accessdate=June 25, 2011}}</ref> |
|
|
|
| SystematicName = Dithallium(I) propanedioate |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| OtherNames = Dithallium Malonate, (Propanedioic Acid, Dithallium Salt), (Malonic Acid, Thallium Salt (1:2)), Formomalenic Thallium<ref name="gov data">{{cite web|url=http://cameochemicals.noaa.gov/chemical/5206|title=United States government data|author=|date=|publisher=Cameo Chemicals|access-date=June 25, 2011}}</ref> |
|
| Abbreviations = |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| CASNo = <!-- blanked - oldvalue: 2757-18-8 --> |
|
|
|
| Abbreviations = |
|
| EINECS = 220-414-7 |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| EINECSCASNO = |
|
|
| PubChem = 16684457 |
|
| CASNo = 2757-18-8 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = Y2JPM0IF0R |
|
|
| EINECS = 220-414-7 |
|
|
| PubChem = 16684457 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16719 |
|
| ChemSpiderID = 16719 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C3H4O4.2Tl/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;/q;2*+1/p-2 |
|
| StdInChI = 1S/C3H4O4.2Tl/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;/q;2*+1/p-2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UFVDXEXHBVQKGB-UHFFFAOYSA-L |
|
| StdInChIKey = UFVDXEXHBVQKGB-UHFFFAOYSA-L |
|
| SMILES = ..C(=O)CC()=O |
|
| SMILES = ..C(=O)CC()=O |
|
| InChI = InChI=1S/C3H4O4.2Tl/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;/q;2*+1/p-2 |
|
| InChI = InChI=1S/C3H4O4.2Tl/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;/q;2*+1/p-2 |
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = |
|
| ChEBI = |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
|
| Section2 = {{Chembox Properties |
|
| ATCCode_suffix = |
|
|
|
| Formula = C<sub>3</sub>H<sub>2</sub>O<sub>4</sub>Tl<sub>2</sub> |
|
| ATC_Supplemental = |
|
|
|
| MolarMass = 510.812 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| MeltingPt_notes = |
|
|
| BoilingPt = |
|
|
| BoilingPt_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| LogP = |
|
|
| VaporPressure = |
|
|
| HenryConstant = |
|
|
| AtmosphericOHRateConstant = |
|
|
| pKa = |
|
|
| pKb = |
|
}} |
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
|
|
|
| CrystalStruct = |
|
| Section2 = {{Chembox Properties |
|
|
|
| Coordination = |
|
| Formula = C<sub>3</sub>H<sub>2</sub>O<sub>4</sub>Tl<sub>2</sub> |
|
|
|
| MolShape = |
|
| MolarMass = 510.812 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| Melting_notes = |
|
|
| BoilingPt = |
|
|
| Boiling_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
|
| Solvent = |
|
|
| LogP = |
|
|
| VaporPressure = |
|
|
| HenryConstant = |
|
|
| AtmosphericOHRateConstant = |
|
|
| pKa = |
|
|
| pKb = |
|
|
}} |
|
}} |
|
|
| Section4 = {{Chembox Thermochemistry |
|
|
|
|
|
| DeltaHf = |
|
| Section3 = {{Chembox Structure |
|
|
| CrystalStruct = |
|
| DeltaHc = |
|
| Coordination = |
|
| Entropy = |
|
| MolShape = |
|
| HeatCapacity = |
|
}} |
|
}} |
|
|
| Section5 = {{Chembox Pharmacology |
|
|
|
|
|
| AdminRoutes = |
|
| Section4 = {{Chembox Thermochemistry |
|
|
| DeltaHf = |
|
| Bioavail = |
|
| DeltaHc = |
|
| Metabolism = |
|
| Entropy = |
|
| HalfLife = |
|
| HeatCapacity = |
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| Pregnancy_category = |
|
|
| Pregnancy_AU = |
|
|
| Pregnancy_US = |
|
}} |
|
}} |
|
|
| Section6 = {{Chembox Explosive |
|
|
|
|
|
| ShockSens = |
|
| Section5 = {{Chembox Pharmacology |
|
|
| AdminRoutes = |
|
| FrictionSens = |
|
| Bioavail = |
|
| DetonationV = |
|
| Metabolism = |
|
| REFactor = |
|
| HalfLife = |
|
|
| ProteinBound = |
|
|
| Excretion = |
|
|
| Legal_status = |
|
|
| Legal_US = |
|
|
| Legal_UK = |
|
|
| Legal_AU = |
|
|
| Legal_CA = |
|
|
| PregCat = |
|
|
| PregCat_AU = |
|
|
| PregCat_US = |
|
|
}} |
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
|
|
|
| GHSPictograms = {{GHS06}} {{GHS health hazard}} {{GHS environment}} |
|
| Section6 = {{Chembox Explosive |
|
|
|
| GHSSignalWord = Danger |
|
| ShockSens = |
|
|
|
| ExternalSDS = |
|
| FrictionSens = |
|
|
| ExplosiveV = |
|
| MainHazards = |
|
| REFactor = |
|
| NFPA-H =3 |
|
|
| NFPA-F =0 |
|
|
| NFPA-R =0 |
|
|
| NFPA-S = |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
|
| ExploLimits = |
|
|
| LD50 = |
|
|
| PEL = |
|
|
| SkinHazard = |
|
|
| EyeHazard = |
|
|
| InhalationHazard = |
|
|
| IngestionHazard = |
|
|
| HPhrases = |
|
|
| PPhrases = |
|
}} |
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
|
|
|
| OtherAnions = |
|
| Section7 = {{Chembox Hazards |
|
|
|
| OtherCations = |
|
| GHSPictograms = {{GHS06}} {{GHS health hazard}} {{GHS environment}} |
|
|
|
| OtherFunction = |
|
| GHSSignalWord = Danger |
|
|
|
| OtherFunction_label = |
|
| ExternalMSDS = http://www.acros.com/Ecommerce/msds.aspx?Language=en&PrdNr=42079 |
|
|
| EUClass = |
|
| OtherCompounds = |
|
| EUIndex = |
|
|
| MainHazards = |
|
|
| NFPA-H =3 |
|
|
| NFPA-F =0 |
|
|
| NFPA-R =0 |
|
|
| NFPA-O = |
|
|
| RPhrases = {{R26/28}}, {{R33}}, {{R51/53}}<ref name="chemexper">{{cite web|url=http://www.chemexper.com/cheminfo/servlet/org.dbcreator.MainServlet?query=entry._entryID%3D23130&target=entry&action=PowerSearch&format=google2008|title=chemexper.com chemical data|author=|date=|work=|publisher=|accessdate=June 25, 2011}}</ref> |
|
|
| SPhrases = {{S13}}, {{S28}}, {{S45}}, {{S61}}<ref name="chemexper" /> |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
|
| LD50 = |
|
|
| PEL = |
|
|
| SkinHazard = |
|
|
| EyeHazard = |
|
|
| InhalationHazard = |
|
|
| IngestionHazard = |
|
|
| HPhrases = |
|
|
| PPhrases = |
|
|
}} |
|
}} |
|
|
}} |
|
|
'''Thallous malonate''' is a ] composed mainly of ]. It is an ] and is on the ]. |
|
|
|
|
|
|
== References == |
|
| Section8 = {{Chembox Related |
|
|
|
{{reflist}} |
|
| OtherAnions = |
|
|
|
|
|
| OtherCations = |
|
|
|
{{Thallium compounds}} |
|
| OtherFunctn = |
|
|
|
|
|
| Function = |
|
|
|
] |
|
| OtherCpds = |
|
|
|
] |
|
}} |
|
|
|
|
|
}} |
|
|
|
|
|
|
{{Organic-compound-stub}} |