| Revision as of 15:52, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 11:11, 10 March 2021 edit undoCitation bot (talk | contribs)Bots5,439,022 edits Add: s2cid. | Use this bot. Report bugs. | Suggested by Abductive | Category:Organic compound stubs | via #UCB_Category 475/1138 |
| (13 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 386559239 |
|
| verifiedrevid = 428772278 |
|
|ImageFile=Thioinosinic acid.png |
|
| ImageFile =Thioinosinic acid.png |
|
|ImageSize=200px |
|
| ImageSize = 220 |
| ⚫ |
|IUPACName= methyl dihydrogen phosphate |
|
|
|
| ImageFile1 = Thioinosine monophosphate anion 3D ball.png |
|
|OtherNames= |
|
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Ball-and-stick model of the thioinosine monophosphate anion |
|
⚫ |
| IUPACName = methyl dihydrogen phosphate |
|
|
| OtherNames = Thioinosine monophosphate (TIMP) |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=53-83-8 |
|
| CASNo =53-83-8 |
| ⚫ |
| PubChem=3034391 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=O1(O)(N2C=NC3=C2NC=NC3=S)O1COP(O)(O)=O |
|
|
|
| UNII = 76CK4YA5ZP |
|
⚫ |
| PubChem =3034391 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID =2298861 |
|
⚫ |
| SMILES =O1(O)(N2C=NC3=C2NC=NC3=S)O1COP(O)(O)=O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI =1S/C10H13N4O7PS/c15-6-4(1-20-22(17,18)19)21-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)23/h2-4,6-7,10,15-16H,1H2,(H,11,12,23)(H2,17,18,19)/t4-,6-,7-,10-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey =ZKRFOXLVOKTUTA-KQYNXXCUSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>13</sub>N<sub>4</sub>O<sub>7</sub>PS |
|
| Formula =C<sub>10</sub>H<sub>13</sub>N<sub>4</sub>O<sub>7</sub>PS |
|
| MolarMass=364.27 g/mol |
|
| MolarMass =364.27 g/mol |
|
| Appearance= |
|
| Appearance = |
|
| Density= |
|
| Density = |
|
| MeltingPt= |
|
| MeltingPt = |
|
| BoilingPt= |
|
| BoilingPt = |
|
| Solubility= |
|
| Solubility = |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Thioinosinic acid''' (or '''thioinosine monophosphate''', '''TIMP''') is an intermediate ] of ], an ].<ref name="Steinhilber">{{cite book|title=Medizinische Chemie|last1=Steinhilber|first1=D|last2=Schubert-Zsilavecz|first2=M|last3=Roth|first3=HJ|publisher=Deutscher Apotheker Verlag|location=Stuttgart|year=2005|page=340|isbn=3-7692-3483-9|language=de}}</ref><ref name="pmid18506437">{{Cite journal | last1 = Sahasranaman | first1 = S. | last2 = Howard | first2 = D. | last3 = Roy | first3 = S. | doi = 10.1007/s00228-008-0478-6 | title = Clinical pharmacology and pharmacogenetics of thiopurines | journal = European Journal of Clinical Pharmacology | volume = 64 | issue = 8 | pages = 753–767 | year = 2008 | pmid = 18506437| s2cid = 27475772 }}</ref> |
|
'''Thioinosinic acid''' is an intermediate in the metabolism of ]. |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
| Line 33: |
Line 49: |
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|