Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Thiamine pyrophosphate: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 12:56, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456176532 of page Thiamine_pyrophosphate for the Chem/Drugbox validation project (updated: '').  Latest revision as of 17:30, 18 July 2024 edit Marbletan (talk | contribs)Extended confirmed users5,256 edits →Reaction mechanisms 
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Watchedfields = changed
| verifiedrevid = 450157910 | verifiedrevid = 470606241
⚫ | ImageFile = Thiamine diphosphate.png
| ImageSize = 200px | Name =
⚫ | ImageFile = Thiamine diphosphate.png
⚫ | IUPACName = 2--4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate
| ImageSize = 200px
| IUPACName_hidden = yes
⚫ | IUPACName = 2--4-methyl-1,3-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate
| OtherNames = Thiamine diphosphate | OtherNames = Thiamine diphosphate
⚫ | Section1 = {{Chembox Identifiers
| SystematicName =
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | Section1 = {{Chembox Identifiers
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10670483 | ChemSpiderID = 10670483
| ChEBI = 9532
| KEGG = C00068
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q57971654Y | UNII = Q57971654Y
Line 19: Line 22:
| StdInChIKey = NBSUTVXQOGUTJX-UHFFFAOYSA-M | StdInChIKey = NBSUTVXQOGUTJX-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 154-87-0 | CASNo = 136-08-3
| PubChem = 1132 | PubChem = 1132
| SMILES = .OP(=O)(O)OP(O)(O)=O.Cc2nc(N)c(C1csc(CCO)c1C)cn2 | SMILES = Cc2ncc(C1csc(CCOP(=O)(O)OP(=O)(O)O)c1C)c(N)n2
| MeSHName = Thiamine+pyrophosphate | MeSHName = Thiamine+pyrophosphate
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = C<sub>12</sub>H<sub>19</sub>N<sub>4</sub>O<sub>7</sub>P<sub>2</sub>S<sup>+</sup> | Formula = C<sub>12</sub>H<sub>19</sub>N<sub>4</sub>O<sub>7</sub>P<sub>2</sub>S<sup>+</sup>
| MolarMass = 425.314382 g/mol | MolarMass = 425.314382 g/mol
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
}} }}
| Section3 = {{Chembox Hazards | Section3 = {{Chembox Hazards
| Solubility = | MainHazards =
| MainHazards = | FlashPt =
| FlashPt = | AutoignitionPt =
| Autoignition =
}} }}
| Section4 =
| Section5 =
| Section6 =
}} }}
'''Thiamine pyrophosphate''' ('''TPP''' or '''ThPP'''), or '''thiamine diphosphate''' ('''ThDP'''), or '''cocarboxylase'''<ref name="pmid8834846">{{cite journal | vauthors = Pietrzak I | title = | language = pl | journal = Przegla̧d Lekarski | volume = 52 | issue = 10 | pages = 522–5 | year = 1995 | pmid = 8834846 }}<!--(Review article)--></ref> is a ] (vitamin B<sub>1</sub>) ] which is produced by the ] ]. Thiamine pyrophosphate is a ] that is present in all living systems, in which it catalyzes several ] reactions.

Thiamine pyrophosphate is synthesized in the ] and is required in the cytosol for the activity of transketolase and in the mitochondria for the activity of pyruvate-, oxoglutarate- and branched chain keto acid dehydrogenases. To date, the yeast ThPP carrier (Tpc1p) the human Tpc and the '']'' have been identified as being responsible for the mitochondrial transport of ThPP and ThMP.<ref>{{Cite journal|last1=Marobbio|first1=C. M. T.|last2=Vozza|first2=A.|last3=Harding|first3=M.|last4=Bisaccia|first4=F.|last5=Palmieri|first5=F.|last6=Walker|first6=J. E.|date=2002-11-01|title=Identification and reconstitution of the yeast mitochondrial transporter for thiamine pyrophosphate|url= |journal=The EMBO Journal|language=en|volume=21|issue=21|pages=5653–5661|doi=10.1093/emboj/cdf583|issn=0261-4189|pmc=131080|pmid=12411483}}</ref><ref>{{Cite journal|last1=Iacopetta|first1=Domenico|last2=Carrisi|first2=Chiara|last3=De Filippis|first3=Giuseppina|last4=Calcagnile|first4=Valeria M.|last5=Cappello|first5=Anna R.|last6=Chimento|first6=Adele|last7=Curcio|first7=Rosita|last8=Santoro|first8=Antonella|last9=Vozza|first9=Angelo|date=2010-03-01|title=The biochemical properties of the mitochondrial thiamine pyrophosphate carrier from Drosophila melanogaster|journal=FEBS Journal|language=en|volume=277|issue=5|pages=1172–1181|doi=10.1111/j.1742-4658.2009.07550.x|issn=1742-4658|pmid=20121944|doi-access=free}}</ref><ref>{{Cite journal|last1=Lindhurst|first1=Marjorie J.|last2=Fiermonte|first2=Giuseppe|last3=Song|first3=Shiwei|last4=Struys|first4=Eduard|last5=Leonardis|first5=Francesco De|last6=Schwartzberg|first6=Pamela L.|last7=Chen|first7=Amy|last8=Castegna|first8=Alessandra|last9=Verhoeven|first9=Nanda|date=2006-10-24|title=Knockout of Slc25a19 causes mitochondrial thiamine pyrophosphate depletion, embryonic lethality, CNS malformations, and anemia|journal=Proceedings of the National Academy of Sciences|language=en|volume=103|issue=43|pages=15927–15932|doi=10.1073/pnas.0607661103|issn=0027-8424|pmc=1595310|pmid=17035501|bibcode=2006PNAS..10315927L|doi-access=free}}</ref> It was first discovered as an ] (]) in humans through its link with the ] ] ], which results from a deficiency of thiamine in the ].<ref name="Pavia">{{cite book | author = Pavia, Donald L., Gary M. Lampman, George S. Kritz, Randall G. Engel | title = Introduction to Organic Laboratory Techniques (4th Ed.) | publisher = Thomson Brooks/Cole| pages = 304–5 | year = 2006 | isbn = 978-0-495-28069-9}}</ref>

TPP works as a ] in many enzymatic reactions, such as:

* ] complex<ref name="GSU">{{cite web|url=http://chemistry.gsu.edu/Glactone/PDB/Proteins/Krebs/1pyd.html|title=PDBs for Biochemistry|publisher=Georgia State University|access-date=2009-02-07|url-status=dead|archive-url=https://web.archive.org/web/20110716103545/http://chemistry.gsu.edu/Glactone/PDB/Proteins/Krebs/1pyd.html|archive-date=2011-07-16}}</ref>
* ] in ]
* ] complex
* ] complex
* ]
* ]

==Chemistry==
]

Chemically, TPP consists of a ] ring which is connected to a ] ring, which is in turn connected to a ] (diphosphate) ].

The part of TPP molecule that is most commonly involved in reactions is the thiazole ring, which contains ] and ]. Thus, the thiazole ring is the "reagent portion" of the molecule. The C2 of this ring is capable of acting as an ] by donating its ] and forming a ].<ref name=":0">{{Citation|last1=Begley|first1=Tadhg P.|title=7.15 - Thiamin Biosynthesis|date=2010-01-01|url=http://www.sciencedirect.com/science/article/pii/B9780080453828001489|work=Comprehensive Natural Products II|pages=547–559|editor-last=Liu|editor-first=Hung-Wen (Ben)|place=Oxford|publisher=Elsevier|language=en|doi=10.1016/b978-008045382-8.00148-9|isbn=978-0-08-045382-8|access-date=2020-12-16|last2=Ealick|first2=Steven E.|editor2-last=Mander|editor2-first=Lew}}</ref> Normally, reactions that form carbanions are highly unfavorable, but the positive charge on the tetravalent nitrogen just adjacent to the carbanion stabilizes the negative charge, making the reaction much more favorable.<ref name=":0" /> A compound with positive and negative charges on adjacent atoms is called an ], so sometimes the carbanion form of TPP is referred to as the "ylide form".<ref name="Pavia" /><ref name="Voet" >{{cite book |title= Fundamentals of Biochemistry |url= https://archive.org/details/fundamentalsbioc00voet |url-access= limited |last= Voet |first= Donald |author2=Judith Voet |author3=Charlotte Pratt |year= 2008 |publisher= John Wiley & Sons Inc |isbn=978-0-470-12930-2 |page=}}</ref>

==Reaction mechanisms==
In several reactions, including that of pyruvate dehydrogenase, alpha-ketoglutarate dehydrogenase, and transketolase, TPP catalyses the reversible decarboxylation reaction (aka cleavage of a substrate compound at a carbon-carbon bond connecting a ] to an adjacent reactive group—usually a ] or an ]). It achieves this in four basic steps:

#The carbanion of the TPP ylid ] the carbonyl group on the substrate. (This forms a single bond between the TPP and the substrate.)
#The target bond on the substrate is broken, and its electrons are pushed towards the TPP. This creates a double bond between the substrate carbon and the TPP carbon and pushes the electrons in the N-C double bond in TPP entirely onto the nitrogen atom, reducing it from a positive to neutral form.
#In what is essentially the reverse of step two, the electrons push back in the opposite direction forming a new bond between the substrate carbon and another atom. (In the case of the decarboxylases, this creates a new carbon-hydrogen bond. In the case of transketolase, this attacks a new substrate molecule to form a new carbon-carbon bond.)
#In what is essentially the reverse of step one, the TPP-substrate bond is broken, reforming the TPP ylid and the substrate carbonyl.
]

The TPP thiazolium ring can be deprotonated at C2 to become an ]:
:]{{clear-left}}

A full view of TPP. The arrow indicates the acidic proton.

:]{{clear-left}}

==See also==
* ]

==References==
{{reflist}}

==External links==
*

{{Enzyme cofactors}}

]
]
]
]
]