| Revision as of 13:03, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 450349597 of page Thiofentanyl for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 17:48, 8 February 2024 edit VastV0idInSpace0 (talk | contribs)Extended confirmed users2,343 edits Fixed spacing between stub template and category templates.Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
|
{{Short description|Opioid}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{distinguish|Thiafentanil}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 447761773 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = ''N''-phenyl-''N''-{1-piperidin-4-yl}propanamide |
|
|
⚫ |
| verifiedrevid = 470607119 |
|
⚫ |
| IUPAC_name = ''N''-phenyl-''N''-<nowiki/>{1-piperidin-4-yl}propanamide |
|
| image = thiofentanyl.svg |
|
| image = thiofentanyl.svg |
|
| width = 100 |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 10: |
Line 12: |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = C |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = S9 |
|
|
| legal_BR = F1 |
|
| legal_CA = Schedule I |
|
| legal_CA = Schedule I |
|
|
| legal_DE = Anlage I |
|
| legal_UK = Class A |
|
| legal_UK = Class A |
|
| legal_US = Schedule I |
|
| legal_US = Schedule I |
|
⚫ |
| routes_of_administration = |
|
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 26: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 60771-38-2 --> |
|
|
|
| CAS_number = 1165-22-6 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 62380 |
|
| PubChem = 62380 |
|
|
| KEGG = C22739 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
| Line 36: |
Line 41: |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 61099 |
|
| ChEBI = 61099 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 954535Y32Y |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=20 | H=26 | N=2 | O=1 | S=1 |
|
| C=20 | H=26 | N=2 | O=1 | S=1 |
|
|
| smiles = O=C(CC)N(C1CCN(CCC2=CC=CS2)CC1)C3=CC=CC=C3 |
|
| molecular_weight = 342.499 g/mol |
|
|
| smiles = O=C(N(c1ccccc1)C2CCN(CC2)CCc3sccc3)CC |
|
|
| InChI = 1/C20H26N2OS/c1-2-20(23)22(17-7-4-3-5-8-17)18-10-13-21(14-11-18)15-12-19-9-6-16-24-19/h3-9,16,18H,2,10-15H2,1H3 |
|
|
| InChIKey = YMRFZDHYDKZXPA-UHFFFAOYAG |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C20H26N2OS/c1-2-20(23)22(17-7-4-3-5-8-17)18-10-13-21(14-11-18)15-12-19-9-6-16-24-19/h3-9,16,18H,2,10-15H2,1H3 |
|
| StdInChI = 1S/C20H26N2OS/c1-2-20(23)22(17-7-4-3-5-8-17)18-10-13-21(14-11-18)15-12-19-9-6-16-24-19/h3-9,16,18H,2,10-15H2,1H3 |
| Line 48: |
Line 52: |
|
| StdInChIKey = YMRFZDHYDKZXPA-UHFFFAOYSA-N |
|
| StdInChIKey = YMRFZDHYDKZXPA-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Thiofentanyl''' is an ] ] that is an ] of ]. |
|
|
|
|
|
Thiofentanyl was sold briefly on the black market in the early 1980s, before the introduction of the ] which for the first time attempted to control entire families of drugs based on their structural similarity rather than scheduling each drug individually as they appeared.<ref>{{cite journal | vauthors = Henderson GL | title = Designer drugs: past history and future prospects | journal = Journal of Forensic Sciences | volume = 33 | issue = 2 | pages = 569–75 | date = March 1988 | doi = 10.1520/JFS11976J | pmid = 3286815 }}</ref> Thiofentanyl is made with the same synthetic route as fentanyl, but by substituting 2-(2-bromoethyl)thiophene for phenethyl bromide in the synthesis. |
|
|
|
|
|
Side effects of ] analogs are similar to those of fentanyl itself, which include ], ] and potentially serious ], which can be life-threatening. Fentanyl analogs have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear.<ref>{{cite journal | vauthors = Mounteney J, Giraudon I, Denissov G, Griffiths P | title = Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe | journal = The International Journal on Drug Policy | volume = 26 | issue = 7 | pages = 626–31 | date = July 2015 | pmid = 25976511 | doi = 10.1016/j.drugpo.2015.04.003 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist|1}} |
|
|
|
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |