| Revision as of 13:28, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 459522268 of page Thymolphthalein for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 02:40, 3 August 2023 edit Headbomb (talk | contribs)Edit filter managers, Autopatrolled, Extended confirmed users, Page movers, File movers, New page reviewers, Pending changes reviewers, Rollbackers, Template editors453,535 edits Alter: journal. | Use this tool. Report bugs. | #UCB_Gadget |
| Line 1: |
Line 1: |
|
|
{{About|thymolphthalein|other related dyes in the phthalein family|Phthalein dye}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 418302061 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Thymolphthalein-skeletal.png |
|
|
⚫ |
| verifiedrevid = 470609780 |
| ⚫ |
| ImageSize = 200px |
|
|
⚫ |
| ImageFile = Thymolphthalein skeletal.svg |
| ⚫ |
| IUPACName = 3,3-bis(4-hydroxy-2-methyl- 5-propan-2-ylphenyl)- 2-benzofuran-1-one |
|
|
⚫ |
| ImageSize = |
|
⚫ |
| PIN = 3,3-Bis-2-benzofuran-1(3''H'')-one |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 29054 |
|
| ChemSpiderID = 29054 |
|
| InChI = 1/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 |
|
| InChI = 1/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 |
| Line 17: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LDKDGDIWEUUXSH-UHFFFAOYSA-N |
|
| StdInChIKey = LDKDGDIWEUUXSH-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 125-20-2 --> |
|
| CASNo = 125-20-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| EINECS = 204-729-7 |
|
|
| PubChem = 31316 |
|
| UNII = YG5I28WSQP |
|
⚫ |
| EINECS = 204-729-7 |
| ⚫ |
| SMILES = O=C1OC(c2ccccc12)(c3cc(c(O)cc3C)C(C)C)c4cc(c(O)cc4C)C(C)C |
|
|
|
| PubChem = 31316 |
|
⚫ |
| SMILES = O=C1OC(c2ccccc12)(c3cc(c(O)cc3C)C(C)C)c4cc(c(O)cc4C)C(C)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=28 | H=30 | O=4 |
|
| Formula = C<sub>28</sub>H<sub>30</sub>O<sub>4</sub> |
|
|
| MolarMass = 430.53 g/mol |
|
| Appearance = White powder |
|
|
| Density = |
|
| Appearance = White powder |
|
|
| Density = |
|
| MeltingPtC = 248 to 252 |
|
|
| MeltingPt_notes = (decomposes) |
|
| MeltingPt = 248 - 252 °C (decomp.) |
|
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
| ⚫ |
}} |
|
| ⚫ |
| Section7 = {{Chembox Hazards |
|
| ⚫ |
| MainHazards = |
|
| ⚫ |
| NFPA-H = 1 |
|
| ⚫ |
| NFPA-F = 0 |
|
| ⚫ |
| NFPA-R = 0 |
|
| ⚫ |
| NFPA-O = |
|
|
| RPhrases = 4, 10 |
|
|
| SPhrases = {{S22}} {{S24/25}} |
|
| ⚫ |
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
⚫ |
|Section7={{Chembox Hazards |
|
⚫ |
| MainHazards = |
|
⚫ |
| NFPA-H = 1 |
|
⚫ |
| NFPA-F = 0 |
|
⚫ |
| NFPA-R = 0 |
|
⚫ |
| NFPA-S = |
|
|
| Hazards_ref=<ref>{{cite web |title=Thymolphthalein |url=https://pubchem.ncbi.nlm.nih.gov/compound/31316#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> |
|
|
| GHSPictograms = {{GHS08}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|341|350|361}} |
|
|
| PPhrases = {{P-phrases|201|202|210|233|240|241|242|243|280|281|303+361+353|308+313|370+378|403+235|405|501}} |
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Thymolphthalein''' is a ] used as an ]–] (]) ]. Its transition range is around pH 9.3–10.5. Below this pH, it is colorless; above, it is blue. The ] for the blue thymolphthalein ] is 38,000 M<sup>−1</sup> cm<sup>−1</sup> at 595 nm.<ref>{{cite journal |author=Hahn HH |author2=Cheuk SF |author3=Elfenbein S |author4= Wood WB |title= Studies on the Pathogenesis of Fever: Xix. Localization of Pyrogen in Granulocytes|journal= The Journal of Experimental Medicine|volume=131 |issue=4 |pages=701–9 |date=April 1970 |pmid=5430784 |pmc=2138774 |doi= 10.1084/jem.131.4.701}}</ref> |
|
|
|
|
|
{{pH_indicator_template|indicator_name=Thymolphthalein |low_pH=9.3 |high_pH=10.5|low_pH_color=white|high_pH_color=blue|high_pH_text=white}} |
|
|
|
|
|
Thymolphthalein is also known to have use as a ]<ref>{{cite journal | last1 = Hubacher | first1 = MH | last2 = Doernberg | first2 = S | last3 = Horner | first3 = A | year = 1953 | title = Laxatives: chemical structure and potency of phthaleins and hydroxyanthraquinones | journal = Journal of the American Pharmaceutical Association | volume = 42 | issue = 1| pages = 23–30 | pmid = 13034620 | doi = 10.1002/jps.3030420108 }}</ref> and for ].<ref>{{Cite web|url=https://www.chymist.com/Disappearing%20Ink.pdf|title=Disappearing Ink|last=Katz|first=David A.|date=1982|website=www.chymist.com|access-date=August 14, 2017}}</ref> |
|
|
|
|
|
==Preparation== |
|
|
Thymolphthalein can be synthesized from ] and ]. |
|
|
:]{{clear left}} |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |