| Revision as of 13:27, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 463413868 of page Thymol_blue for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 00:41, 19 August 2024 edit BD2412 (talk | contribs)Autopatrolled, IP block exemptions, Administrators2,453,387 editsm Clean up spacing around commas and other punctuation fixes, replaced: ,i → , i, , → ,Tag: AWB |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 440335737 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Thymol blue |
|
|
⚫ |
| verifiedrevid = 470609766 |
| ⚫ |
| ImageFile = Thymolblau skeletal.png |
|
|
⚫ |
| Name = Thymol blue |
| ⚫ |
| ImageSize = 225px |
|
|
⚫ |
| ImageFile = Thymolblau skeletal.png |
|
| IUPACName = <small>4-nona-1,3,5-trien-9-yl]- 5-methyl-2-propan-2-yl-phenol</small> |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
| OtherNames = <small>α-hydroxy-α,α-bis(5-hydroxycarvacryl)- o-toluenesulfonic acid γ-sultone; thymolsulfonephthalein</small> |
|
|
|
| ImageFile2 = Thymol Blue crystals.jpg |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageSize2 = 200px |
| ⚫ |
| SMILES = O=S2(=O)OC(c1ccccc12)(c3cc(c(O)cc3C)C(C)C)c4cc(c(O)cc4C)C(C)C |
|
|
|
| PIN = 3,3-Bis-2,1λ<sup>6</sup>-benzoxathiole-1,1(3''H'')-dione |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| OtherNames = α-hydroxy-α,α-bis(5-hydroxycarvacryl)- o-toluenesulfonic acid γ-sultone; thymolsulfonephthalein |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 76-61-9 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59008 |
|
| ChemSpiderID = 59008 |
|
|
| EC_number = 200-973-3 |
|
| PubChem = 65565 |
|
| PubChem = 65565 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8YB4804L4M |
|
| InChI = 1/C27H30O5S/c1-15(2)19-13-22(17(5)11-24(19)28)27(21-9-7-8-10-26(21)33(30,31)32-27)23-14-20(16(3)4)25(29)12-18(23)6/h7-16,28-29H,1-6H3 |
|
| InChI = 1/C27H30O5S/c1-15(2)19-13-22(17(5)11-24(19)28)27(21-9-7-8-10-26(21)33(30,31)32-27)23-14-20(16(3)4)25(29)12-18(23)6/h7-16,28-29H,1-6H3 |
|
| InChIKey = PRZSXZWFJHEZBJ-UHFFFAOYAE |
|
| InChIKey = PRZSXZWFJHEZBJ-UHFFFAOYAE |
| Line 18: |
Line 25: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PRZSXZWFJHEZBJ-UHFFFAOYSA-N |
|
| StdInChIKey = PRZSXZWFJHEZBJ-UHFFFAOYSA-N |
|
⚫ |
| SMILES = O=S2(=O)OC(c1ccccc12)(c3cc(c(O)cc3C)C(C)C)c4cc(c(O)cc4C)C(C)C |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
}} |
|
| CASNo = <!-- blanked - oldvalue: 76-61-9 --> |
|
|
⚫ |
|Section2={{Chembox Properties |
|
|
| C=27 | H=30 | O=5 | S=1 |
|
⚫ |
| Appearance = Brownish-green crystal powder |
|
|
| MeltingPtC = 221-224 |
|
|
| MeltingPt_notes = <br> decomposes<ref name="sigma"></ref> |
|
⚫ |
| Solubility = Insoluble |
|
|
| LambdaMax = 594 nm (1st)<br> 376 nm (2nd)<ref name="sigma" /> |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards = Harmful |
|
|
| GHS_ref=<ref>{{cite web |title=Thymol blue |url=https://pubchem.ncbi.nlm.nih.gov/compound/65565#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |access-date=12 December 2021 |language=en}}</ref> |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|302}} |
|
|
| PPhrases = {{P-phrases|264|270|301+312|330|501}} |
|
|
| NFPA-H = 1 |
|
|
| NFPA-F = 1 |
|
}} |
|
}} |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>27</sub>H<sub>30</sub>O<sub>5</sub>S |
|
|
| MolarMass = 466.59<ref>Number derived from ]</ref> g mol<sup>−1</sup> |
|
| ⚫ |
| Appearance = Brownish-green crystal powder |
|
| ⚫ |
| Solubility = Insoluble |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
|
|
|
|
|
'''Thymol blue''' (thymolsulfonephthalein) is a brownish-green or reddish-brown crystalline powder that is used as a ]. It is insoluble in ] but soluble in ] and dilute ] solutions. {{pH_indicator|indicator_name=Thymol blue|low_pH=8.0|high_pH=9.6|low_pH_color=yellow|high_pH_color=blue|high_pH_text=white}} |
|
|
{{pH_indicator|indicator_name=Thymol blue|low_pH=1.2|high_pH=2.8|low_pH_color=red|low_pH_text=white|high_pH_color=yellow}} |
|
|
It transitions from red to yellow at ] 1.2–2.8 and from yellow to blue at pH 8.0–9.6. It is usually a component of ]. |
|
|
|
|
|
At wavelength (378 - 382) nm, extinction coefficient > 8000 and at wavelength (298 - 302) nm, the extinction coefficient > 12000.<ref>{{Cite web |last=|first=|date=9 October 2017|title=Product Specification: Thymol Blue- ACS reagent|url=http://www.sigmaaldrich.com/Graphics/COfAInfo/SigmaSAPQM/SPEC/11/114545/114545-BULK_______SIAL_____.pdf|publisher=Sigma-Aldrich|volume=1|pages=1}}</ref> |
|
|
|
|
|
==Structures== |
|
|
Thymol blue has different structures at different pH. |
|
|
:]thymol blue. |
|
|
] |
|
|
|
|
|
==Safety== |
|
|
It may cause irritation. Its toxicological properties have not been fully investigated.<ref>{{Cite web |title=Thymol Blue MSDS |url=https://fscimage.fishersci.com/msds/60620.htm#:~:text=Eye:%20May%20cause%20eye%20irritation,irritation%20of%20the%20digestive%20tract. |access-date=2024-07-23 |website=Fisher Scientific}}</ref> Harmful if swallowed, Acute Toxicity. Only Hazardous when percent values are above 10%.<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/Thymol_blue#section=GHS-Classification|title=Thymol blue|publisher=PubChem|language=en|access-date=2017-10-09}}</ref> |
|
|
|
|
|
==Bibliography== |
|
|
* Merck. "Thymol Blue." ''The Merck Index''. 14th ed. 2006. Accessed via web on 2007-02-25. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
{{Commons category|Thymol blue}} |
|
|
* |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |