Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Tolterodine: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 13:43, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456670924 of page Tolterodine for the Chem/Drugbox validation project (updated: 'DrugBank').  Latest revision as of 04:17, 26 October 2024 edit 76.174.0.57 (talk) →References: Cats. 
Line 1: Line 1:
{{Short description|Benzhydryl compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Use dmy dates|date=May 2022}}
{{Drugbox
{{cs1 config |name-list-style=vanc |display-authors=6}}
| Verifiedfields = changed
{{Infobox drug
| verifiedrevid = 409297754
| Watchedfields = changed
| IUPAC_name = (''R'')-2--4-methylphenol
| verifiedrevid = 470611677
| image = Tolterodin Structural Formulae.png
| image = Tolterodine.svg
| width = 250
| width = 200
| alt =
| caption =


<!--Clinical data--> <!-- Clinical data -->
| tradename = Detrol | pronounce =
| tradename = Detrol, Detrusitol, others
| Drugs.com = {{drugs.com|monograph|detrol}}
| Drugs.com = {{drugs.com|monograph|tolterodine}}
| MedlinePlus = a699026 | MedlinePlus = a699026
| DailyMedID = Tolterodine
| pregnancy_category =
| legal_status = | pregnancy_AU = B3
| pregnancy_AU_comment =
| routes_of_administration =
| pregnancy_category=
| routes_of_administration = ]
| class =
| ATC_prefix = G04
| ATC_suffix = BD07
| ATC_supplemental =

<!-- Legal status -->
| legal_AU = S4
| legal_AU_comment =
| legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F -->
| legal_BR_comment =
| legal_CA = Rx-only
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled -->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = POM
| legal_UK_comment = <ref>{{cite web | title=Detrusitol 1mg film-coated tablets - Summary of Product Characteristics (SmPC) | website=(emc) | date=9 March 2021 | url=https://www.medicines.org.uk/emc/product/2243/smpc | access-date=12 May 2022}}</ref>
| legal_US = Rx-only
| legal_US_comment = <ref name="Detrol FDA label">{{cite web | title=Detrol- tolterodine tartrate tablet, film coated | website=DailyMed | date=29 September 2021 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=42f819c9-4108-4ca7-92c5-a213037dd4db | access-date=12 May 2022}}</ref><ref name="Detrol LA FDA label">{{cite web | title=Detrol LA- tolterodine tartrate capsule, extended release | website=DailyMed | date=12 October 2020 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=c98eb213-9c80-4698-9710-a9855059b8bb | access-date=12 May 2022}}</ref>
| legal_EU = Rx-only
| legal_EU_comment =<ref>{{cite web|url=https://www.ema.europa.eu/documents/psusa/tolterodine-list-nationally-authorised-medicinal-products-psusa-00002993-202109_en.pdf|title=List of nationally authorised medicinal products|website=ema.europa.eu|date=5 May 2022|access-date=9 November 2023}}</ref>
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV -->
| legal_UN_comment =
| legal_status = <!-- For countries not listed above -->


<!--Pharmacokinetic data--> <!-- Pharmacokinetic data -->
| bioavailability = 77% | bioavailability = 77%
| protein_bound = Approximately 96.3%. | protein_bound = Approximately 96.3%
| metabolism = | metabolism =
| metabolites =
| elimination_half-life = 1.9-3.7 hours
| onset =
| elimination_half-life = 1.9–3.7 hours
| duration_of_action =
| excretion =


<!--Identifiers--> <!-- Identifiers -->
| index2_label = as salt
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 124937-51-5 | CAS_number = 124937-51-5
| CAS_number2 = 124937-52-6
| ATC_prefix = G04
| CAS_supplemental =
| ATC_suffix = BD07
| ATC_supplemental =
| PubChem = 443879 | PubChem = 443879
| PubChem2 = 443878
| IUPHAR_ligand = 360
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01036 | DrugBank = DB01036
| DrugBank2 = DBSALT000467
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 391967 | ChemSpiderID = 391967
| ChemSpiderID2 = 391966
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = WHE7A56U7K | UNII = WHE7A56U7K
| UNII2 = 5T619TQR3R
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00646 | KEGG = D00646
| KEGG2 = D01148
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9622 | ChEBI = 9622
| ChEBI2 = 32245
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1382 | ChEMBL = 1382
| ChEMBL2 = 1200871
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = PNU-200583E


<!--Chemical data--> <!-- Chemical and physical data -->
| IUPAC_name = (''S'')-2--4-methylphenol
| C=22 | H=31 | N=1 | O=1
| C=22 | H=31 | N=1 | O=1
| molecular_weight = 325.488 g/mol
| smiles = Oc1ccc(cc1(c2ccccc2)CCN(C(C)C)C(C)C)C | SMILES = Cc1ccc(c(c1)(CCN(C(C)C)C(C)C)c2ccccc2)O
| InChI = 1/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1
| InChIKey = OOGJQPCLVADCPB-HXUWFJFHBV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1 | StdInChI = 1S/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1
| StdInChI_comment =
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OOGJQPCLVADCPB-HXUWFJFHSA-N | StdInChIKey = OOGJQPCLVADCPB-HXUWFJFHSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}} }}

<!-- Definition and medical uses -->
'''Tolterodine''', sold under the brand name '''Detrol''' among others, is a ] used to treat ], ], or ].<ref name=BNF76>{{cite book|title=British national formulary : BNF 76|date=2018|publisher=Pharmaceutical Press|isbn=9780857113382|pages=762|edition=76}}</ref> Effects are seen within an hour.<ref name=AHFS2019/> It is taken by mouth.<ref name=AHFS2019/><ref name="pmid32491781">{{cite book | vauthors = Narain S, Parmar M | chapter = Tolterodine | title = StatPearls . | location = Treasure Island (FL) | publisher = StatPearls Publishing | date = January 2021 | pmid = 32491781 | chapter-url = https://www.ncbi.nlm.nih.gov/books/NBK557858/ }}</ref>

<!-- Side effects and mechanisms -->
Common side effects include headache, dry mouth, constipation, and dizziness.<ref name=AHFS2019/> Serious side effects may include ], ], and ].<ref name=AHFS2019/> Use in ] and ] are of unclear safety.<ref name=BNF76/><ref name=Preg2019>{{cite web |title=Tolterodine Pregnancy and Breastfeeding Warnings |url=https://www.drugs.com/pregnancy/tolterodine.html |website=Drugs.com |access-date=3 March 2019 }}</ref> It works by ] in the ] thus decreasing bladder contractions.<ref name=AHFS2019>{{cite web |title=Tolterodine Tartrate Monograph for Professionals |url=https://www.drugs.com/monograph/tolterodine.html |website=Drugs.com |publisher=American Society of Health-System Pharmacists |access-date=3 March 2019 }}</ref>

<!-- Society and culture -->
Tolterodine was approved for medical use in 1998.<ref name=AHFS2019/> It is available as a ].<ref name=BNF76/> In 2020, it was the 271st most commonly prescribed medication in the United States, with more than 1{{nbsp}}million prescriptions.<ref>{{cite web | title = The Top 300 of 2020 | url = https://clincalc.com/DrugStats/Top300Drugs.aspx | website = ClinCalc | access-date = 7 October 2022}}</ref><ref>{{cite web | title = Tolterodine - Drug Usage Statistics | website = ClinCalc | url = https://clincalc.com/DrugStats/Drugs/Tolterodine | access-date = 7 October 2022}}</ref>

==Medical uses==
Detrusor overactivity (DO, contraction of the muscular bladder wall) is the most common form of urinary incontinence (UI) in older adults.{{Medical citation needed|date=May 2022}} It is characterized by uninhibited bladder contractions causing an uncontrollable urge to void.{{Medical citation needed|date=May 2022}} Urinary frequency, urge incontinence and nocturnal incontinence occur.{{Medical citation needed|date=May 2022}} Abnormal bladder contractions that coincide with the urge to void can be measured by ].{{Medical citation needed|date=May 2022}} Treatment is bladder retraining,<ref>{{cite web | url = https://www.ichelp.org/diagnosis-treatment/management-of-ic-pain/bladder-retraining/ | title = Bladder retraining | publisher = Interstitial Cystitis Association | access-date = 6 June 2018 | archive-date = 28 July 2018 | archive-url = https://web.archive.org/web/20180728000635/https://www.ichelp.org/diagnosis-treatment/management-of-ic-pain/bladder-retraining/ | url-status = dead }}</ref>{{Unreliable medical source|date=May 2022}} ] or with drugs that inhibit bladder contractions such as ] and tolterodine.{{Medical citation needed|date=May 2022}}

== Side effects ==
{{Unreferenced section|date=May 2022}}

Known side effects:
* ]
* ] (upset stomach)
* ]
* ]
* ]
* ]
* ]

The following reactions have been reported in people who have taken tolterodine since it has become available:
* ] including swelling
* ] or ]
* ] in the arms and legs
* ]

Tolterodine is not recommended for use in people with ] and ].

== Pharmacology ==
Tolterodine acts on M<sub>2</sub> and M<sub>3</sub><ref>{{cite web | title = Tolterodine | url = http://www.drugbank.ca/drugs/DB01036 | work = DrugBank }}</ref> subtypes of ]s whereas older ] treatments for overactive bladder act more specifically on M<sub>3</sub> receptors.{{Medical citation needed|date=May 2022}}

Tolterodine, although it acts on all types of receptors, has fewer side effects than ] (M<sub>3</sub> and M<sub>1</sub> selective, but more so in the parotid than in the bladder) as tolterodine targets the bladder more than other areas of the body.{{Medical citation needed|date=May 2022}}

== Society and culture ==

=== Brand names ===
It is marketed by ] in Canada and the United States under the brand name Detrol. In Egypt it is also found under the trade names Tolterodine by Sabaa and Incont L.A. by Adwia.

In the US, Detrol is marketed by ] after Upjohn was spun off from Pfizer.<ref>{{cite web | title=Pfizer Completes Transaction to Combine Its Upjohn Business with Mylan | publisher=Pfizer | via=Business Wire | date=16 November 2020 | url=https://www.businesswire.com/news/home/20201116005378/en/ | access-date=17 June 2024}}</ref><ref>{{cite web | title=Detrol | website=Pfizer | url=https://www.pfizer.com/products/product-detail/detrol | access-date=17 June 2024}}</ref><ref>{{cite web | title=Brands | website=Viatris | date=16 November 2020 | url=https://www.viatris.com/en/products/brands | access-date=17 June 2024}}</ref>

== References ==
{{Reflist}}

{{Urologicals}}
{{Hallucinogens}}
{{Ion channel modulators}}
{{Muscarinic acetylcholine receptor modulators}}
{{Portal bar | Medicine}}

]
]
]
]
]
]
]
]
]
]
]